Merge branch 'develop' into matthew/whitelist-uri-schemes
This commit is contained in:
@@ -15,7 +15,8 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
/**
|
||||
* Allows a user to add a third party identifier to their Home Server and,
|
||||
@@ -43,8 +44,8 @@ class AddThreepid {
|
||||
this.sessionId = res.sid;
|
||||
return res;
|
||||
}, function(err) {
|
||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||
err.message = "This email address is already in use";
|
||||
if (err.errcode === 'M_THREEPID_IN_USE') {
|
||||
err.message = _t('This email address is already in use');
|
||||
} else if (err.httpStatus) {
|
||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||
}
|
||||
@@ -68,8 +69,8 @@ class AddThreepid {
|
||||
this.sessionId = res.sid;
|
||||
return res;
|
||||
}, function(err) {
|
||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||
err.message = "This phone number is already in use";
|
||||
if (err.errcode === 'M_THREEPID_IN_USE') {
|
||||
err.message = _t('This phone number is already in use');
|
||||
} else if (err.httpStatus) {
|
||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||
}
|
||||
@@ -84,16 +85,15 @@ class AddThreepid {
|
||||
* the request failed.
|
||||
*/
|
||||
checkEmailLinkClicked() {
|
||||
var identityServerDomain = MatrixClientPeg.get().idBaseUrl.split("://")[1];
|
||||
const identityServerDomain = MatrixClientPeg.get().idBaseUrl.split("://")[1];
|
||||
return MatrixClientPeg.get().addThreePid({
|
||||
sid: this.sessionId,
|
||||
client_secret: this.clientSecret,
|
||||
id_server: identityServerDomain
|
||||
id_server: identityServerDomain,
|
||||
}, this.bind).catch(function(err) {
|
||||
if (err.httpStatus === 401) {
|
||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
||||
}
|
||||
else if (err.httpStatus) {
|
||||
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||
} else if (err.httpStatus) {
|
||||
err.message += ` (Status ${err.httpStatus})`;
|
||||
}
|
||||
throw err;
|
||||
@@ -103,6 +103,7 @@ class AddThreepid {
|
||||
/**
|
||||
* Takes a phone number verification code as entered by the user and validates
|
||||
* it with the ID server, then if successful, adds the phone number.
|
||||
* @param {string} token phone number verification code as entered by the user
|
||||
* @return {Promise} Resolves if the phone number was added. Rejects with an object
|
||||
* with a "message" property which contains a human-readable message detailing why
|
||||
* the request failed.
|
||||
@@ -118,7 +119,7 @@ class AddThreepid {
|
||||
return MatrixClientPeg.get().addThreePid({
|
||||
sid: this.sessionId,
|
||||
client_secret: this.clientSecret,
|
||||
id_server: identityServerDomain
|
||||
id_server: identityServerDomain,
|
||||
}, this.bind);
|
||||
});
|
||||
}
|
||||
|
||||
153
src/Analytics.js
Normal file
153
src/Analytics.js
Normal file
@@ -0,0 +1,153 @@
|
||||
/*
|
||||
Copyright 2017 Michael Telatynski <7t3chguy@gmail.com>
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import { getCurrentLanguage } from './languageHandler';
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import PlatformPeg from './PlatformPeg';
|
||||
import SdkConfig from './SdkConfig';
|
||||
|
||||
function getRedactedUrl() {
|
||||
const redactedHash = window.location.hash.replace(/#\/(room|user)\/(.+)/, "#/$1/<redacted>");
|
||||
// hardcoded url to make piwik happy
|
||||
return 'https://riot.im/app/' + redactedHash;
|
||||
}
|
||||
|
||||
const customVariables = {
|
||||
'App Platform': 1,
|
||||
'App Version': 2,
|
||||
'User Type': 3,
|
||||
'Chosen Language': 4,
|
||||
'Instance': 5,
|
||||
};
|
||||
|
||||
|
||||
class Analytics {
|
||||
constructor() {
|
||||
this._paq = null;
|
||||
this.disabled = true;
|
||||
this.firstPage = true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enable Analytics if initialized but disabled
|
||||
* otherwise try and initalize, no-op if piwik config missing
|
||||
*/
|
||||
enable() {
|
||||
if (this._paq || this._init()) {
|
||||
this.disabled = false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Disable Analytics calls, will not fully unload Piwik until a refresh,
|
||||
* but this is second best, Piwik should not pull anything implicitly.
|
||||
*/
|
||||
disable() {
|
||||
this.trackEvent('Analytics', 'opt-out');
|
||||
this.disabled = true;
|
||||
}
|
||||
|
||||
_init() {
|
||||
const config = SdkConfig.get();
|
||||
if (!config || !config.piwik || !config.piwik.url || !config.piwik.siteId) return;
|
||||
|
||||
const url = config.piwik.url;
|
||||
const siteId = config.piwik.siteId;
|
||||
const self = this;
|
||||
|
||||
window._paq = this._paq = window._paq || [];
|
||||
|
||||
this._paq.push(['setTrackerUrl', url+'piwik.php']);
|
||||
this._paq.push(['setSiteId', siteId]);
|
||||
|
||||
this._paq.push(['trackAllContentImpressions']);
|
||||
this._paq.push(['discardHashTag', false]);
|
||||
this._paq.push(['enableHeartBeatTimer']);
|
||||
this._paq.push(['enableLinkTracking', true]);
|
||||
|
||||
const platform = PlatformPeg.get();
|
||||
this._setVisitVariable('App Platform', platform.getHumanReadableName());
|
||||
platform.getAppVersion().then((version) => {
|
||||
this._setVisitVariable('App Version', version);
|
||||
}).catch(() => {
|
||||
this._setVisitVariable('App Version', 'unknown');
|
||||
});
|
||||
|
||||
this._setVisitVariable('Chosen Language', getCurrentLanguage());
|
||||
|
||||
if (window.location.hostname === 'riot.im') {
|
||||
this._setVisitVariable('Instance', window.location.pathname);
|
||||
}
|
||||
|
||||
(function() {
|
||||
const g = document.createElement('script');
|
||||
const s = document.getElementsByTagName('script')[0];
|
||||
g.type='text/javascript'; g.async=true; g.defer=true; g.src=url+'piwik.js';
|
||||
|
||||
g.onload = function() {
|
||||
console.log('Initialised anonymous analytics');
|
||||
self._paq = window._paq;
|
||||
};
|
||||
|
||||
s.parentNode.insertBefore(g, s);
|
||||
})();
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
trackPageChange() {
|
||||
if (this.disabled) return;
|
||||
if (this.firstPage) {
|
||||
// De-duplicate first page
|
||||
// router seems to hit the fn twice
|
||||
this.firstPage = false;
|
||||
return;
|
||||
}
|
||||
this._paq.push(['setCustomUrl', getRedactedUrl()]);
|
||||
this._paq.push(['trackPageView']);
|
||||
}
|
||||
|
||||
trackEvent(category, action, name) {
|
||||
if (this.disabled) return;
|
||||
this._paq.push(['trackEvent', category, action, name]);
|
||||
}
|
||||
|
||||
logout() {
|
||||
if (this.disabled) return;
|
||||
this._paq.push(['deleteCookies']);
|
||||
}
|
||||
|
||||
login() { // not used currently
|
||||
const cli = MatrixClientPeg.get();
|
||||
if (this.disabled || !cli) return;
|
||||
|
||||
this._paq.push(['setUserId', `@${cli.getUserIdLocalpart()}:${cli.getDomain()}`]);
|
||||
}
|
||||
|
||||
_setVisitVariable(key, value) {
|
||||
this._paq.push(['setCustomVariable', customVariables[key], key, value, 'visit']);
|
||||
}
|
||||
|
||||
setGuest(guest) {
|
||||
if (this.disabled) return;
|
||||
this._setVisitVariable('User Type', guest ? 'Guest' : 'Logged In');
|
||||
}
|
||||
}
|
||||
|
||||
if (!global.mxAnalytics) {
|
||||
global.mxAnalytics = new Analytics();
|
||||
}
|
||||
module.exports = global.mxAnalytics;
|
||||
@@ -15,18 +15,18 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
'use strict';
|
||||
var ContentRepo = require("matrix-js-sdk").ContentRepo;
|
||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||
import {ContentRepo} from 'matrix-js-sdk';
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
|
||||
module.exports = {
|
||||
avatarUrlForMember: function(member, width, height, resizeMethod) {
|
||||
var url = member.getAvatarUrl(
|
||||
let url = member.getAvatarUrl(
|
||||
MatrixClientPeg.get().getHomeserverUrl(),
|
||||
width,
|
||||
height,
|
||||
Math.floor(width * window.devicePixelRatio),
|
||||
Math.floor(height * window.devicePixelRatio),
|
||||
resizeMethod,
|
||||
false,
|
||||
false
|
||||
false,
|
||||
);
|
||||
if (!url) {
|
||||
// member can be null here currently since on invites, the JS SDK
|
||||
@@ -38,9 +38,11 @@ module.exports = {
|
||||
},
|
||||
|
||||
avatarUrlForUser: function(user, width, height, resizeMethod) {
|
||||
var url = ContentRepo.getHttpUriForMxc(
|
||||
const url = ContentRepo.getHttpUriForMxc(
|
||||
MatrixClientPeg.get().getHomeserverUrl(), user.avatarUrl,
|
||||
width, height, resizeMethod
|
||||
Math.floor(width * window.devicePixelRatio),
|
||||
Math.floor(height * window.devicePixelRatio),
|
||||
resizeMethod,
|
||||
);
|
||||
if (!url || url.length === 0) {
|
||||
return null;
|
||||
@@ -49,12 +51,11 @@ module.exports = {
|
||||
},
|
||||
|
||||
defaultAvatarUrlForString: function(s) {
|
||||
var images = ['76cfa6', '50e2c2', 'f4c371'];
|
||||
var total = 0;
|
||||
for (var i = 0; i < s.length; ++i) {
|
||||
const images = ['76cfa6', '50e2c2', 'f4c371'];
|
||||
let total = 0;
|
||||
for (let i = 0; i < s.length; ++i) {
|
||||
total += s.charCodeAt(i);
|
||||
}
|
||||
return 'img/' + images[total % images.length] + '.png';
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
|
||||
@@ -17,6 +17,8 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import dis from './dispatcher';
|
||||
|
||||
/**
|
||||
* Base class for classes that provide platform-specific functionality
|
||||
* eg. Setting an application badge or displaying notifications
|
||||
@@ -27,6 +29,21 @@ export default class BasePlatform {
|
||||
constructor() {
|
||||
this.notificationCount = 0;
|
||||
this.errorDidOccur = false;
|
||||
|
||||
dis.register(this._onAction.bind(this));
|
||||
}
|
||||
|
||||
_onAction(payload: Object) {
|
||||
switch (payload.action) {
|
||||
case 'on_logged_out':
|
||||
this.setNotificationCount(0);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Used primarily for Analytics
|
||||
getHumanReadableName(): string {
|
||||
return 'Base Platform';
|
||||
}
|
||||
|
||||
setNotificationCount(count: number) {
|
||||
@@ -40,6 +57,7 @@ export default class BasePlatform {
|
||||
/**
|
||||
* Returns true if the platform supports displaying
|
||||
* notifications, otherwise false.
|
||||
* @returns {boolean} whether the platform supports displaying notifications
|
||||
*/
|
||||
supportsNotifications(): boolean {
|
||||
return false;
|
||||
@@ -48,6 +66,7 @@ export default class BasePlatform {
|
||||
/**
|
||||
* Returns true if the application currently has permission
|
||||
* to display notifications. Otherwise false.
|
||||
* @returns {boolean} whether the application has permission to display notifications
|
||||
*/
|
||||
maySendNotifications(): boolean {
|
||||
return false;
|
||||
@@ -66,11 +85,14 @@ export default class BasePlatform {
|
||||
displayNotification(title: string, msg: string, avatarUrl: string, room: Object) {
|
||||
}
|
||||
|
||||
loudNotification(ev: Event, room: Object) {
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns a promise that resolves to a string representing
|
||||
* the current version of the application.
|
||||
*/
|
||||
getAppVersion() {
|
||||
getAppVersion(): Promise<string> {
|
||||
throw new Error("getAppVersion not implemented!");
|
||||
}
|
||||
|
||||
@@ -79,10 +101,12 @@ export default class BasePlatform {
|
||||
* with getUserMedia, return a string explaining why not.
|
||||
* Otherwise, return null.
|
||||
*/
|
||||
screenCaptureErrorString() {
|
||||
screenCaptureErrorString(): string {
|
||||
return "Not implemented";
|
||||
}
|
||||
|
||||
isElectron(): boolean { return false; }
|
||||
|
||||
/**
|
||||
* Restarts the application, without neccessarily reloading
|
||||
* any application code
|
||||
|
||||
@@ -51,12 +51,14 @@ limitations under the License.
|
||||
* }
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||
var PlatformPeg = require("./PlatformPeg");
|
||||
var Modal = require('./Modal');
|
||||
var sdk = require('./index');
|
||||
var Matrix = require("matrix-js-sdk");
|
||||
var dis = require("./dispatcher");
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import UserSettingsStore from './UserSettingsStore';
|
||||
import PlatformPeg from './PlatformPeg';
|
||||
import Modal from './Modal';
|
||||
import sdk from './index';
|
||||
import { _t } from './languageHandler';
|
||||
import Matrix from 'matrix-js-sdk';
|
||||
import dis from './dispatcher';
|
||||
|
||||
global.mxCalls = {
|
||||
//room_id: MatrixCall
|
||||
@@ -142,8 +144,8 @@ function _setCallListeners(call) {
|
||||
play("busyAudio");
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Call Timeout",
|
||||
description: "The remote side failed to pick up."
|
||||
title: _t('Call Timeout'),
|
||||
description: _t('The remote side failed to pick up') + '.',
|
||||
});
|
||||
}
|
||||
else if (oldState === "invite_sent") {
|
||||
@@ -179,7 +181,8 @@ function _setCallState(call, roomId, status) {
|
||||
}
|
||||
dis.dispatch({
|
||||
action: 'call_state',
|
||||
room_id: roomId
|
||||
room_id: roomId,
|
||||
state: status,
|
||||
});
|
||||
}
|
||||
|
||||
@@ -203,8 +206,8 @@ function _onAction(payload) {
|
||||
console.log("Can't capture screen: " + screenCapErrorString);
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Unable to capture screen",
|
||||
description: screenCapErrorString
|
||||
title: _t('Unable to capture screen'),
|
||||
description: screenCapErrorString,
|
||||
});
|
||||
return;
|
||||
}
|
||||
@@ -223,8 +226,8 @@ function _onAction(payload) {
|
||||
if (module.exports.getAnyActiveCall()) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Existing Call",
|
||||
description: "You are already in a call."
|
||||
title: _t('Existing Call'),
|
||||
description: _t('You are already in a call.'),
|
||||
});
|
||||
return; // don't allow >1 call to be placed.
|
||||
}
|
||||
@@ -233,8 +236,8 @@ function _onAction(payload) {
|
||||
if (!MatrixClientPeg.get().supportsVoip()) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "VoIP is unsupported",
|
||||
description: "You cannot place VoIP calls in this browser."
|
||||
title: _t('VoIP is unsupported'),
|
||||
description: _t('You cannot place VoIP calls in this browser.'),
|
||||
});
|
||||
return;
|
||||
}
|
||||
@@ -249,15 +252,15 @@ function _onAction(payload) {
|
||||
if (members.length <= 1) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
description: "You cannot place a call with yourself."
|
||||
description: _t('You cannot place a call with yourself.'),
|
||||
});
|
||||
return;
|
||||
}
|
||||
else if (members.length === 2) {
|
||||
console.log("Place %s call in %s", payload.type, payload.room_id);
|
||||
var call = Matrix.createNewMatrixCall(
|
||||
MatrixClientPeg.get(), payload.room_id
|
||||
);
|
||||
const call = Matrix.createNewMatrixCall(MatrixClientPeg.get(), payload.room_id, {
|
||||
forceTURN: UserSettingsStore.getLocalSetting('webRtcForceTURN', false),
|
||||
});
|
||||
placeCall(call);
|
||||
}
|
||||
else { // > 2
|
||||
@@ -275,14 +278,14 @@ function _onAction(payload) {
|
||||
if (!ConferenceHandler) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
description: "Conference calls are not supported in this client"
|
||||
description: _t('Conference calls are not supported in this client'),
|
||||
});
|
||||
}
|
||||
else if (!MatrixClientPeg.get().supportsVoip()) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "VoIP is unsupported",
|
||||
description: "You cannot place VoIP calls in this browser."
|
||||
title: _t('VoIP is unsupported'),
|
||||
description: _t('You cannot place VoIP calls in this browser.'),
|
||||
});
|
||||
}
|
||||
else if (MatrixClientPeg.get().isRoomEncrypted(payload.room_id)) {
|
||||
@@ -294,14 +297,14 @@ function _onAction(payload) {
|
||||
// Therefore we disable conference calling in E2E rooms.
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
description: "Conference calls are not supported in encrypted rooms",
|
||||
description: _t('Conference calls are not supported in encrypted rooms'),
|
||||
});
|
||||
}
|
||||
else {
|
||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
Modal.createDialog(QuestionDialog, {
|
||||
title: "Warning!",
|
||||
description: "Conference calling is in development and may not be reliable.",
|
||||
title: _t('Warning!'),
|
||||
description: _t('Conference calling is in development and may not be reliable.'),
|
||||
onFinished: confirm=>{
|
||||
if (confirm) {
|
||||
ConferenceHandler.createNewMatrixCall(
|
||||
@@ -312,8 +315,8 @@ function _onAction(payload) {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
console.error("Conference call failed: " + err);
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Failed to set up conference call",
|
||||
description: "Conference call failed.",
|
||||
title: _t('Failed to set up conference call'),
|
||||
description: _t('Conference call failed.') + ' ' + ((err && err.message) ? err.message : ''),
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
64
src/CallMediaHandler.js
Normal file
64
src/CallMediaHandler.js
Normal file
@@ -0,0 +1,64 @@
|
||||
/*
|
||||
Copyright 2017 Michael Telatynski <7t3chguy@gmail.com>
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import UserSettingsStore from './UserSettingsStore';
|
||||
import * as Matrix from 'matrix-js-sdk';
|
||||
|
||||
export default {
|
||||
getDevices: function() {
|
||||
// Only needed for Electron atm, though should work in modern browsers
|
||||
// once permission has been granted to the webapp
|
||||
return navigator.mediaDevices.enumerateDevices().then(function(devices) {
|
||||
const audioIn = [];
|
||||
const videoIn = [];
|
||||
|
||||
if (devices.some((device) => !device.label)) return false;
|
||||
|
||||
devices.forEach((device) => {
|
||||
switch (device.kind) {
|
||||
case 'audioinput': audioIn.push(device); break;
|
||||
case 'videoinput': videoIn.push(device); break;
|
||||
}
|
||||
});
|
||||
|
||||
// console.log("Loaded WebRTC Devices", mediaDevices);
|
||||
return {
|
||||
audioinput: audioIn,
|
||||
videoinput: videoIn,
|
||||
};
|
||||
}, (error) => { console.log('Unable to refresh WebRTC Devices: ', error); });
|
||||
},
|
||||
|
||||
loadDevices: function() {
|
||||
// this.getDevices().then((devices) => {
|
||||
const localSettings = UserSettingsStore.getLocalSettings();
|
||||
// // if deviceId is not found, automatic fallback is in spec
|
||||
// // recall previously stored inputs if any
|
||||
Matrix.setMatrixCallAudioInput(localSettings['webrtc_audioinput']);
|
||||
Matrix.setMatrixCallVideoInput(localSettings['webrtc_videoinput']);
|
||||
// });
|
||||
},
|
||||
|
||||
setAudioInput: function(deviceId) {
|
||||
UserSettingsStore.setLocalSetting('webrtc_audioinput', deviceId);
|
||||
Matrix.setMatrixCallAudioInput(deviceId);
|
||||
},
|
||||
|
||||
setVideoInput: function(deviceId) {
|
||||
UserSettingsStore.setLocalSetting('webrtc_videoinput', deviceId);
|
||||
Matrix.setMatrixCallVideoInput(deviceId);
|
||||
},
|
||||
};
|
||||
82
src/ComposerHistoryManager.js
Normal file
82
src/ComposerHistoryManager.js
Normal file
@@ -0,0 +1,82 @@
|
||||
//@flow
|
||||
/*
|
||||
Copyright 2017 Aviral Dasgupta
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import {ContentState} from 'draft-js';
|
||||
import * as RichText from './RichText';
|
||||
import Markdown from './Markdown';
|
||||
import _flow from 'lodash/flow';
|
||||
import _clamp from 'lodash/clamp';
|
||||
|
||||
type MessageFormat = 'html' | 'markdown';
|
||||
|
||||
class HistoryItem {
|
||||
message: string = '';
|
||||
format: MessageFormat = 'html';
|
||||
|
||||
constructor(message: string, format: MessageFormat) {
|
||||
this.message = message;
|
||||
this.format = format;
|
||||
}
|
||||
|
||||
toContentState(format: MessageFormat): ContentState {
|
||||
let {message} = this;
|
||||
if (format === 'markdown') {
|
||||
if (this.format === 'html') {
|
||||
message = _flow([RichText.htmlToContentState, RichText.stateToMarkdown])(message);
|
||||
}
|
||||
return ContentState.createFromText(message);
|
||||
} else {
|
||||
if (this.format === 'markdown') {
|
||||
message = new Markdown(message).toHTML();
|
||||
}
|
||||
return RichText.htmlToContentState(message);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
export default class ComposerHistoryManager {
|
||||
history: Array<HistoryItem> = [];
|
||||
prefix: string;
|
||||
lastIndex: number = 0;
|
||||
currentIndex: number = 0;
|
||||
|
||||
constructor(roomId: string, prefix: string = 'mx_composer_history_') {
|
||||
this.prefix = prefix + roomId;
|
||||
|
||||
// TODO: Performance issues?
|
||||
let item;
|
||||
for(; item = sessionStorage.getItem(`${this.prefix}[${this.currentIndex}]`); this.currentIndex++) {
|
||||
this.history.push(
|
||||
Object.assign(new HistoryItem(), JSON.parse(item)),
|
||||
);
|
||||
}
|
||||
this.lastIndex = this.currentIndex;
|
||||
}
|
||||
|
||||
addItem(message: string, format: MessageFormat) {
|
||||
const item = new HistoryItem(message, format);
|
||||
this.history.push(item);
|
||||
this.currentIndex = this.lastIndex + 1;
|
||||
sessionStorage.setItem(`${this.prefix}[${this.lastIndex++}]`, JSON.stringify(item));
|
||||
}
|
||||
|
||||
getItem(offset: number, format: MessageFormat): ?ContentState {
|
||||
this.currentIndex = _clamp(this.currentIndex + offset, 0, this.lastIndex - 1);
|
||||
const item = this.history[this.currentIndex];
|
||||
return item ? item.toContentState(format) : null;
|
||||
}
|
||||
}
|
||||
@@ -21,6 +21,7 @@ var extend = require('./extend');
|
||||
var dis = require('./dispatcher');
|
||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||
var sdk = require('./index');
|
||||
import { _t } from './languageHandler';
|
||||
var Modal = require('./Modal');
|
||||
|
||||
var encrypt = require("browser-encrypt-attachment");
|
||||
@@ -347,14 +348,14 @@ class ContentMessages {
|
||||
}, function(err) {
|
||||
error = err;
|
||||
if (!upload.canceled) {
|
||||
var desc = "The file '"+upload.fileName+"' failed to upload.";
|
||||
var desc = _t('The file \'%(fileName)s\' failed to upload', {fileName: upload.fileName}) + '.';
|
||||
if (err.http_status == 413) {
|
||||
desc = "The file '"+upload.fileName+"' exceeds this home server's size limit for uploads";
|
||||
desc = _t('The file \'%(fileName)s\' exceeds this home server\'s size limit for uploads', {fileName: upload.fileName});
|
||||
}
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Upload Failed",
|
||||
description: desc
|
||||
title: _t('Upload Failed'),
|
||||
description: desc,
|
||||
});
|
||||
}
|
||||
}).finally(() => {
|
||||
|
||||
107
src/DateUtils.js
107
src/DateUtils.js
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2015, 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -15,38 +16,90 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
'use strict';
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
var days = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"];
|
||||
var months = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
|
||||
function getDaysArray() {
|
||||
return [
|
||||
_t('Sun'),
|
||||
_t('Mon'),
|
||||
_t('Tue'),
|
||||
_t('Wed'),
|
||||
_t('Thu'),
|
||||
_t('Fri'),
|
||||
_t('Sat'),
|
||||
];
|
||||
}
|
||||
|
||||
function getMonthsArray() {
|
||||
return [
|
||||
_t('Jan'),
|
||||
_t('Feb'),
|
||||
_t('Mar'),
|
||||
_t('Apr'),
|
||||
_t('May'),
|
||||
_t('Jun'),
|
||||
_t('Jul'),
|
||||
_t('Aug'),
|
||||
_t('Sep'),
|
||||
_t('Oct'),
|
||||
_t('Nov'),
|
||||
_t('Dec'),
|
||||
];
|
||||
}
|
||||
|
||||
function pad(n) {
|
||||
return (n < 10 ? '0' : '') + n;
|
||||
}
|
||||
|
||||
function twelveHourTime(date) {
|
||||
let hours = date.getHours() % 12;
|
||||
const minutes = pad(date.getMinutes());
|
||||
const ampm = date.getHours() >= 12 ? _t('PM') : _t('AM');
|
||||
hours = hours ? hours : 12; // convert 0 -> 12
|
||||
return `${hours}:${minutes}${ampm}`;
|
||||
}
|
||||
|
||||
module.exports = {
|
||||
formatDate: function(date) {
|
||||
// date.toLocaleTimeString is completely system dependent.
|
||||
// just go 24h for now
|
||||
function pad(n) {
|
||||
return (n < 10 ? '0' : '') + n;
|
||||
}
|
||||
|
||||
var now = new Date();
|
||||
formatDate: function(date, showTwelveHour=false) {
|
||||
const now = new Date();
|
||||
const days = getDaysArray();
|
||||
const months = getMonthsArray();
|
||||
if (date.toDateString() === now.toDateString()) {
|
||||
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
return this.formatTime(date);
|
||||
} else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
||||
// TODO: use standard date localize function provided in counterpart
|
||||
return _t('%(weekDayName)s %(time)s', {
|
||||
weekDayName: days[date.getDay()],
|
||||
time: this.formatTime(date, showTwelveHour),
|
||||
});
|
||||
} else if (now.getFullYear() === date.getFullYear()) {
|
||||
// TODO: use standard date localize function provided in counterpart
|
||||
return _t('%(weekDayName)s, %(monthName)s %(day)s %(time)s', {
|
||||
weekDayName: days[date.getDay()],
|
||||
monthName: months[date.getMonth()],
|
||||
day: date.getDate(),
|
||||
time: this.formatTime(date),
|
||||
});
|
||||
}
|
||||
else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
||||
return days[date.getDay()] + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
}
|
||||
else /* if (now.getFullYear() === date.getFullYear()) */ {
|
||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
}
|
||||
/*
|
||||
else {
|
||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + date.getFullYear() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
}
|
||||
*/
|
||||
return this.formatFullDate(date, showTwelveHour);
|
||||
},
|
||||
|
||||
formatTime: function(date) {
|
||||
//return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
return ('00' + date.getHours()).slice(-2) + ':' + ('00' + date.getMinutes()).slice(-2);
|
||||
}
|
||||
};
|
||||
formatFullDate: function(date, showTwelveHour=false) {
|
||||
const days = getDaysArray();
|
||||
const months = getMonthsArray();
|
||||
return _t('%(weekDayName)s, %(monthName)s %(day)s %(fullYear)s %(time)s', {
|
||||
weekDayName: days[date.getDay()],
|
||||
monthName: months[date.getMonth()],
|
||||
day: date.getDate(),
|
||||
fullYear: date.getFullYear(),
|
||||
time: showTwelveHour ? twelveHourTime(date) : this.formatTime(date),
|
||||
});
|
||||
},
|
||||
|
||||
formatTime: function(date, showTwelveHour=false) {
|
||||
if (showTwelveHour) {
|
||||
return twelveHourTime(date);
|
||||
}
|
||||
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||
},
|
||||
};
|
||||
|
||||
@@ -14,8 +14,7 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var React = require('react');
|
||||
var sdk = require('./index');
|
||||
import sdk from './index';
|
||||
|
||||
function isMatch(query, name, uid) {
|
||||
query = query.toLowerCase();
|
||||
@@ -33,8 +32,8 @@ function isMatch(query, name, uid) {
|
||||
}
|
||||
|
||||
// split spaces in name and try matching constituent parts
|
||||
var parts = name.split(" ");
|
||||
for (var i = 0; i < parts.length; i++) {
|
||||
const parts = name.split(" ");
|
||||
for (let i = 0; i < parts.length; i++) {
|
||||
if (parts[i].indexOf(query) === 0) {
|
||||
return true;
|
||||
}
|
||||
@@ -67,7 +66,7 @@ class Entity {
|
||||
|
||||
class MemberEntity extends Entity {
|
||||
getJsx() {
|
||||
var MemberTile = sdk.getComponent("rooms.MemberTile");
|
||||
const MemberTile = sdk.getComponent("rooms.MemberTile");
|
||||
return (
|
||||
<MemberTile key={this.model.userId} member={this.model} />
|
||||
);
|
||||
@@ -84,6 +83,7 @@ class UserEntity extends Entity {
|
||||
super(model);
|
||||
this.showInviteButton = Boolean(showInviteButton);
|
||||
this.inviteFn = inviteFn;
|
||||
this.onClick = this.onClick.bind(this);
|
||||
}
|
||||
|
||||
onClick() {
|
||||
@@ -93,15 +93,15 @@ class UserEntity extends Entity {
|
||||
}
|
||||
|
||||
getJsx() {
|
||||
var UserTile = sdk.getComponent("rooms.UserTile");
|
||||
const UserTile = sdk.getComponent("rooms.UserTile");
|
||||
return (
|
||||
<UserTile key={this.model.userId} user={this.model}
|
||||
showInviteButton={this.showInviteButton} onClick={this.onClick.bind(this)} />
|
||||
showInviteButton={this.showInviteButton} onClick={this.onClick} />
|
||||
);
|
||||
}
|
||||
|
||||
matches(queryString) {
|
||||
var name = this.model.displayName || this.model.userId;
|
||||
const name = this.model.displayName || this.model.userId;
|
||||
return isMatch(queryString, name, this.model.userId);
|
||||
}
|
||||
}
|
||||
@@ -109,7 +109,7 @@ class UserEntity extends Entity {
|
||||
|
||||
module.exports = {
|
||||
newEntity: function(jsx, matchFn) {
|
||||
var entity = new Entity();
|
||||
const entity = new Entity();
|
||||
entity.getJsx = function() {
|
||||
return jsx;
|
||||
};
|
||||
@@ -137,5 +137,5 @@ module.exports = {
|
||||
return users.map(function(u) {
|
||||
return new UserEntity(u, showInviteButton, inviteFn);
|
||||
});
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
101
src/HtmlUtils.js
101
src/HtmlUtils.js
@@ -25,6 +25,9 @@ import emojione from 'emojione';
|
||||
import classNames from 'classnames';
|
||||
|
||||
emojione.imagePathSVG = 'emojione/svg/';
|
||||
// Store PNG path for displaying many flags at once (for increased performance over SVG)
|
||||
emojione.imagePathPNG = 'emojione/png/';
|
||||
// Use SVGs for emojis
|
||||
emojione.imageType = 'svg';
|
||||
|
||||
const EMOJI_REGEX = new RegExp(emojione.unicodeRegexp+"+", "gi");
|
||||
@@ -64,17 +67,24 @@ export function unicodeToImage(str) {
|
||||
* emoji.
|
||||
*
|
||||
* @param alt {string} String to use for the image alt text
|
||||
* @param useSvg {boolean} Whether to use SVG image src. If False, PNG will be used.
|
||||
* @param unicode {integer} One or more integers representing unicode characters
|
||||
* @returns A img node with the corresponding emoji
|
||||
*/
|
||||
export function charactersToImageNode(alt, ...unicode) {
|
||||
export function charactersToImageNode(alt, useSvg, ...unicode) {
|
||||
const fileName = unicode.map((u) => {
|
||||
return u.toString(16);
|
||||
}).join('-');
|
||||
return <img alt={alt} src={`${emojione.imagePathSVG}${fileName}.svg${emojione.cacheBustParam}`}/>;
|
||||
const path = useSvg ? emojione.imagePathSVG : emojione.imagePathPNG;
|
||||
const fileType = useSvg ? 'svg' : 'png';
|
||||
return <img
|
||||
alt={alt}
|
||||
src={`${path}${fileName}.${fileType}${emojione.cacheBustParam}`}
|
||||
/>;
|
||||
}
|
||||
|
||||
export function stripParagraphs(html: string): string {
|
||||
|
||||
export function processHtmlForSending(html: string): string {
|
||||
const contentDiv = document.createElement('div');
|
||||
contentDiv.innerHTML = html;
|
||||
|
||||
@@ -83,10 +93,21 @@ export function stripParagraphs(html: string): string {
|
||||
}
|
||||
|
||||
let contentHTML = "";
|
||||
for (let i=0; i<contentDiv.children.length; i++) {
|
||||
for (let i=0; i < contentDiv.children.length; i++) {
|
||||
const element = contentDiv.children[i];
|
||||
if (element.tagName.toLowerCase() === 'p') {
|
||||
contentHTML += element.innerHTML + '<br />';
|
||||
contentHTML += element.innerHTML;
|
||||
// Don't add a <br /> for the last <p>
|
||||
if (i !== contentDiv.children.length - 1) {
|
||||
contentHTML += '<br />';
|
||||
}
|
||||
} else if (element.tagName.toLowerCase() === 'pre') {
|
||||
// Replace "<br>\n" with "\n" within `<pre>` tags because the <br> is
|
||||
// redundant. This is a workaround for a bug in draft-js-export-html:
|
||||
// https://github.com/sstur/draft-js-export-html/issues/62
|
||||
contentHTML += '<pre>' +
|
||||
element.innerHTML.replace(/<br>\n/g, '\n').trim() +
|
||||
'</pre>';
|
||||
} else {
|
||||
const temp = document.createElement('div');
|
||||
temp.appendChild(element.cloneNode(true));
|
||||
@@ -97,12 +118,21 @@ export function stripParagraphs(html: string): string {
|
||||
return contentHTML;
|
||||
}
|
||||
|
||||
var sanitizeHtmlParams = {
|
||||
/*
|
||||
* Given an untrusted HTML string, return a React node with an sanitized version
|
||||
* of that HTML.
|
||||
*/
|
||||
export function sanitizedHtmlNode(insaneHtml) {
|
||||
const saneHtml = sanitizeHtml(insaneHtml, sanitizeHtmlParams);
|
||||
|
||||
return <div dangerouslySetInnerHTML={{ __html: saneHtml }} dir="auto" />;
|
||||
}
|
||||
|
||||
const sanitizeHtmlParams = {
|
||||
allowedTags: [
|
||||
'font', // custom to matrix for IRC-style font coloring
|
||||
'del', // for markdown
|
||||
// deliberately no h1/h2 to stop people shouting.
|
||||
'h3', 'h4', 'h5', 'h6', 'blockquote', 'p', 'a', 'ul', 'ol',
|
||||
'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'blockquote', 'p', 'a', 'ul', 'ol',
|
||||
'nl', 'li', 'b', 'i', 'u', 'strong', 'em', 'strike', 'code', 'hr', 'br', 'div',
|
||||
'table', 'thead', 'caption', 'tbody', 'tr', 'th', 'td', 'pre', 'span', 'img',
|
||||
],
|
||||
@@ -115,6 +145,7 @@ var sanitizeHtmlParams = {
|
||||
// would make sense if we did
|
||||
img: ['src'],
|
||||
ol: ['start'],
|
||||
code: ['class'], // We don't actually allow all classes, we filter them in transformTags
|
||||
},
|
||||
// Lots of these won't come up by default because we don't allow them
|
||||
selfClosing: ['img', 'br', 'hr', 'area', 'base', 'basefont', 'input', 'link', 'meta'],
|
||||
@@ -139,22 +170,36 @@ var sanitizeHtmlParams = {
|
||||
attribs.href = m[1];
|
||||
delete attribs.target;
|
||||
}
|
||||
|
||||
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
||||
if (m) {
|
||||
var entity = m[1];
|
||||
if (entity[0] === '@') {
|
||||
attribs.href = '#/user/' + entity;
|
||||
else {
|
||||
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
||||
if (m) {
|
||||
var entity = m[1];
|
||||
if (entity[0] === '@') {
|
||||
attribs.href = '#/user/' + entity;
|
||||
}
|
||||
else if (entity[0] === '#' || entity[0] === '!') {
|
||||
attribs.href = '#/room/' + entity;
|
||||
}
|
||||
delete attribs.target;
|
||||
}
|
||||
else if (entity[0] === '#' || entity[0] === '!') {
|
||||
attribs.href = '#/room/' + entity;
|
||||
}
|
||||
delete attribs.target;
|
||||
}
|
||||
}
|
||||
attribs.rel = 'noopener'; // https://mathiasbynens.github.io/rel-noopener/
|
||||
return { tagName: tagName, attribs : attribs };
|
||||
},
|
||||
'code': function(tagName, attribs) {
|
||||
if (typeof attribs.class !== 'undefined') {
|
||||
// Filter out all classes other than ones starting with language- for syntax highlighting.
|
||||
let classes = attribs.class.split(/\s+/).filter(function(cl) {
|
||||
return cl.startsWith('language-');
|
||||
});
|
||||
attribs.class = classes.join(' ');
|
||||
}
|
||||
return {
|
||||
tagName: tagName,
|
||||
attribs: attribs,
|
||||
};
|
||||
},
|
||||
'*': function(tagName, attribs) {
|
||||
// Delete any style previously assigned, style is an allowedTag for font and span
|
||||
// because attributes are stripped after transforming
|
||||
@@ -335,6 +380,7 @@ export function bodyToHtml(content, highlights, opts) {
|
||||
}
|
||||
safeBody = sanitizeHtml(body, sanitizeHtmlParams);
|
||||
safeBody = unicodeToImage(safeBody);
|
||||
safeBody = addCodeCopyButton(safeBody);
|
||||
}
|
||||
finally {
|
||||
delete sanitizeHtmlParams.textFilter;
|
||||
@@ -350,7 +396,24 @@ export function bodyToHtml(content, highlights, opts) {
|
||||
'mx_EventTile_bigEmoji': emojiBody,
|
||||
'markdown-body': isHtml,
|
||||
});
|
||||
return <span className={className} dangerouslySetInnerHTML={{ __html: safeBody }} />;
|
||||
return <span className={className} dangerouslySetInnerHTML={{ __html: safeBody }} dir="auto" />;
|
||||
}
|
||||
|
||||
function addCodeCopyButton(safeBody) {
|
||||
// Adds 'copy' buttons to pre blocks
|
||||
// Note that this only manipulates the markup to add the buttons:
|
||||
// we need to add the event handlers once the nodes are in the DOM
|
||||
// since we can't save functions in the markup.
|
||||
// This is done in TextualBody
|
||||
const el = document.createElement("div");
|
||||
el.innerHTML = safeBody;
|
||||
const codeBlocks = Array.from(el.getElementsByTagName("pre"));
|
||||
codeBlocks.forEach(p => {
|
||||
const button = document.createElement("span");
|
||||
button.className = "mx_EventTile_copyButton";
|
||||
p.appendChild(button);
|
||||
});
|
||||
return el.innerHTML;
|
||||
}
|
||||
|
||||
export function emojifyText(text) {
|
||||
|
||||
@@ -30,6 +30,30 @@ module.exports = {
|
||||
RIGHT: 39,
|
||||
DOWN: 40,
|
||||
DELETE: 46,
|
||||
KEY_A: 65,
|
||||
KEY_B: 66,
|
||||
KEY_C: 67,
|
||||
KEY_D: 68,
|
||||
KEY_E: 69,
|
||||
KEY_F: 70,
|
||||
KEY_G: 71,
|
||||
KEY_H: 72,
|
||||
KEY_I: 73,
|
||||
KEY_J: 74,
|
||||
KEY_K: 75,
|
||||
KEY_L: 76,
|
||||
KEY_M: 77,
|
||||
KEY_N: 78,
|
||||
KEY_O: 79,
|
||||
KEY_P: 80,
|
||||
KEY_Q: 81,
|
||||
KEY_R: 82,
|
||||
KEY_S: 83,
|
||||
KEY_T: 84,
|
||||
KEY_U: 85,
|
||||
KEY_V: 86,
|
||||
KEY_W: 87,
|
||||
KEY_X: 88,
|
||||
KEY_Y: 89,
|
||||
KEY_Z: 90,
|
||||
};
|
||||
|
||||
138
src/KeyRequestHandler.js
Normal file
138
src/KeyRequestHandler.js
Normal file
@@ -0,0 +1,138 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import sdk from './index';
|
||||
import Modal from './Modal';
|
||||
|
||||
export default class KeyRequestHandler {
|
||||
constructor(matrixClient) {
|
||||
this._matrixClient = matrixClient;
|
||||
|
||||
// the user/device for which we currently have a dialog open
|
||||
this._currentUser = null;
|
||||
this._currentDevice = null;
|
||||
|
||||
// userId -> deviceId -> [keyRequest]
|
||||
this._pendingKeyRequests = Object.create(null);
|
||||
}
|
||||
|
||||
handleKeyRequest(keyRequest) {
|
||||
const userId = keyRequest.userId;
|
||||
const deviceId = keyRequest.deviceId;
|
||||
const requestId = keyRequest.requestId;
|
||||
|
||||
if (!this._pendingKeyRequests[userId]) {
|
||||
this._pendingKeyRequests[userId] = Object.create(null);
|
||||
}
|
||||
if (!this._pendingKeyRequests[userId][deviceId]) {
|
||||
this._pendingKeyRequests[userId][deviceId] = [];
|
||||
}
|
||||
|
||||
// check if we already have this request
|
||||
const requests = this._pendingKeyRequests[userId][deviceId];
|
||||
if (requests.find((r) => r.requestId === requestId)) {
|
||||
console.log("Already have this key request, ignoring");
|
||||
return;
|
||||
}
|
||||
|
||||
requests.push(keyRequest);
|
||||
|
||||
if (this._currentUser) {
|
||||
// ignore for now
|
||||
console.log("Key request, but we already have a dialog open");
|
||||
return;
|
||||
}
|
||||
|
||||
this._processNextRequest();
|
||||
}
|
||||
|
||||
handleKeyRequestCancellation(cancellation) {
|
||||
// see if we can find the request in the queue
|
||||
const userId = cancellation.userId;
|
||||
const deviceId = cancellation.deviceId;
|
||||
const requestId = cancellation.requestId;
|
||||
|
||||
if (userId === this._currentUser && deviceId === this._currentDevice) {
|
||||
console.log(
|
||||
"room key request cancellation for the user we currently have a"
|
||||
+ " dialog open for",
|
||||
);
|
||||
// TODO: update the dialog. For now, we just ignore the
|
||||
// cancellation.
|
||||
return;
|
||||
}
|
||||
|
||||
if (!this._pendingKeyRequests[userId]) {
|
||||
return;
|
||||
}
|
||||
const requests = this._pendingKeyRequests[userId][deviceId];
|
||||
if (!requests) {
|
||||
return;
|
||||
}
|
||||
const idx = requests.findIndex((r) => r.requestId === requestId);
|
||||
if (idx < 0) {
|
||||
return;
|
||||
}
|
||||
console.log("Forgetting room key request");
|
||||
requests.splice(idx, 1);
|
||||
if (requests.length === 0) {
|
||||
delete this._pendingKeyRequests[userId][deviceId];
|
||||
if (Object.keys(this._pendingKeyRequests[userId]).length === 0) {
|
||||
delete this._pendingKeyRequests[userId];
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_processNextRequest() {
|
||||
const userId = Object.keys(this._pendingKeyRequests)[0];
|
||||
if (!userId) {
|
||||
return;
|
||||
}
|
||||
const deviceId = Object.keys(this._pendingKeyRequests[userId])[0];
|
||||
if (!deviceId) {
|
||||
return;
|
||||
}
|
||||
console.log(`Starting KeyShareDialog for ${userId}:${deviceId}`);
|
||||
|
||||
const finished = (r) => {
|
||||
this._currentUser = null;
|
||||
this._currentDevice = null;
|
||||
|
||||
if (r) {
|
||||
for (const req of this._pendingKeyRequests[userId][deviceId]) {
|
||||
req.share();
|
||||
}
|
||||
}
|
||||
delete this._pendingKeyRequests[userId][deviceId];
|
||||
if (Object.keys(this._pendingKeyRequests[userId]).length === 0) {
|
||||
delete this._pendingKeyRequests[userId];
|
||||
}
|
||||
|
||||
this._processNextRequest();
|
||||
};
|
||||
|
||||
const KeyShareDialog = sdk.getComponent("dialogs.KeyShareDialog");
|
||||
Modal.createDialog(KeyShareDialog, {
|
||||
matrixClient: this._matrixClient,
|
||||
userId: userId,
|
||||
deviceId: deviceId,
|
||||
onFinished: finished,
|
||||
});
|
||||
this._currentUser = userId;
|
||||
this._currentDevice = deviceId;
|
||||
}
|
||||
}
|
||||
|
||||
319
src/Lifecycle.js
319
src/Lifecycle.js
@@ -19,6 +19,8 @@ import q from 'q';
|
||||
import Matrix from 'matrix-js-sdk';
|
||||
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import createMatrixClient from './utils/createMatrixClient';
|
||||
import Analytics from './Analytics';
|
||||
import Notifier from './Notifier';
|
||||
import UserActivity from './UserActivity';
|
||||
import Presence from './Presence';
|
||||
@@ -32,28 +34,19 @@ import sdk from './index';
|
||||
* Called at startup, to attempt to build a logged-in Matrix session. It tries
|
||||
* a number of things:
|
||||
*
|
||||
* 0. if it looks like we are in the middle of a registration process, it does
|
||||
* nothing.
|
||||
*
|
||||
* 1. if we have a loginToken in the (real) query params, it uses that to log
|
||||
* in.
|
||||
*
|
||||
* 2. if we have a guest access token in the fragment query params, it uses
|
||||
* 1. if we have a guest access token in the fragment query params, it uses
|
||||
* that.
|
||||
*
|
||||
* 3. if an access token is stored in local storage (from a previous session),
|
||||
* 2. if an access token is stored in local storage (from a previous session),
|
||||
* it uses that.
|
||||
*
|
||||
* 4. it attempts to auto-register as a guest user.
|
||||
* 3. it attempts to auto-register as a guest user.
|
||||
*
|
||||
* If any of steps 1-4 are successful, it will call {setLoggedIn}, which in
|
||||
* If any of steps 1-4 are successful, it will call {_doSetLoggedIn}, which in
|
||||
* turn will raise on_logged_in and will_start_client events.
|
||||
*
|
||||
* It returns a promise which resolves when the above process completes.
|
||||
*
|
||||
* @param {object} opts.realQueryParams: string->string map of the
|
||||
* query-parameters extracted from the real query-string of the starting
|
||||
* URI.
|
||||
* @param {object} opts
|
||||
*
|
||||
* @param {object} opts.fragmentQueryParams: string->string map of the
|
||||
* query-parameters extracted from the #-fragment of the starting URI.
|
||||
@@ -67,54 +60,39 @@ import sdk from './index';
|
||||
* @params {string} opts.guestIsUrl: homeserver URL. Only used if enableGuest is
|
||||
* true; defines the IS to use.
|
||||
*
|
||||
* @returns {Promise} a promise which resolves when the above process completes.
|
||||
* Resolves to `true` if we ended up starting a session, or `false` if we
|
||||
* failed.
|
||||
*/
|
||||
export function loadSession(opts) {
|
||||
const realQueryParams = opts.realQueryParams || {};
|
||||
const fragmentQueryParams = opts.fragmentQueryParams || {};
|
||||
let enableGuest = opts.enableGuest || false;
|
||||
const guestHsUrl = opts.guestHsUrl;
|
||||
const guestIsUrl = opts.guestIsUrl;
|
||||
const defaultDeviceDisplayName = opts.defaultDeviceDisplayName;
|
||||
|
||||
if (fragmentQueryParams.client_secret && fragmentQueryParams.sid) {
|
||||
// this happens during email validation: the email contains a link to the
|
||||
// IS, which in turn redirects back to vector. We let MatrixChat create a
|
||||
// Registration component which completes the next stage of registration.
|
||||
console.log("Not registering as guest: registration already in progress.");
|
||||
return q();
|
||||
}
|
||||
|
||||
if (!guestHsUrl) {
|
||||
console.warn("Cannot enable guest access: can't determine HS URL to use");
|
||||
enableGuest = false;
|
||||
}
|
||||
|
||||
if (realQueryParams.loginToken) {
|
||||
if (!realQueryParams.homeserver) {
|
||||
console.warn("Cannot log in with token: can't determine HS URL to use");
|
||||
} else {
|
||||
return _loginWithToken(realQueryParams, defaultDeviceDisplayName);
|
||||
}
|
||||
}
|
||||
|
||||
if (enableGuest &&
|
||||
fragmentQueryParams.guest_user_id &&
|
||||
fragmentQueryParams.guest_access_token
|
||||
) {
|
||||
console.log("Using guest access credentials");
|
||||
setLoggedIn({
|
||||
return _doSetLoggedIn({
|
||||
userId: fragmentQueryParams.guest_user_id,
|
||||
accessToken: fragmentQueryParams.guest_access_token,
|
||||
homeserverUrl: guestHsUrl,
|
||||
identityServerUrl: guestIsUrl,
|
||||
guest: true,
|
||||
});
|
||||
return q();
|
||||
}, true).then(() => true);
|
||||
}
|
||||
|
||||
return _restoreFromLocalStorage().then((success) => {
|
||||
if (success) {
|
||||
return;
|
||||
return true;
|
||||
}
|
||||
|
||||
if (enableGuest) {
|
||||
@@ -122,12 +100,32 @@ export function loadSession(opts) {
|
||||
}
|
||||
|
||||
// fall back to login screen
|
||||
return false;
|
||||
});
|
||||
}
|
||||
|
||||
function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
||||
/**
|
||||
* @param {Object} queryParams string->string map of the
|
||||
* query-parameters extracted from the real query-string of the starting
|
||||
* URI.
|
||||
*
|
||||
* @param {String} defaultDeviceDisplayName
|
||||
*
|
||||
* @returns {Promise} promise which resolves to true if we completed the token
|
||||
* login, else false
|
||||
*/
|
||||
export function attemptTokenLogin(queryParams, defaultDeviceDisplayName) {
|
||||
if (!queryParams.loginToken) {
|
||||
return q(false);
|
||||
}
|
||||
|
||||
if (!queryParams.homeserver) {
|
||||
console.warn("Cannot log in with token: can't determine HS URL to use");
|
||||
return q(false);
|
||||
}
|
||||
|
||||
// create a temporary MatrixClient to do the login
|
||||
var client = Matrix.createClient({
|
||||
const client = Matrix.createClient({
|
||||
baseUrl: queryParams.homeserver,
|
||||
});
|
||||
|
||||
@@ -138,28 +136,32 @@ function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
||||
},
|
||||
).then(function(data) {
|
||||
console.log("Logged in with token");
|
||||
setLoggedIn({
|
||||
userId: data.user_id,
|
||||
deviceId: data.device_id,
|
||||
accessToken: data.access_token,
|
||||
homeserverUrl: queryParams.homeserver,
|
||||
identityServerUrl: queryParams.identityServer,
|
||||
guest: false,
|
||||
return _clearStorage().then(() => {
|
||||
_persistCredentialsToLocalStorage({
|
||||
userId: data.user_id,
|
||||
deviceId: data.device_id,
|
||||
accessToken: data.access_token,
|
||||
homeserverUrl: queryParams.homeserver,
|
||||
identityServerUrl: queryParams.identityServer,
|
||||
guest: false,
|
||||
});
|
||||
return true;
|
||||
});
|
||||
}, (err) => {
|
||||
}).catch((err) => {
|
||||
console.error("Failed to log in with login token: " + err + " " +
|
||||
err.data);
|
||||
return false;
|
||||
});
|
||||
}
|
||||
|
||||
function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
||||
console.log("Doing guest login on %s", hsUrl);
|
||||
console.log(`Doing guest login on ${hsUrl}`);
|
||||
|
||||
// TODO: we should probably de-duplicate this and Login.loginAsGuest.
|
||||
// Not really sure where the right home for it is.
|
||||
|
||||
// create a temporary MatrixClient to do the login
|
||||
var client = Matrix.createClient({
|
||||
const client = Matrix.createClient({
|
||||
baseUrl: hsUrl,
|
||||
});
|
||||
|
||||
@@ -168,52 +170,60 @@ function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
||||
initial_device_display_name: defaultDeviceDisplayName,
|
||||
},
|
||||
}).then((creds) => {
|
||||
console.log("Registered as guest: %s", creds.user_id);
|
||||
setLoggedIn({
|
||||
console.log(`Registered as guest: ${creds.user_id}`);
|
||||
return _doSetLoggedIn({
|
||||
userId: creds.user_id,
|
||||
deviceId: creds.device_id,
|
||||
accessToken: creds.access_token,
|
||||
homeserverUrl: hsUrl,
|
||||
identityServerUrl: isUrl,
|
||||
guest: true,
|
||||
});
|
||||
}, true).then(() => true);
|
||||
}, (err) => {
|
||||
console.error("Failed to register as guest: " + err + " " + err.data);
|
||||
return false;
|
||||
});
|
||||
}
|
||||
|
||||
// returns a promise which resolves to true if a session is found in
|
||||
// localstorage
|
||||
//
|
||||
// N.B. Lifecycle.js should not maintain any further localStorage state, we
|
||||
// are moving towards using SessionStore to keep track of state related
|
||||
// to the current session (which is typically backed by localStorage).
|
||||
//
|
||||
// The plan is to gradually move the localStorage access done here into
|
||||
// SessionStore to avoid bugs where the view becomes out-of-sync with
|
||||
// localStorage (e.g. teamToken, isGuest etc.)
|
||||
function _restoreFromLocalStorage() {
|
||||
if (!localStorage) {
|
||||
return q(false);
|
||||
}
|
||||
const hs_url = localStorage.getItem("mx_hs_url");
|
||||
const is_url = localStorage.getItem("mx_is_url") || 'https://matrix.org';
|
||||
const access_token = localStorage.getItem("mx_access_token");
|
||||
const user_id = localStorage.getItem("mx_user_id");
|
||||
const device_id = localStorage.getItem("mx_device_id");
|
||||
const hsUrl = localStorage.getItem("mx_hs_url");
|
||||
const isUrl = localStorage.getItem("mx_is_url") || 'https://matrix.org';
|
||||
const accessToken = localStorage.getItem("mx_access_token");
|
||||
const userId = localStorage.getItem("mx_user_id");
|
||||
const deviceId = localStorage.getItem("mx_device_id");
|
||||
|
||||
let is_guest;
|
||||
let isGuest;
|
||||
if (localStorage.getItem("mx_is_guest") !== null) {
|
||||
is_guest = localStorage.getItem("mx_is_guest") === "true";
|
||||
isGuest = localStorage.getItem("mx_is_guest") === "true";
|
||||
} else {
|
||||
// legacy key name
|
||||
is_guest = localStorage.getItem("matrix-is-guest") === "true";
|
||||
isGuest = localStorage.getItem("matrix-is-guest") === "true";
|
||||
}
|
||||
|
||||
if (access_token && user_id && hs_url) {
|
||||
console.log("Restoring session for %s", user_id);
|
||||
if (accessToken && userId && hsUrl) {
|
||||
console.log(`Restoring session for ${userId}`);
|
||||
try {
|
||||
setLoggedIn({
|
||||
userId: user_id,
|
||||
deviceId: device_id,
|
||||
accessToken: access_token,
|
||||
homeserverUrl: hs_url,
|
||||
identityServerUrl: is_url,
|
||||
guest: is_guest,
|
||||
});
|
||||
return q(true);
|
||||
return _doSetLoggedIn({
|
||||
userId: userId,
|
||||
deviceId: deviceId,
|
||||
accessToken: accessToken,
|
||||
homeserverUrl: hsUrl,
|
||||
identityServerUrl: isUrl,
|
||||
guest: isGuest,
|
||||
}, false).then(() => true);
|
||||
} catch (e) {
|
||||
return _handleRestoreFailure(e);
|
||||
}
|
||||
@@ -226,25 +236,12 @@ function _restoreFromLocalStorage() {
|
||||
function _handleRestoreFailure(e) {
|
||||
console.log("Unable to restore session", e);
|
||||
|
||||
let msg = e.message;
|
||||
if (msg == "OLM.BAD_LEGACY_ACCOUNT_PICKLE") {
|
||||
msg = "You need to log back in to generate end-to-end encryption keys "
|
||||
+ "for this device and submit the public key to your homeserver. "
|
||||
+ "This is a once off; sorry for the inconvenience.";
|
||||
|
||||
_clearLocalStorage();
|
||||
|
||||
return q.reject(new Error(
|
||||
"Unable to restore previous session: " + msg,
|
||||
));
|
||||
}
|
||||
|
||||
const def = q.defer();
|
||||
const SessionRestoreErrorDialog =
|
||||
sdk.getComponent('views.dialogs.SessionRestoreErrorDialog');
|
||||
|
||||
Modal.createDialog(SessionRestoreErrorDialog, {
|
||||
error: msg,
|
||||
error: e.message,
|
||||
onFinished: (success) => {
|
||||
def.resolve(success);
|
||||
},
|
||||
@@ -253,7 +250,7 @@ function _handleRestoreFailure(e) {
|
||||
return def.promise.then((success) => {
|
||||
if (success) {
|
||||
// user clicked continue.
|
||||
_clearLocalStorage();
|
||||
_clearStorage();
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -264,46 +261,79 @@ function _handleRestoreFailure(e) {
|
||||
|
||||
let rtsClient = null;
|
||||
export function initRtsClient(url) {
|
||||
rtsClient = new RtsClient(url);
|
||||
if (url) {
|
||||
rtsClient = new RtsClient(url);
|
||||
} else {
|
||||
rtsClient = null;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Transitions to a logged-in state using the given credentials
|
||||
* Transitions to a logged-in state using the given credentials.
|
||||
*
|
||||
* Starts the matrix client and all other react-sdk services that
|
||||
* listen for events while a session is logged in.
|
||||
*
|
||||
* Also stops the old MatrixClient and clears old credentials/etc out of
|
||||
* storage before starting the new client.
|
||||
*
|
||||
* @param {MatrixClientCreds} credentials The credentials to use
|
||||
*
|
||||
* @returns {Promise} promise which resolves to the new MatrixClient once it has been started
|
||||
*/
|
||||
export function setLoggedIn(credentials) {
|
||||
stopMatrixClient();
|
||||
return _doSetLoggedIn(credentials, true);
|
||||
}
|
||||
|
||||
/**
|
||||
* fires on_logging_in, optionally clears localstorage, persists new credentials
|
||||
* to localstorage, starts the new client.
|
||||
*
|
||||
* @param {MatrixClientCreds} credentials
|
||||
* @param {Boolean} clearStorage
|
||||
*
|
||||
* @returns {Promise} promise which resolves to the new MatrixClient once it has been started
|
||||
*/
|
||||
async function _doSetLoggedIn(credentials, clearStorage) {
|
||||
credentials.guest = Boolean(credentials.guest);
|
||||
console.log("setLoggedIn => %s (guest=%s) hs=%s",
|
||||
credentials.userId, credentials.guest,
|
||||
credentials.homeserverUrl);
|
||||
|
||||
console.log(
|
||||
"setLoggedIn: mxid: " + credentials.userId +
|
||||
" deviceId: " + credentials.deviceId +
|
||||
" guest: " + credentials.guest +
|
||||
" hs: " + credentials.homeserverUrl,
|
||||
);
|
||||
|
||||
// This is dispatched to indicate that the user is still in the process of logging in
|
||||
// because `teamPromise` may take some time to resolve, breaking the assumption that
|
||||
// `setLoggedIn` takes an "instant" to complete, and dispatch `on_logged_in` a few ms
|
||||
// later than MatrixChat might assume.
|
||||
dis.dispatch({action: 'on_logging_in'});
|
||||
|
||||
if (clearStorage) {
|
||||
await _clearStorage();
|
||||
}
|
||||
|
||||
Analytics.setGuest(credentials.guest);
|
||||
|
||||
// Resolves by default
|
||||
let teamPromise = Promise.resolve(null);
|
||||
|
||||
// persist the session
|
||||
|
||||
if (localStorage) {
|
||||
try {
|
||||
localStorage.setItem("mx_hs_url", credentials.homeserverUrl);
|
||||
localStorage.setItem("mx_is_url", credentials.identityServerUrl);
|
||||
localStorage.setItem("mx_user_id", credentials.userId);
|
||||
localStorage.setItem("mx_access_token", credentials.accessToken);
|
||||
localStorage.setItem("mx_is_guest", JSON.stringify(credentials.guest));
|
||||
_persistCredentialsToLocalStorage(credentials);
|
||||
|
||||
// if we didn't get a deviceId from the login, leave mx_device_id unset,
|
||||
// rather than setting it to "undefined".
|
||||
//
|
||||
// (in this case MatrixClient doesn't bother with the crypto stuff
|
||||
// - that's fine for us).
|
||||
if (credentials.deviceId) {
|
||||
localStorage.setItem("mx_device_id", credentials.deviceId);
|
||||
// The user registered as a PWLU (PassWord-Less User), the generated password
|
||||
// is cached here such that the user can change it at a later time.
|
||||
if (credentials.password) {
|
||||
// Update SessionStore
|
||||
dis.dispatch({
|
||||
action: 'cached_password',
|
||||
cachedPassword: credentials.password,
|
||||
});
|
||||
}
|
||||
|
||||
console.log("Session persisted for %s", credentials.userId);
|
||||
} catch (e) {
|
||||
console.warn("Error using local storage: can't persist session!", e);
|
||||
}
|
||||
@@ -320,9 +350,6 @@ export function setLoggedIn(credentials) {
|
||||
console.warn("No local storage available: can't persist session!");
|
||||
}
|
||||
|
||||
// stop any running clients before we create a new one with these new credentials
|
||||
stopMatrixClient();
|
||||
|
||||
MatrixClientPeg.replaceUsingCreds(credentials);
|
||||
|
||||
teamPromise.then((teamToken) => {
|
||||
@@ -333,6 +360,26 @@ export function setLoggedIn(credentials) {
|
||||
});
|
||||
|
||||
startMatrixClient();
|
||||
return MatrixClientPeg.get();
|
||||
}
|
||||
|
||||
function _persistCredentialsToLocalStorage(credentials) {
|
||||
localStorage.setItem("mx_hs_url", credentials.homeserverUrl);
|
||||
localStorage.setItem("mx_is_url", credentials.identityServerUrl);
|
||||
localStorage.setItem("mx_user_id", credentials.userId);
|
||||
localStorage.setItem("mx_access_token", credentials.accessToken);
|
||||
localStorage.setItem("mx_is_guest", JSON.stringify(credentials.guest));
|
||||
|
||||
// if we didn't get a deviceId from the login, leave mx_device_id unset,
|
||||
// rather than setting it to "undefined".
|
||||
//
|
||||
// (in this case MatrixClient doesn't bother with the crypto stuff
|
||||
// - that's fine for us).
|
||||
if (credentials.deviceId) {
|
||||
localStorage.setItem("mx_device_id", credentials.deviceId);
|
||||
}
|
||||
|
||||
console.log(`Session persisted for ${credentials.userId}`);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -352,7 +399,7 @@ export function logout() {
|
||||
return;
|
||||
}
|
||||
|
||||
return MatrixClientPeg.get().logout().then(onLoggedOut,
|
||||
MatrixClientPeg.get().logout().then(onLoggedOut,
|
||||
(err) => {
|
||||
// Just throwing an error here is going to be very unhelpful
|
||||
// if you're trying to log out because your server's down and
|
||||
@@ -363,15 +410,17 @@ export function logout() {
|
||||
// change your password).
|
||||
console.log("Failed to call logout API: token will not be invalidated");
|
||||
onLoggedOut();
|
||||
}
|
||||
);
|
||||
},
|
||||
).done();
|
||||
}
|
||||
|
||||
/**
|
||||
* Starts the matrix client and all other react-sdk services that
|
||||
* listen for events while a session is logged in.
|
||||
*/
|
||||
export function startMatrixClient() {
|
||||
function startMatrixClient() {
|
||||
console.log(`Lifecycle: Starting MatrixClient`);
|
||||
|
||||
// dispatch this before starting the matrix client: it's used
|
||||
// to add listeners for the 'sync' event so otherwise we'd have
|
||||
// a race condition (and we need to dispatch synchronously for this
|
||||
@@ -387,44 +436,54 @@ export function startMatrixClient() {
|
||||
}
|
||||
|
||||
/*
|
||||
* Stops a running client and all related services, used after
|
||||
* a session has been logged out / ended.
|
||||
* Stops a running client and all related services, and clears persistent
|
||||
* storage. Used after a session has been logged out.
|
||||
*/
|
||||
export function onLoggedOut() {
|
||||
_clearLocalStorage();
|
||||
stopMatrixClient();
|
||||
_clearStorage().done();
|
||||
dis.dispatch({action: 'on_logged_out'});
|
||||
}
|
||||
|
||||
function _clearLocalStorage() {
|
||||
if (!window.localStorage) {
|
||||
return;
|
||||
}
|
||||
const hsUrl = window.localStorage.getItem("mx_hs_url");
|
||||
const isUrl = window.localStorage.getItem("mx_is_url");
|
||||
window.localStorage.clear();
|
||||
/**
|
||||
* @returns {Promise} promise which resolves once the stores have been cleared
|
||||
*/
|
||||
function _clearStorage() {
|
||||
Analytics.logout();
|
||||
|
||||
// preserve our HS & IS URLs for convenience
|
||||
// N.B. we cache them in hsUrl/isUrl and can't really inline them
|
||||
// as getCurrentHsUrl() may call through to localStorage.
|
||||
// NB. We do clear the device ID (as well as all the settings)
|
||||
if (hsUrl) window.localStorage.setItem("mx_hs_url", hsUrl);
|
||||
if (isUrl) window.localStorage.setItem("mx_is_url", isUrl);
|
||||
if (window.localStorage) {
|
||||
const hsUrl = window.localStorage.getItem("mx_hs_url");
|
||||
const isUrl = window.localStorage.getItem("mx_is_url");
|
||||
window.localStorage.clear();
|
||||
|
||||
// preserve our HS & IS URLs for convenience
|
||||
// N.B. we cache them in hsUrl/isUrl and can't really inline them
|
||||
// as getCurrentHsUrl() may call through to localStorage.
|
||||
// NB. We do clear the device ID (as well as all the settings)
|
||||
if (hsUrl) window.localStorage.setItem("mx_hs_url", hsUrl);
|
||||
if (isUrl) window.localStorage.setItem("mx_is_url", isUrl);
|
||||
}
|
||||
|
||||
// create a temporary client to clear out the persistent stores.
|
||||
const cli = createMatrixClient({
|
||||
// we'll never make any requests, so can pass a bogus HS URL
|
||||
baseUrl: "",
|
||||
});
|
||||
return cli.clearStores();
|
||||
}
|
||||
|
||||
/**
|
||||
* Stop all the background processes related to the current client
|
||||
* Stop all the background processes related to the current client.
|
||||
*/
|
||||
export function stopMatrixClient() {
|
||||
Notifier.stop();
|
||||
UserActivity.stop();
|
||||
Presence.stop();
|
||||
if (DMRoomMap.shared()) DMRoomMap.shared().stop();
|
||||
var cli = MatrixClientPeg.get();
|
||||
const cli = MatrixClientPeg.get();
|
||||
if (cli) {
|
||||
cli.stopClient();
|
||||
cli.removeAllListeners();
|
||||
cli.store.deleteAllData();
|
||||
MatrixClientPeg.unset();
|
||||
}
|
||||
}
|
||||
|
||||
34
src/Login.js
34
src/Login.js
@@ -16,6 +16,7 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
import Matrix from "matrix-js-sdk";
|
||||
import { _t } from "./languageHandler";
|
||||
|
||||
import q from 'q';
|
||||
import url from 'url';
|
||||
@@ -96,11 +97,6 @@ export default class Login {
|
||||
guest: true
|
||||
};
|
||||
}, (error) => {
|
||||
if (error.httpStatus === 403) {
|
||||
error.friendlyText = "Guest access is disabled on this Home Server.";
|
||||
} else {
|
||||
error.friendlyText = "Failed to register as guest: " + error.data;
|
||||
}
|
||||
throw error;
|
||||
});
|
||||
}
|
||||
@@ -156,15 +152,7 @@ export default class Login {
|
||||
accessToken: data.access_token
|
||||
});
|
||||
}, function(error) {
|
||||
if (error.httpStatus == 400 && loginParams.medium) {
|
||||
error.friendlyText = (
|
||||
'This Home Server does not support login using email address.'
|
||||
);
|
||||
}
|
||||
else if (error.httpStatus === 403) {
|
||||
error.friendlyText = (
|
||||
'Incorrect username and/or password.'
|
||||
);
|
||||
if (error.httpStatus === 403) {
|
||||
if (self._fallbackHsUrl) {
|
||||
var fbClient = Matrix.createClient({
|
||||
baseUrl: self._fallbackHsUrl,
|
||||
@@ -185,21 +173,23 @@ export default class Login {
|
||||
});
|
||||
}
|
||||
}
|
||||
else {
|
||||
error.friendlyText = (
|
||||
'There was a problem logging in. (HTTP ' + error.httpStatus + ")"
|
||||
);
|
||||
}
|
||||
throw error;
|
||||
});
|
||||
}
|
||||
|
||||
redirectToCas() {
|
||||
var client = this._createTemporaryClient();
|
||||
var parsedUrl = url.parse(window.location.href, true);
|
||||
const client = this._createTemporaryClient();
|
||||
const parsedUrl = url.parse(window.location.href, true);
|
||||
|
||||
// XXX: at this point, the fragment will always be #/login, which is no
|
||||
// use to anyone. Ideally, we would get the intended fragment from
|
||||
// MatrixChat.screenAfterLogin so that you could follow #/room links etc
|
||||
// through a CAS login.
|
||||
parsedUrl.hash = "";
|
||||
|
||||
parsedUrl.query["homeserver"] = client.getHomeserverUrl();
|
||||
parsedUrl.query["identityServer"] = client.getIdentityServerUrl();
|
||||
var casUrl = client.getCasLoginUrl(url.format(parsedUrl));
|
||||
const casUrl = client.getCasLoginUrl(url.format(parsedUrl));
|
||||
window.location.href = casUrl;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -17,7 +17,7 @@ limitations under the License.
|
||||
import commonmark from 'commonmark';
|
||||
import escape from 'lodash/escape';
|
||||
|
||||
const ALLOWED_HTML_TAGS = ['del'];
|
||||
const ALLOWED_HTML_TAGS = ['del', 'u'];
|
||||
|
||||
// These types of node are definitely text
|
||||
const TEXT_NODES = ['text', 'softbreak', 'linebreak', 'paragraph', 'document'];
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2015, 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd.
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -16,13 +17,10 @@ limitations under the License.
|
||||
|
||||
'use strict';
|
||||
|
||||
import q from "q";
|
||||
import Matrix from 'matrix-js-sdk';
|
||||
import utils from 'matrix-js-sdk/lib/utils';
|
||||
import EventTimeline from 'matrix-js-sdk/lib/models/event-timeline';
|
||||
import EventTimelineSet from 'matrix-js-sdk/lib/models/event-timeline-set';
|
||||
|
||||
const localStorage = window.localStorage;
|
||||
import createMatrixClient from './utils/createMatrixClient';
|
||||
|
||||
interface MatrixClientCreds {
|
||||
homeserverUrl: string,
|
||||
@@ -50,7 +48,6 @@ class MatrixClientPeg {
|
||||
this.opts = {
|
||||
initialSyncLimit: 20,
|
||||
};
|
||||
this.indexedDbWorkerScript = null;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -61,7 +58,7 @@ class MatrixClientPeg {
|
||||
* @param {string} script href to the script to be passed to the web worker
|
||||
*/
|
||||
setIndexedDbWorkerScript(script) {
|
||||
this.indexedDbWorkerScript = script;
|
||||
createMatrixClient.indexedDbWorkerScript = script;
|
||||
}
|
||||
|
||||
get(): MatrixClient {
|
||||
@@ -80,20 +77,26 @@ class MatrixClientPeg {
|
||||
this._createClient(creds);
|
||||
}
|
||||
|
||||
start() {
|
||||
async start() {
|
||||
const opts = utils.deepCopy(this.opts);
|
||||
// the react sdk doesn't work without this, so don't allow
|
||||
opts.pendingEventOrdering = "detached";
|
||||
|
||||
let promise = this.matrixClient.store.startup();
|
||||
// log any errors when starting up the database (if one exists)
|
||||
promise.catch((err) => { console.error(err); });
|
||||
try {
|
||||
let promise = this.matrixClient.store.startup();
|
||||
console.log(`MatrixClientPeg: waiting for MatrixClient store to initialise`);
|
||||
await promise;
|
||||
} catch(err) {
|
||||
// log any errors when starting up the database (if one exists)
|
||||
console.error(`Error starting matrixclient store: ${err}`);
|
||||
}
|
||||
|
||||
// regardless of errors, start the client. If we did error out, we'll
|
||||
// just end up doing a full initial /sync.
|
||||
promise.finally(() => {
|
||||
this.get().startClient(opts);
|
||||
});
|
||||
|
||||
console.log(`MatrixClientPeg: really starting MatrixClient`);
|
||||
this.get().startClient(opts);
|
||||
console.log(`MatrixClientPeg: MatrixClient started`);
|
||||
}
|
||||
|
||||
getCredentials(): MatrixClientCreds {
|
||||
@@ -130,22 +133,7 @@ class MatrixClientPeg {
|
||||
timelineSupport: true,
|
||||
};
|
||||
|
||||
if (localStorage) {
|
||||
opts.sessionStore = new Matrix.WebStorageSessionStore(localStorage);
|
||||
}
|
||||
if (window.indexedDB && localStorage) {
|
||||
// FIXME: bodge to remove old database. Remove this after a few weeks.
|
||||
window.indexedDB.deleteDatabase("matrix-js-sdk:default");
|
||||
|
||||
opts.store = new Matrix.IndexedDBStore({
|
||||
indexedDB: window.indexedDB,
|
||||
dbName: "riot-web-sync",
|
||||
localStorage: localStorage,
|
||||
workerScript: this.indexedDbWorkerScript,
|
||||
});
|
||||
}
|
||||
|
||||
this.matrixClient = Matrix.createClient(opts);
|
||||
this.matrixClient = createMatrixClient(opts, this.indexedDbWorkerScript);
|
||||
|
||||
// we're going to add eventlisteners for each matrix event tile, so the
|
||||
// potential number of event listeners is quite high.
|
||||
|
||||
10
src/Modal.js
10
src/Modal.js
@@ -19,6 +19,7 @@ limitations under the License.
|
||||
|
||||
var React = require('react');
|
||||
var ReactDOM = require('react-dom');
|
||||
import Analytics from './Analytics';
|
||||
import sdk from './index';
|
||||
|
||||
const DIALOG_CONTAINER_ID = "mx_Dialog_Container";
|
||||
@@ -63,7 +64,6 @@ const AsyncWrapper = React.createClass({
|
||||
|
||||
render: function() {
|
||||
const {loader, ...otherProps} = this.props;
|
||||
|
||||
if (this.state.component) {
|
||||
const Component = this.state.component;
|
||||
return <Component {...otherProps} />;
|
||||
@@ -104,6 +104,9 @@ class ModalManager {
|
||||
}
|
||||
|
||||
createDialog(Element, props, className) {
|
||||
if (props && props.title) {
|
||||
Analytics.trackEvent('Modal', props.title, 'createDialog');
|
||||
}
|
||||
return this.createDialogAsync((cb) => {cb(Element);}, props, className);
|
||||
}
|
||||
|
||||
@@ -195,4 +198,7 @@ class ModalManager {
|
||||
}
|
||||
}
|
||||
|
||||
export default new ModalManager();
|
||||
if (!global.singletonModalManager) {
|
||||
global.singletonModalManager = new ModalManager();
|
||||
}
|
||||
export default global.singletonModalManager;
|
||||
|
||||
@@ -15,11 +15,15 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
var PlatformPeg = require("./PlatformPeg");
|
||||
var TextForEvent = require('./TextForEvent');
|
||||
var Avatar = require('./Avatar');
|
||||
var dis = require("./dispatcher");
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import PlatformPeg from './PlatformPeg';
|
||||
import TextForEvent from './TextForEvent';
|
||||
import Analytics from './Analytics';
|
||||
import Avatar from './Avatar';
|
||||
import dis from './dispatcher';
|
||||
import sdk from './index';
|
||||
import { _t } from './languageHandler';
|
||||
import Modal from './Modal';
|
||||
|
||||
/*
|
||||
* Dispatches:
|
||||
@@ -29,7 +33,7 @@ var dis = require("./dispatcher");
|
||||
* }
|
||||
*/
|
||||
|
||||
var Notifier = {
|
||||
const Notifier = {
|
||||
notifsByRoom: {},
|
||||
|
||||
notificationMessageForEvent: function(ev) {
|
||||
@@ -48,16 +52,16 @@ var Notifier = {
|
||||
return;
|
||||
}
|
||||
|
||||
var msg = this.notificationMessageForEvent(ev);
|
||||
let msg = this.notificationMessageForEvent(ev);
|
||||
if (!msg) return;
|
||||
|
||||
var title;
|
||||
if (!ev.sender || room.name == ev.sender.name) {
|
||||
let title;
|
||||
if (!ev.sender || room.name === ev.sender.name) {
|
||||
title = room.name;
|
||||
// notificationMessageForEvent includes sender,
|
||||
// but we already have the sender here
|
||||
if (ev.getContent().body) msg = ev.getContent().body;
|
||||
} else if (ev.getType() == 'm.room.member') {
|
||||
} else if (ev.getType() === 'm.room.member') {
|
||||
// context is all in the message here, we don't need
|
||||
// to display sender info
|
||||
title = room.name;
|
||||
@@ -68,7 +72,7 @@ var Notifier = {
|
||||
if (ev.getContent().body) msg = ev.getContent().body;
|
||||
}
|
||||
|
||||
var avatarUrl = ev.sender ? Avatar.avatarUrlForMember(
|
||||
const avatarUrl = ev.sender ? Avatar.avatarUrlForMember(
|
||||
ev.sender, 40, 40, 'crop'
|
||||
) : null;
|
||||
|
||||
@@ -83,7 +87,7 @@ var Notifier = {
|
||||
},
|
||||
|
||||
_playAudioNotification: function(ev, room) {
|
||||
var e = document.getElementById("messageAudio");
|
||||
const e = document.getElementById("messageAudio");
|
||||
if (e) {
|
||||
e.load();
|
||||
e.play();
|
||||
@@ -95,7 +99,7 @@ var Notifier = {
|
||||
this.boundOnSyncStateChange = this.onSyncStateChange.bind(this);
|
||||
this.boundOnRoomReceipt = this.onRoomReceipt.bind(this);
|
||||
MatrixClientPeg.get().on('Room.timeline', this.boundOnRoomTimeline);
|
||||
MatrixClientPeg.get().on("Room.receipt", this.boundOnRoomReceipt);
|
||||
MatrixClientPeg.get().on('Room.receipt', this.boundOnRoomReceipt);
|
||||
MatrixClientPeg.get().on("sync", this.boundOnSyncStateChange);
|
||||
this.toolbarHidden = false;
|
||||
this.isSyncing = false;
|
||||
@@ -104,7 +108,7 @@ var Notifier = {
|
||||
stop: function() {
|
||||
if (MatrixClientPeg.get() && this.boundOnRoomTimeline) {
|
||||
MatrixClientPeg.get().removeListener('Room.timeline', this.boundOnRoomTimeline);
|
||||
MatrixClientPeg.get().removeListener("Room.receipt", this.boundOnRoomReceipt);
|
||||
MatrixClientPeg.get().removeListener('Room.receipt', this.boundOnRoomReceipt);
|
||||
MatrixClientPeg.get().removeListener('sync', this.boundOnSyncStateChange);
|
||||
}
|
||||
this.isSyncing = false;
|
||||
@@ -118,10 +122,13 @@ var Notifier = {
|
||||
setEnabled: function(enable, callback) {
|
||||
const plaf = PlatformPeg.get();
|
||||
if (!plaf) return;
|
||||
|
||||
Analytics.trackEvent('Notifier', 'Set Enabled', enable);
|
||||
|
||||
// make sure that we persist the current setting audio_enabled setting
|
||||
// before changing anything
|
||||
if (global.localStorage) {
|
||||
if(global.localStorage.getItem('audio_notifications_enabled') == null) {
|
||||
if (global.localStorage.getItem('audio_notifications_enabled') === null) {
|
||||
this.setAudioEnabled(this.isEnabled());
|
||||
}
|
||||
}
|
||||
@@ -131,6 +138,14 @@ var Notifier = {
|
||||
plaf.requestNotificationPermission().done((result) => {
|
||||
if (result !== 'granted') {
|
||||
// The permission request was dismissed or denied
|
||||
const description = result === 'denied'
|
||||
? _t('Riot does not have permission to send you notifications - please check your browser settings')
|
||||
: _t('Riot was not given permission to send notifications - please try again');
|
||||
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: _t('Unable to enable Notifications'),
|
||||
description,
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -141,7 +156,7 @@ var Notifier = {
|
||||
if (callback) callback();
|
||||
dis.dispatch({
|
||||
action: "notifier_enabled",
|
||||
value: true
|
||||
value: true,
|
||||
});
|
||||
});
|
||||
// clear the notifications_hidden flag, so that if notifications are
|
||||
@@ -152,7 +167,7 @@ var Notifier = {
|
||||
global.localStorage.setItem('notifications_enabled', 'false');
|
||||
dis.dispatch({
|
||||
action: "notifier_enabled",
|
||||
value: false
|
||||
value: false,
|
||||
});
|
||||
}
|
||||
},
|
||||
@@ -165,7 +180,7 @@ var Notifier = {
|
||||
|
||||
if (!global.localStorage) return true;
|
||||
|
||||
var enabled = global.localStorage.getItem('notifications_enabled');
|
||||
const enabled = global.localStorage.getItem('notifications_enabled');
|
||||
if (enabled === null) return true;
|
||||
return enabled === 'true';
|
||||
},
|
||||
@@ -173,12 +188,12 @@ var Notifier = {
|
||||
setAudioEnabled: function(enable) {
|
||||
if (!global.localStorage) return;
|
||||
global.localStorage.setItem('audio_notifications_enabled',
|
||||
enable ? 'true' : 'false');
|
||||
enable ? 'true' : 'false');
|
||||
},
|
||||
|
||||
isAudioEnabled: function(enable) {
|
||||
if (!global.localStorage) return true;
|
||||
var enabled = global.localStorage.getItem(
|
||||
const enabled = global.localStorage.getItem(
|
||||
'audio_notifications_enabled');
|
||||
// default to true if the popups are enabled
|
||||
if (enabled === null) return this.isEnabled();
|
||||
@@ -188,11 +203,13 @@ var Notifier = {
|
||||
setToolbarHidden: function(hidden, persistent = true) {
|
||||
this.toolbarHidden = hidden;
|
||||
|
||||
Analytics.trackEvent('Notifier', 'Set Toolbar Hidden', hidden);
|
||||
|
||||
// XXX: why are we dispatching this here?
|
||||
// this is nothing to do with notifier_enabled
|
||||
dis.dispatch({
|
||||
action: "notifier_enabled",
|
||||
value: this.isEnabled()
|
||||
value: this.isEnabled(),
|
||||
});
|
||||
|
||||
// update the info to localStorage for persistent settings
|
||||
@@ -215,8 +232,7 @@ var Notifier = {
|
||||
onSyncStateChange: function(state) {
|
||||
if (state === "SYNCING") {
|
||||
this.isSyncing = true;
|
||||
}
|
||||
else if (state === "STOPPED" || state === "ERROR") {
|
||||
} else if (state === "STOPPED" || state === "ERROR") {
|
||||
this.isSyncing = false;
|
||||
}
|
||||
},
|
||||
@@ -225,22 +241,23 @@ var Notifier = {
|
||||
if (toStartOfTimeline) return;
|
||||
if (!room) return;
|
||||
if (!this.isSyncing) return; // don't alert for any messages initially
|
||||
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) return;
|
||||
if (ev.sender && ev.sender.userId === MatrixClientPeg.get().credentials.userId) return;
|
||||
if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
|
||||
|
||||
var actions = MatrixClientPeg.get().getPushActionsForEvent(ev);
|
||||
const actions = MatrixClientPeg.get().getPushActionsForEvent(ev);
|
||||
if (actions && actions.notify) {
|
||||
if (this.isEnabled()) {
|
||||
this._displayPopupNotification(ev, room);
|
||||
}
|
||||
if (actions.tweaks.sound && this.isAudioEnabled()) {
|
||||
PlatformPeg.get().loudNotification(ev, room);
|
||||
this._playAudioNotification(ev, room);
|
||||
}
|
||||
}
|
||||
},
|
||||
|
||||
onRoomReceipt: function(ev, room) {
|
||||
if (room.getUnreadNotificationCount() == 0) {
|
||||
if (room.getUnreadNotificationCount() === 0) {
|
||||
// ideally we would clear each notification when it was read,
|
||||
// but we have no way, given a read receipt, to know whether
|
||||
// the receipt comes before or after an event, so we can't
|
||||
@@ -255,7 +272,7 @@ var Notifier = {
|
||||
}
|
||||
delete this.notifsByRoom[room.roomId];
|
||||
}
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
if (!global.mxNotifier) {
|
||||
|
||||
@@ -23,8 +23,8 @@ limitations under the License.
|
||||
* { key: $KEY, val: $VALUE, place: "add|del" }
|
||||
*/
|
||||
module.exports.getKeyValueArrayDiffs = function(before, after) {
|
||||
var results = [];
|
||||
var delta = {};
|
||||
const results = [];
|
||||
const delta = {};
|
||||
Object.keys(before).forEach(function(beforeKey) {
|
||||
delta[beforeKey] = delta[beforeKey] || 0; // init to 0 initially
|
||||
delta[beforeKey]--; // keys present in the past have -ve values
|
||||
@@ -46,9 +46,9 @@ module.exports.getKeyValueArrayDiffs = function(before, after) {
|
||||
results.push({ place: "del", key: muxedKey, val: beforeVal });
|
||||
});
|
||||
break;
|
||||
case 0: // A mix of added/removed keys
|
||||
case 0: {// A mix of added/removed keys
|
||||
// compare old & new vals
|
||||
var itemDelta = {};
|
||||
const itemDelta = {};
|
||||
before[muxedKey].forEach(function(beforeVal) {
|
||||
itemDelta[beforeVal] = itemDelta[beforeVal] || 0;
|
||||
itemDelta[beforeVal]--;
|
||||
@@ -68,9 +68,9 @@ module.exports.getKeyValueArrayDiffs = function(before, after) {
|
||||
}
|
||||
});
|
||||
break;
|
||||
}
|
||||
default:
|
||||
console.error("Calculated key delta of " + delta[muxedKey] +
|
||||
" - this should never happen!");
|
||||
console.error("Calculated key delta of " + delta[muxedKey] + " - this should never happen!");
|
||||
break;
|
||||
}
|
||||
});
|
||||
@@ -79,8 +79,10 @@ module.exports.getKeyValueArrayDiffs = function(before, after) {
|
||||
};
|
||||
|
||||
/**
|
||||
* Shallow-compare two objects for equality: each key and value must be
|
||||
* identical
|
||||
* Shallow-compare two objects for equality: each key and value must be identical
|
||||
* @param {Object} objA First object to compare against the second
|
||||
* @param {Object} objB Second object to compare against the first
|
||||
* @return {boolean} whether the two objects have same key=values
|
||||
*/
|
||||
module.exports.shallowEqual = function(objA, objB) {
|
||||
if (objA === objB) {
|
||||
@@ -92,15 +94,15 @@ module.exports.shallowEqual = function(objA, objB) {
|
||||
return false;
|
||||
}
|
||||
|
||||
var keysA = Object.keys(objA);
|
||||
var keysB = Object.keys(objB);
|
||||
const keysA = Object.keys(objA);
|
||||
const keysB = Object.keys(objB);
|
||||
|
||||
if (keysA.length !== keysB.length) {
|
||||
return false;
|
||||
}
|
||||
|
||||
for (var i = 0; i < keysA.length; i++) {
|
||||
var key = keysA[i];
|
||||
for (let i = 0; i < keysA.length; i++) {
|
||||
const key = keysA[i];
|
||||
if (!objB.hasOwnProperty(key) || objA[key] !== objB[key]) {
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2015, 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -22,4 +23,6 @@ export default {
|
||||
CreateRoom: "create_room",
|
||||
RoomDirectory: "room_directory",
|
||||
UserView: "user_view",
|
||||
GroupView: "group_view",
|
||||
MyGroups: "my_groups",
|
||||
};
|
||||
|
||||
@@ -14,7 +14,8 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var Matrix = require("matrix-js-sdk");
|
||||
import * as Matrix from 'matrix-js-sdk';
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
/**
|
||||
* Allows a user to reset their password on a homeserver.
|
||||
@@ -33,7 +34,7 @@ class PasswordReset {
|
||||
constructor(homeserverUrl, identityUrl) {
|
||||
this.client = Matrix.createClient({
|
||||
baseUrl: homeserverUrl,
|
||||
idBaseUrl: identityUrl
|
||||
idBaseUrl: identityUrl,
|
||||
});
|
||||
this.clientSecret = this.client.generateClientSecret();
|
||||
this.identityServerDomain = identityUrl.split("://")[1];
|
||||
@@ -52,8 +53,8 @@ class PasswordReset {
|
||||
this.sessionId = res.sid;
|
||||
return res;
|
||||
}, function(err) {
|
||||
if (err.errcode == 'M_THREEPID_NOT_FOUND') {
|
||||
err.message = "This email address was not found";
|
||||
if (err.errcode === 'M_THREEPID_NOT_FOUND') {
|
||||
err.message = _t('This email address was not found');
|
||||
} else if (err.httpStatus) {
|
||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||
}
|
||||
@@ -74,16 +75,15 @@ class PasswordReset {
|
||||
threepid_creds: {
|
||||
sid: this.sessionId,
|
||||
client_secret: this.clientSecret,
|
||||
id_server: this.identityServerDomain
|
||||
}
|
||||
id_server: this.identityServerDomain,
|
||||
},
|
||||
}, this.password).catch(function(err) {
|
||||
if (err.httpStatus === 401) {
|
||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
||||
}
|
||||
else if (err.httpStatus === 404) {
|
||||
err.message = "Your email address does not appear to be associated with a Matrix ID on this Homeserver.";
|
||||
}
|
||||
else if (err.httpStatus) {
|
||||
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||
} else if (err.httpStatus === 404) {
|
||||
err.message =
|
||||
_t('Your email address does not appear to be associated with a Matrix ID on this Homeserver.');
|
||||
} else if (err.httpStatus) {
|
||||
err.message += ` (Status ${err.httpStatus})`;
|
||||
}
|
||||
throw err;
|
||||
|
||||
@@ -14,10 +14,8 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||
var dis = require('./dispatcher');
|
||||
var sdk = require('./index');
|
||||
var Modal = require('./Modal');
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import dis from './dispatcher';
|
||||
import { EventStatus } from 'matrix-js-sdk';
|
||||
|
||||
module.exports = {
|
||||
@@ -37,12 +35,10 @@ module.exports = {
|
||||
},
|
||||
resend: function(event) {
|
||||
const room = MatrixClientPeg.get().getRoom(event.getRoomId());
|
||||
MatrixClientPeg.get().resendEvent(
|
||||
event, room
|
||||
).done(function(res) {
|
||||
MatrixClientPeg.get().resendEvent(event, room).done(function(res) {
|
||||
dis.dispatch({
|
||||
action: 'message_sent',
|
||||
event: event
|
||||
event: event,
|
||||
});
|
||||
}, function(err) {
|
||||
// XXX: temporary logging to try to diagnose
|
||||
@@ -58,7 +54,7 @@ module.exports = {
|
||||
|
||||
dis.dispatch({
|
||||
action: 'message_send_failed',
|
||||
event: event
|
||||
event: event,
|
||||
});
|
||||
});
|
||||
},
|
||||
@@ -66,7 +62,7 @@ module.exports = {
|
||||
MatrixClientPeg.get().cancelPendingEvent(event);
|
||||
dis.dispatch({
|
||||
action: 'message_send_cancelled',
|
||||
event: event
|
||||
event: event,
|
||||
});
|
||||
},
|
||||
};
|
||||
|
||||
@@ -16,6 +16,7 @@ import * as sdk from './index';
|
||||
import * as emojione from 'emojione';
|
||||
import {stateToHTML} from 'draft-js-export-html';
|
||||
import {SelectionRange} from "./autocomplete/Autocompleter";
|
||||
import {stateToMarkdown as __stateToMarkdown} from 'draft-js-export-markdown';
|
||||
|
||||
const MARKDOWN_REGEX = {
|
||||
LINK: /(?:\[([^\]]+)\]\(([^\)]+)\))|\<(\w+:\/\/[^\>]+)\>/g,
|
||||
@@ -30,9 +31,26 @@ const USERNAME_REGEX = /@\S+:\S+/g;
|
||||
const ROOM_REGEX = /#\S+:\S+/g;
|
||||
const EMOJI_REGEX = new RegExp(emojione.unicodeRegexp, 'g');
|
||||
|
||||
export const contentStateToHTML = stateToHTML;
|
||||
const ZWS_CODE = 8203;
|
||||
const ZWS = String.fromCharCode(ZWS_CODE); // zero width space
|
||||
export function stateToMarkdown(state) {
|
||||
return __stateToMarkdown(state)
|
||||
.replace(
|
||||
ZWS, // draft-js-export-markdown adds these
|
||||
''); // this is *not* a zero width space, trust me :)
|
||||
}
|
||||
|
||||
export function HTMLtoContentState(html: string): ContentState {
|
||||
export const contentStateToHTML = (contentState: ContentState) => {
|
||||
return stateToHTML(contentState, {
|
||||
inlineStyles: {
|
||||
UNDERLINE: {
|
||||
element: 'u'
|
||||
}
|
||||
}
|
||||
});
|
||||
};
|
||||
|
||||
export function htmlToContentState(html: string): ContentState {
|
||||
return ContentState.createFromBlockArray(convertFromHTML(html));
|
||||
}
|
||||
|
||||
@@ -146,9 +164,9 @@ export function getScopedMDDecorators(scope: any): CompositeDecorator {
|
||||
</a>
|
||||
)
|
||||
});
|
||||
markdownDecorators.push(emojiDecorator);
|
||||
|
||||
return markdownDecorators;
|
||||
// markdownDecorators.push(emojiDecorator);
|
||||
// TODO Consider renabling "syntax highlighting" when we can do it properly
|
||||
return [emojiDecorator];
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
17
src/Roles.js
17
src/Roles.js
@@ -13,14 +13,19 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
export const LEVEL_ROLE_MAP = {
|
||||
undefined: 'Default',
|
||||
0: 'User',
|
||||
50: 'Moderator',
|
||||
100: 'Admin',
|
||||
};
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
export function levelRoleMap() {
|
||||
return {
|
||||
undefined: _t('Default'),
|
||||
0: _t('User'),
|
||||
50: _t('Moderator'),
|
||||
100: _t('Admin'),
|
||||
};
|
||||
}
|
||||
|
||||
export function textualPowerLevel(level, userDefault) {
|
||||
const LEVEL_ROLE_MAP = this.levelRoleMap();
|
||||
if (LEVEL_ROLE_MAP[level]) {
|
||||
return LEVEL_ROLE_MAP[level] + (level !== undefined ? ` (${level})` : ` (${userDefault})`);
|
||||
} else {
|
||||
|
||||
@@ -19,8 +19,7 @@ limitations under the License.
|
||||
function tsOfNewestEvent(room) {
|
||||
if (room.timeline.length) {
|
||||
return room.timeline[room.timeline.length - 1].getTs();
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
return Number.MAX_SAFE_INTEGER;
|
||||
}
|
||||
}
|
||||
@@ -32,5 +31,5 @@ function mostRecentActivityFirst(roomList) {
|
||||
}
|
||||
|
||||
module.exports = {
|
||||
mostRecentActivityFirst: mostRecentActivityFirst
|
||||
mostRecentActivityFirst,
|
||||
};
|
||||
|
||||
@@ -52,7 +52,7 @@ export function getRoomNotifsState(roomId) {
|
||||
}
|
||||
|
||||
export function setRoomNotifsState(roomId, newState) {
|
||||
if (newState == MUTE) {
|
||||
if (newState === MUTE) {
|
||||
return setRoomNotifsStateMuted(roomId);
|
||||
} else {
|
||||
return setRoomNotifsStateUnmuted(roomId, newState);
|
||||
@@ -80,11 +80,11 @@ function setRoomNotifsStateMuted(roomId) {
|
||||
kind: 'event_match',
|
||||
key: 'room_id',
|
||||
pattern: roomId,
|
||||
}
|
||||
},
|
||||
],
|
||||
actions: [
|
||||
'dont_notify',
|
||||
]
|
||||
],
|
||||
}));
|
||||
|
||||
return q.all(promises);
|
||||
@@ -99,16 +99,16 @@ function setRoomNotifsStateUnmuted(roomId, newState) {
|
||||
promises.push(cli.deletePushRule('global', 'override', overrideMuteRule.rule_id));
|
||||
}
|
||||
|
||||
if (newState == 'all_messages') {
|
||||
if (newState === 'all_messages') {
|
||||
const roomRule = cli.getRoomPushRule('global', roomId);
|
||||
if (roomRule) {
|
||||
promises.push(cli.deletePushRule('global', 'room', roomRule.rule_id));
|
||||
}
|
||||
} else if (newState == 'mentions_only') {
|
||||
} else if (newState === 'mentions_only') {
|
||||
promises.push(cli.addPushRule('global', 'room', roomId, {
|
||||
actions: [
|
||||
'dont_notify',
|
||||
]
|
||||
],
|
||||
}));
|
||||
// https://matrix.org/jira/browse/SPEC-400
|
||||
promises.push(cli.setPushRuleEnabled('global', 'room', roomId, true));
|
||||
@@ -119,8 +119,8 @@ function setRoomNotifsStateUnmuted(roomId, newState) {
|
||||
{
|
||||
set_tweak: 'sound',
|
||||
value: 'default',
|
||||
}
|
||||
]
|
||||
},
|
||||
],
|
||||
}));
|
||||
// https://matrix.org/jira/browse/SPEC-400
|
||||
promises.push(cli.setPushRuleEnabled('global', 'room', roomId, true));
|
||||
@@ -145,20 +145,10 @@ function isRuleForRoom(roomId, rule) {
|
||||
return false;
|
||||
}
|
||||
const cond = rule.conditions[0];
|
||||
if (
|
||||
cond.kind == 'event_match' &&
|
||||
cond.key == 'room_id' &&
|
||||
cond.pattern == roomId
|
||||
) {
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
return (cond.kind === 'event_match' && cond.key === 'room_id' && cond.pattern === roomId);
|
||||
}
|
||||
|
||||
function isMuteRule(rule) {
|
||||
return (
|
||||
rule.actions.length == 1 &&
|
||||
rule.actions[0] == 'dont_notify'
|
||||
);
|
||||
return (rule.actions.length === 1 && rule.actions[0] === 'dont_notify');
|
||||
}
|
||||
|
||||
|
||||
14
src/Rooms.js
14
src/Rooms.js
@@ -15,7 +15,6 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import DMRoomMap from './utils/DMRoomMap';
|
||||
import q from 'q';
|
||||
|
||||
/**
|
||||
@@ -145,7 +144,18 @@ export function guessDMRoomTarget(room, me) {
|
||||
let oldestTs;
|
||||
let oldestUser;
|
||||
|
||||
// Pick the user who's been here longest (and isn't us)
|
||||
// Pick the joined user who's been here longest (and isn't us),
|
||||
for (const user of room.getJoinedMembers()) {
|
||||
if (user.userId == me.userId) continue;
|
||||
|
||||
if (oldestTs === undefined || user.events.member.getTs() < oldestTs) {
|
||||
oldestUser = user;
|
||||
oldestTs = user.events.member.getTs();
|
||||
}
|
||||
}
|
||||
if (oldestUser) return oldestUser;
|
||||
|
||||
// if there are no joined members other than us, use the oldest member
|
||||
for (const user of room.currentState.getMembers()) {
|
||||
if (user.userId == me.userId) continue;
|
||||
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
import 'whatwg-fetch';
|
||||
|
||||
let fetchFunction = fetch;
|
||||
|
||||
function checkStatus(response) {
|
||||
if (!response.ok) {
|
||||
return response.text().then((text) => {
|
||||
@@ -31,7 +33,7 @@ const request = (url, opts) => {
|
||||
opts.body = JSON.stringify(opts.body);
|
||||
opts.headers['Content-Type'] = 'application/json';
|
||||
}
|
||||
return fetch(url, opts)
|
||||
return fetchFunction(url, opts)
|
||||
.then(checkStatus)
|
||||
.then(parseJson);
|
||||
};
|
||||
@@ -64,7 +66,7 @@ export default class RtsClient {
|
||||
client_secret: clientSecret,
|
||||
},
|
||||
method: 'POST',
|
||||
}
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
@@ -74,7 +76,7 @@ export default class RtsClient {
|
||||
qs: {
|
||||
team_token: teamToken,
|
||||
},
|
||||
}
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
@@ -91,7 +93,12 @@ export default class RtsClient {
|
||||
qs: {
|
||||
user_id: userId,
|
||||
},
|
||||
}
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
// allow fetch to be replaced, for testing.
|
||||
static setFetch(fn) {
|
||||
fetchFunction = fn;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -76,10 +76,13 @@ class ScalarAuthClient {
|
||||
return defer.promise;
|
||||
}
|
||||
|
||||
getScalarInterfaceUrlForRoom(roomId) {
|
||||
getScalarInterfaceUrlForRoom(roomId, screen) {
|
||||
var url = SdkConfig.get().integrations_ui_url;
|
||||
url += "?scalar_token=" + encodeURIComponent(this.scalarToken);
|
||||
url += "&room_id=" + encodeURIComponent(roomId);
|
||||
if (screen) {
|
||||
url += '&screen=' + encodeURIComponent(screen);
|
||||
}
|
||||
return url;
|
||||
}
|
||||
|
||||
@@ -89,4 +92,3 @@ class ScalarAuthClient {
|
||||
}
|
||||
|
||||
module.exports = ScalarAuthClient;
|
||||
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -94,6 +95,92 @@ Example:
|
||||
}
|
||||
}
|
||||
|
||||
get_membership_count
|
||||
--------------------
|
||||
Get the number of joined users in the room.
|
||||
|
||||
Request:
|
||||
- room_id is the room to get the count in.
|
||||
Response:
|
||||
78
|
||||
Example:
|
||||
{
|
||||
action: "get_membership_count",
|
||||
room_id: "!foo:bar",
|
||||
response: 78
|
||||
}
|
||||
|
||||
set_widget
|
||||
----------
|
||||
Set a new widget in the room. Clobbers based on the ID.
|
||||
|
||||
Request:
|
||||
- `room_id` (String) is the room to set the widget in.
|
||||
- `widget_id` (String) is the ID of the widget to add (or replace if it already exists).
|
||||
It can be an arbitrary UTF8 string and is purely for distinguishing between widgets.
|
||||
- `url` (String) is the URL that clients should load in an iframe to run the widget.
|
||||
All widgets must have a valid URL. If the URL is `null` (not `undefined`), the
|
||||
widget will be removed from the room.
|
||||
- `type` (String) is the type of widget, which is provided as a hint for matrix clients so they
|
||||
can configure/lay out the widget in different ways. All widgets must have a type.
|
||||
- `name` (String) is an optional human-readable string about the widget.
|
||||
- `data` (Object) is some optional data about the widget, and can contain arbitrary key/value pairs.
|
||||
Response:
|
||||
{
|
||||
success: true
|
||||
}
|
||||
Example:
|
||||
{
|
||||
action: "set_widget",
|
||||
room_id: "!foo:bar",
|
||||
widget_id: "abc123",
|
||||
url: "http://widget.url",
|
||||
type: "example",
|
||||
response: {
|
||||
success: true
|
||||
}
|
||||
}
|
||||
|
||||
get_widgets
|
||||
-----------
|
||||
Get a list of all widgets in the room. The response is the `content` field
|
||||
of the state event.
|
||||
|
||||
Request:
|
||||
- `room_id` (String) is the room to get the widgets in.
|
||||
Response:
|
||||
{
|
||||
$widget_id: {
|
||||
type: "example",
|
||||
url: "http://widget.url",
|
||||
name: "Example Widget",
|
||||
data: {
|
||||
key: "val"
|
||||
}
|
||||
},
|
||||
$widget_id: { ... }
|
||||
}
|
||||
Example:
|
||||
{
|
||||
action: "get_widgets",
|
||||
room_id: "!foo:bar",
|
||||
widget_id: "abc123",
|
||||
url: "http://widget.url",
|
||||
type: "example",
|
||||
response: {
|
||||
$widget_id: {
|
||||
type: "example",
|
||||
url: "http://widget.url",
|
||||
name: "Example Widget",
|
||||
data: {
|
||||
key: "val"
|
||||
}
|
||||
},
|
||||
$widget_id: { ... }
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
membership_state AND bot_options
|
||||
--------------------------------
|
||||
Get the content of the "m.room.member" or "m.room.bot.options" state event respectively.
|
||||
@@ -125,6 +212,7 @@ const SdkConfig = require('./SdkConfig');
|
||||
const MatrixClientPeg = require("./MatrixClientPeg");
|
||||
const MatrixEvent = require("matrix-js-sdk").MatrixEvent;
|
||||
const dis = require("./dispatcher");
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
function sendResponse(event, res) {
|
||||
const data = JSON.parse(JSON.stringify(event.data));
|
||||
@@ -150,7 +238,7 @@ function inviteUser(event, roomId, userId) {
|
||||
console.log(`Received request to invite ${userId} into room ${roomId}`);
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, "You need to be logged in.");
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
const room = client.getRoom(roomId);
|
||||
@@ -170,10 +258,88 @@ function inviteUser(event, roomId, userId) {
|
||||
success: true,
|
||||
});
|
||||
}, function(err) {
|
||||
sendError(event, "You need to be able to invite users to do that.", err);
|
||||
sendError(event, _t('You need to be able to invite users to do that.'), err);
|
||||
});
|
||||
}
|
||||
|
||||
function setWidget(event, roomId) {
|
||||
const widgetId = event.data.widget_id;
|
||||
const widgetType = event.data.type;
|
||||
const widgetUrl = event.data.url;
|
||||
const widgetName = event.data.name; // optional
|
||||
const widgetData = event.data.data; // optional
|
||||
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
|
||||
// both adding/removing widgets need these checks
|
||||
if (!widgetId || widgetUrl === undefined) {
|
||||
sendError(event, _t("Unable to create widget."), new Error("Missing required widget fields."));
|
||||
return;
|
||||
}
|
||||
|
||||
if (widgetUrl !== null) { // if url is null it is being deleted, don't need to check name/type/etc
|
||||
// check types of fields
|
||||
if (widgetName !== undefined && typeof widgetName !== 'string') {
|
||||
sendError(event, _t("Unable to create widget."), new Error("Optional field 'name' must be a string."));
|
||||
return;
|
||||
}
|
||||
if (widgetData !== undefined && !(widgetData instanceof Object)) {
|
||||
sendError(event, _t("Unable to create widget."), new Error("Optional field 'data' must be an Object."));
|
||||
return;
|
||||
}
|
||||
if (typeof widgetType !== 'string') {
|
||||
sendError(event, _t("Unable to create widget."), new Error("Field 'type' must be a string."));
|
||||
return;
|
||||
}
|
||||
if (typeof widgetUrl !== 'string') {
|
||||
sendError(event, _t("Unable to create widget."), new Error("Field 'url' must be a string or null."));
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
// TODO: same dance we do for power levels. It'd be nice if the JS SDK had helper methods to do this.
|
||||
client.getStateEvent(roomId, "im.vector.modular.widgets", "").then((widgets) => {
|
||||
if (widgetUrl === null) {
|
||||
delete widgets[widgetId];
|
||||
}
|
||||
else {
|
||||
widgets[widgetId] = {
|
||||
type: widgetType,
|
||||
url: widgetUrl,
|
||||
name: widgetName,
|
||||
data: widgetData,
|
||||
};
|
||||
}
|
||||
return client.sendStateEvent(roomId, "im.vector.modular.widgets", widgets);
|
||||
}, (err) => {
|
||||
if (err.errcode === "M_NOT_FOUND") {
|
||||
return client.sendStateEvent(roomId, "im.vector.modular.widgets", {
|
||||
[widgetId]: {
|
||||
type: widgetType,
|
||||
url: widgetUrl,
|
||||
name: widgetName,
|
||||
data: widgetData,
|
||||
}
|
||||
});
|
||||
}
|
||||
throw err;
|
||||
}).done(() => {
|
||||
sendResponse(event, {
|
||||
success: true,
|
||||
});
|
||||
}, (err) => {
|
||||
sendError(event, _t('Failed to send request.'), err);
|
||||
});
|
||||
}
|
||||
|
||||
function getWidgets(event, roomId) {
|
||||
returnStateEvent(event, roomId, "im.vector.modular.widgets", "");
|
||||
}
|
||||
|
||||
function setPlumbingState(event, roomId, status) {
|
||||
if (typeof status !== 'string') {
|
||||
throw new Error('Plumbing state status should be a string');
|
||||
@@ -181,7 +347,7 @@ function setPlumbingState(event, roomId, status) {
|
||||
console.log(`Received request to set plumbing state to status "${status}" in room ${roomId}`);
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, "You need to be logged in.");
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
client.sendStateEvent(roomId, "m.room.plumbing", { status : status }).done(() => {
|
||||
@@ -189,7 +355,7 @@ function setPlumbingState(event, roomId, status) {
|
||||
success: true,
|
||||
});
|
||||
}, (err) => {
|
||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
||||
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||
});
|
||||
}
|
||||
|
||||
@@ -197,7 +363,7 @@ function setBotOptions(event, roomId, userId) {
|
||||
console.log(`Received request to set options for bot ${userId} in room ${roomId}`);
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, "You need to be logged in.");
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
client.sendStateEvent(roomId, "m.room.bot.options", event.data.content, "_" + userId).done(() => {
|
||||
@@ -205,20 +371,20 @@ function setBotOptions(event, roomId, userId) {
|
||||
success: true,
|
||||
});
|
||||
}, (err) => {
|
||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
||||
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||
});
|
||||
}
|
||||
|
||||
function setBotPower(event, roomId, userId, level) {
|
||||
if (!(Number.isInteger(level) && level >= 0)) {
|
||||
sendError(event, "Power level must be positive integer.");
|
||||
sendError(event, _t('Power level must be positive integer.'));
|
||||
return;
|
||||
}
|
||||
|
||||
console.log(`Received request to set power level to ${level} for bot ${userId} in room ${roomId}.`);
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, "You need to be logged in.");
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -235,7 +401,7 @@ function setBotPower(event, roomId, userId, level) {
|
||||
success: true,
|
||||
});
|
||||
}, (err) => {
|
||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
||||
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||
});
|
||||
});
|
||||
}
|
||||
@@ -255,15 +421,30 @@ function botOptions(event, roomId, userId) {
|
||||
returnStateEvent(event, roomId, "m.room.bot.options", "_" + userId);
|
||||
}
|
||||
|
||||
function returnStateEvent(event, roomId, eventType, stateKey) {
|
||||
function getMembershipCount(event, roomId) {
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, "You need to be logged in.");
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
const room = client.getRoom(roomId);
|
||||
if (!room) {
|
||||
sendError(event, "This room is not recognised.");
|
||||
sendError(event, _t('This room is not recognised.'));
|
||||
return;
|
||||
}
|
||||
const count = room.getJoinedMembers().length;
|
||||
sendResponse(event, count);
|
||||
}
|
||||
|
||||
function returnStateEvent(event, roomId, eventType, stateKey) {
|
||||
const client = MatrixClientPeg.get();
|
||||
if (!client) {
|
||||
sendError(event, _t('You need to be logged in.'));
|
||||
return;
|
||||
}
|
||||
const room = client.getRoom(roomId);
|
||||
if (!room) {
|
||||
sendError(event, _t('This room is not recognised.'));
|
||||
return;
|
||||
}
|
||||
const stateEvent = room.currentState.getStateEvents(eventType, stateKey);
|
||||
@@ -300,7 +481,7 @@ const onMessage = function(event) {
|
||||
// All strings start with the empty string, so for sanity return if the length
|
||||
// of the event origin is 0.
|
||||
let url = SdkConfig.get().integrations_ui_url;
|
||||
if (event.origin.length === 0 || !url.startsWith(event.origin)) {
|
||||
if (event.origin.length === 0 || !url.startsWith(event.origin) || !event.data.action) {
|
||||
return; // don't log this - debugging APIs like to spam postMessage which floods the log otherwise
|
||||
}
|
||||
|
||||
@@ -313,13 +494,13 @@ const onMessage = function(event) {
|
||||
const roomId = event.data.room_id;
|
||||
const userId = event.data.user_id;
|
||||
if (!roomId) {
|
||||
sendError(event, "Missing room_id in request");
|
||||
sendError(event, _t('Missing room_id in request'));
|
||||
return;
|
||||
}
|
||||
let promise = Promise.resolve(currentRoomId);
|
||||
if (!currentRoomId) {
|
||||
if (!currentRoomAlias) {
|
||||
sendError(event, "Must be viewing a room");
|
||||
sendError(event, _t('Must be viewing a room'));
|
||||
return;
|
||||
}
|
||||
// no room ID but there is an alias, look it up.
|
||||
@@ -331,21 +512,30 @@ const onMessage = function(event) {
|
||||
|
||||
promise.then((viewingRoomId) => {
|
||||
if (roomId !== viewingRoomId) {
|
||||
sendError(event, "Room " + roomId + " not visible");
|
||||
sendError(event, _t('Room %(roomId)s not visible', {roomId: roomId}));
|
||||
return;
|
||||
}
|
||||
|
||||
// Getting join rules does not require userId
|
||||
// These APIs don't require userId
|
||||
if (event.data.action === "join_rules_state") {
|
||||
getJoinRules(event, roomId);
|
||||
return;
|
||||
} else if (event.data.action === "set_plumbing_state") {
|
||||
setPlumbingState(event, roomId, event.data.status);
|
||||
return;
|
||||
} else if (event.data.action === "get_membership_count") {
|
||||
getMembershipCount(event, roomId);
|
||||
return;
|
||||
} else if (event.data.action === "set_widget") {
|
||||
setWidget(event, roomId);
|
||||
return;
|
||||
} else if (event.data.action === "get_widgets") {
|
||||
getWidgets(event, roomId);
|
||||
return;
|
||||
}
|
||||
|
||||
if (!userId) {
|
||||
sendError(event, "Missing user_id in request");
|
||||
sendError(event, _t('Missing user_id in request'));
|
||||
return;
|
||||
}
|
||||
switch (event.data.action) {
|
||||
@@ -370,16 +560,31 @@ const onMessage = function(event) {
|
||||
}
|
||||
}, (err) => {
|
||||
console.error(err);
|
||||
sendError(event, "Failed to lookup current room.");
|
||||
sendError(event, _t('Failed to lookup current room') + '.');
|
||||
});
|
||||
};
|
||||
|
||||
let listenerCount = 0;
|
||||
module.exports = {
|
||||
startListening: function() {
|
||||
window.addEventListener("message", onMessage, false);
|
||||
if (listenerCount === 0) {
|
||||
window.addEventListener("message", onMessage, false);
|
||||
}
|
||||
listenerCount += 1;
|
||||
},
|
||||
|
||||
stopListening: function() {
|
||||
window.removeEventListener("message", onMessage);
|
||||
listenerCount -= 1;
|
||||
if (listenerCount === 0) {
|
||||
window.removeEventListener("message", onMessage);
|
||||
}
|
||||
if (listenerCount < 0) {
|
||||
// Make an error so we get a stack trace
|
||||
const e = new Error(
|
||||
"ScalarMessaging: mismatched startListening / stopListening detected." +
|
||||
" Negative count"
|
||||
);
|
||||
console.error(e);
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
@@ -14,7 +14,7 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var DEFAULTS = {
|
||||
const DEFAULTS = {
|
||||
// URL to a page we show in an iframe to configure integrations
|
||||
integrations_ui_url: "https://scalar.vector.im/",
|
||||
// Base URL to the REST interface of the integrations server
|
||||
@@ -30,8 +30,8 @@ class SdkConfig {
|
||||
}
|
||||
|
||||
static put(cfg) {
|
||||
var defaultKeys = Object.keys(DEFAULTS);
|
||||
for (var i = 0; i < defaultKeys.length; ++i) {
|
||||
const defaultKeys = Object.keys(DEFAULTS);
|
||||
for (let i = 0; i < defaultKeys.length; ++i) {
|
||||
if (cfg[defaultKeys[i]] === undefined) {
|
||||
cfg[defaultKeys[i]] = DEFAULTS[defaultKeys[i]];
|
||||
}
|
||||
|
||||
@@ -23,41 +23,46 @@ class Skinner {
|
||||
if (this.components === null) {
|
||||
throw new Error(
|
||||
"Attempted to get a component before a skin has been loaded."+
|
||||
"This is probably because either:"+
|
||||
" This is probably because either:"+
|
||||
" a) Your app has not called sdk.loadSkin(), or"+
|
||||
" b) A component has called getComponent at the root level"
|
||||
" b) A component has called getComponent at the root level",
|
||||
);
|
||||
}
|
||||
var comp = this.components[name];
|
||||
if (comp) {
|
||||
return comp;
|
||||
}
|
||||
let comp = this.components[name];
|
||||
// XXX: Temporarily also try 'views.' as we're currently
|
||||
// leaving the 'views.' off views.
|
||||
var comp = this.components['views.'+name];
|
||||
if (comp) {
|
||||
return comp;
|
||||
if (!comp) {
|
||||
comp = this.components['views.'+name];
|
||||
}
|
||||
throw new Error("No such component: "+name);
|
||||
|
||||
if (!comp) {
|
||||
throw new Error("No such component: "+name);
|
||||
}
|
||||
|
||||
// components have to be functions.
|
||||
const validType = typeof comp === 'function';
|
||||
if (!validType) {
|
||||
throw new Error(`Not a valid component: ${name}.`);
|
||||
}
|
||||
return comp;
|
||||
}
|
||||
|
||||
load(skinObject) {
|
||||
if (this.components !== null) {
|
||||
throw new Error(
|
||||
"Attempted to load a skin while a skin is already loaded"+
|
||||
"If you want to change the active skin, call resetSkin first"
|
||||
);
|
||||
"If you want to change the active skin, call resetSkin first");
|
||||
}
|
||||
this.components = {};
|
||||
var compKeys = Object.keys(skinObject.components);
|
||||
for (var i = 0; i < compKeys.length; ++i) {
|
||||
var comp = skinObject.components[compKeys[i]];
|
||||
const compKeys = Object.keys(skinObject.components);
|
||||
for (let i = 0; i < compKeys.length; ++i) {
|
||||
const comp = skinObject.components[compKeys[i]];
|
||||
this.addComponent(compKeys[i], comp);
|
||||
}
|
||||
}
|
||||
|
||||
addComponent(name, comp) {
|
||||
var slot = name;
|
||||
let slot = name;
|
||||
if (comp.replaces !== undefined) {
|
||||
if (comp.replaces.indexOf('.') > -1) {
|
||||
slot = comp.replaces;
|
||||
|
||||
@@ -14,10 +14,11 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
var dis = require("./dispatcher");
|
||||
var Tinter = require("./Tinter");
|
||||
import MatrixClientPeg from "./MatrixClientPeg";
|
||||
import dis from "./dispatcher";
|
||||
import Tinter from "./Tinter";
|
||||
import sdk from './index';
|
||||
import { _t } from './languageHandler';
|
||||
import Modal from './Modal';
|
||||
|
||||
|
||||
@@ -41,58 +42,64 @@ class Command {
|
||||
}
|
||||
|
||||
getUsage() {
|
||||
return "Usage: " + this.getCommandWithArgs();
|
||||
return _t('Usage') + ': ' + this.getCommandWithArgs();
|
||||
}
|
||||
}
|
||||
|
||||
var reject = function(msg) {
|
||||
function reject(msg) {
|
||||
return {
|
||||
error: msg
|
||||
error: msg,
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
var success = function(promise) {
|
||||
function success(promise) {
|
||||
return {
|
||||
promise: promise
|
||||
promise: promise,
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
var commands = {
|
||||
/* Disable the "unexpected this" error for these commands - all of the run
|
||||
* functions are called with `this` bound to the Command instance.
|
||||
*/
|
||||
|
||||
/* eslint-disable babel/no-invalid-this */
|
||||
|
||||
const commands = {
|
||||
ddg: new Command("ddg", "<query>", function(roomId, args) {
|
||||
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||
// TODO Don't explain this away, actually show a search UI here.
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "/ddg is not a command",
|
||||
description: "To use it, just wait for autocomplete results to load and tab through them.",
|
||||
title: _t('/ddg is not a command'),
|
||||
description: _t('To use it, just wait for autocomplete results to load and tab through them.'),
|
||||
});
|
||||
return success();
|
||||
}),
|
||||
|
||||
// Change your nickname
|
||||
nick: new Command("nick", "<display_name>", function(room_id, args) {
|
||||
nick: new Command("nick", "<display_name>", function(roomId, args) {
|
||||
if (args) {
|
||||
return success(
|
||||
MatrixClientPeg.get().setDisplayName(args)
|
||||
MatrixClientPeg.get().setDisplayName(args),
|
||||
);
|
||||
}
|
||||
return reject(this.getUsage());
|
||||
}),
|
||||
|
||||
// Changes the colorscheme of your current room
|
||||
tint: new Command("tint", "<color1> [<color2>]", function(room_id, args) {
|
||||
tint: new Command("tint", "<color1> [<color2>]", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
||||
const matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
||||
if (matches) {
|
||||
Tinter.tint(matches[1], matches[4]);
|
||||
var colorScheme = {};
|
||||
const colorScheme = {};
|
||||
colorScheme.primary_color = matches[1];
|
||||
if (matches[4]) {
|
||||
colorScheme.secondary_color = matches[4];
|
||||
}
|
||||
return success(
|
||||
MatrixClientPeg.get().setRoomAccountData(
|
||||
room_id, "org.matrix.room.color_scheme", colorScheme
|
||||
)
|
||||
roomId, "org.matrix.room.color_scheme", colorScheme,
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -100,22 +107,22 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Change the room topic
|
||||
topic: new Command("topic", "<topic>", function(room_id, args) {
|
||||
topic: new Command("topic", "<topic>", function(roomId, args) {
|
||||
if (args) {
|
||||
return success(
|
||||
MatrixClientPeg.get().setRoomTopic(room_id, args)
|
||||
MatrixClientPeg.get().setRoomTopic(roomId, args),
|
||||
);
|
||||
}
|
||||
return reject(this.getUsage());
|
||||
}),
|
||||
|
||||
// Invite a user
|
||||
invite: new Command("invite", "<userId>", function(room_id, args) {
|
||||
invite: new Command("invite", "<userId>", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+)$/);
|
||||
const matches = args.match(/^(\S+)$/);
|
||||
if (matches) {
|
||||
return success(
|
||||
MatrixClientPeg.get().invite(room_id, matches[1])
|
||||
MatrixClientPeg.get().invite(roomId, matches[1]),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -123,21 +130,21 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Join a room
|
||||
join: new Command("join", "#alias:domain", function(room_id, args) {
|
||||
join: new Command("join", "#alias:domain", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+)$/);
|
||||
const matches = args.match(/^(\S+)$/);
|
||||
if (matches) {
|
||||
var room_alias = matches[1];
|
||||
if (room_alias[0] !== '#') {
|
||||
let roomAlias = matches[1];
|
||||
if (roomAlias[0] !== '#') {
|
||||
return reject(this.getUsage());
|
||||
}
|
||||
if (!room_alias.match(/:/)) {
|
||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
||||
if (!roomAlias.match(/:/)) {
|
||||
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||
}
|
||||
|
||||
dis.dispatch({
|
||||
action: 'view_room',
|
||||
room_alias: room_alias,
|
||||
room_alias: roomAlias,
|
||||
auto_join: true,
|
||||
});
|
||||
|
||||
@@ -147,29 +154,29 @@ var commands = {
|
||||
return reject(this.getUsage());
|
||||
}),
|
||||
|
||||
part: new Command("part", "[#alias:domain]", function(room_id, args) {
|
||||
var targetRoomId;
|
||||
part: new Command("part", "[#alias:domain]", function(roomId, args) {
|
||||
let targetRoomId;
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+)$/);
|
||||
const matches = args.match(/^(\S+)$/);
|
||||
if (matches) {
|
||||
var room_alias = matches[1];
|
||||
if (room_alias[0] !== '#') {
|
||||
let roomAlias = matches[1];
|
||||
if (roomAlias[0] !== '#') {
|
||||
return reject(this.getUsage());
|
||||
}
|
||||
if (!room_alias.match(/:/)) {
|
||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
||||
if (!roomAlias.match(/:/)) {
|
||||
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||
}
|
||||
|
||||
// Try to find a room with this alias
|
||||
var rooms = MatrixClientPeg.get().getRooms();
|
||||
for (var i = 0; i < rooms.length; i++) {
|
||||
var aliasEvents = rooms[i].currentState.getStateEvents(
|
||||
"m.room.aliases"
|
||||
const rooms = MatrixClientPeg.get().getRooms();
|
||||
for (let i = 0; i < rooms.length; i++) {
|
||||
const aliasEvents = rooms[i].currentState.getStateEvents(
|
||||
"m.room.aliases",
|
||||
);
|
||||
for (var j = 0; j < aliasEvents.length; j++) {
|
||||
var aliases = aliasEvents[j].getContent().aliases || [];
|
||||
for (var k = 0; k < aliases.length; k++) {
|
||||
if (aliases[k] === room_alias) {
|
||||
for (let j = 0; j < aliasEvents.length; j++) {
|
||||
const aliases = aliasEvents[j].getContent().aliases || [];
|
||||
for (let k = 0; k < aliases.length; k++) {
|
||||
if (aliases[k] === roomAlias) {
|
||||
targetRoomId = rooms[i].roomId;
|
||||
break;
|
||||
}
|
||||
@@ -178,27 +185,28 @@ var commands = {
|
||||
}
|
||||
if (targetRoomId) { break; }
|
||||
}
|
||||
}
|
||||
if (!targetRoomId) {
|
||||
return reject("Unrecognised room alias: " + room_alias);
|
||||
if (!targetRoomId) {
|
||||
return reject(_t("Unrecognised room alias:") + ' ' + roomAlias);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (!targetRoomId) targetRoomId = room_id;
|
||||
if (!targetRoomId) targetRoomId = roomId;
|
||||
return success(
|
||||
MatrixClientPeg.get().leave(targetRoomId).then(
|
||||
function() {
|
||||
dis.dispatch({action: 'view_next_room'});
|
||||
})
|
||||
function() {
|
||||
dis.dispatch({action: 'view_next_room'});
|
||||
},
|
||||
),
|
||||
);
|
||||
}),
|
||||
|
||||
// Kick a user from the room with an optional reason
|
||||
kick: new Command("kick", "<userId> [<reason>]", function(room_id, args) {
|
||||
kick: new Command("kick", "<userId> [<reason>]", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||
if (matches) {
|
||||
return success(
|
||||
MatrixClientPeg.get().kick(room_id, matches[1], matches[3])
|
||||
MatrixClientPeg.get().kick(roomId, matches[1], matches[3]),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -206,12 +214,12 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Ban a user from the room with an optional reason
|
||||
ban: new Command("ban", "<userId> [<reason>]", function(room_id, args) {
|
||||
ban: new Command("ban", "<userId> [<reason>]", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||
if (matches) {
|
||||
return success(
|
||||
MatrixClientPeg.get().ban(room_id, matches[1], matches[3])
|
||||
MatrixClientPeg.get().ban(roomId, matches[1], matches[3]),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -219,13 +227,13 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Unban a user from the room
|
||||
unban: new Command("unban", "<userId>", function(room_id, args) {
|
||||
unban: new Command("unban", "<userId>", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+)$/);
|
||||
const matches = args.match(/^(\S+)$/);
|
||||
if (matches) {
|
||||
// Reset the user membership to "leave" to unban him
|
||||
return success(
|
||||
MatrixClientPeg.get().unban(room_id, matches[1])
|
||||
MatrixClientPeg.get().unban(roomId, matches[1]),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -233,27 +241,27 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Define the power level of a user
|
||||
op: new Command("op", "<userId> [<power level>]", function(room_id, args) {
|
||||
op: new Command("op", "<userId> [<power level>]", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+?)( +(\d+))?$/);
|
||||
var powerLevel = 50; // default power level for op
|
||||
const matches = args.match(/^(\S+?)( +(\d+))?$/);
|
||||
let powerLevel = 50; // default power level for op
|
||||
if (matches) {
|
||||
var user_id = matches[1];
|
||||
const userId = matches[1];
|
||||
if (matches.length === 4 && undefined !== matches[3]) {
|
||||
powerLevel = parseInt(matches[3]);
|
||||
}
|
||||
if (powerLevel !== NaN) {
|
||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
||||
if (!isNaN(powerLevel)) {
|
||||
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||
if (!room) {
|
||||
return reject("Bad room ID: " + room_id);
|
||||
return reject("Bad room ID: " + roomId);
|
||||
}
|
||||
var powerLevelEvent = room.currentState.getStateEvents(
|
||||
"m.room.power_levels", ""
|
||||
const powerLevelEvent = room.currentState.getStateEvents(
|
||||
"m.room.power_levels", "",
|
||||
);
|
||||
return success(
|
||||
MatrixClientPeg.get().setPowerLevel(
|
||||
room_id, user_id, powerLevel, powerLevelEvent
|
||||
)
|
||||
roomId, userId, powerLevel, powerLevelEvent,
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -262,32 +270,93 @@ var commands = {
|
||||
}),
|
||||
|
||||
// Reset the power level of a user
|
||||
deop: new Command("deop", "<userId>", function(room_id, args) {
|
||||
deop: new Command("deop", "<userId>", function(roomId, args) {
|
||||
if (args) {
|
||||
var matches = args.match(/^(\S+)$/);
|
||||
const matches = args.match(/^(\S+)$/);
|
||||
if (matches) {
|
||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
||||
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||
if (!room) {
|
||||
return reject("Bad room ID: " + room_id);
|
||||
return reject("Bad room ID: " + roomId);
|
||||
}
|
||||
|
||||
var powerLevelEvent = room.currentState.getStateEvents(
|
||||
"m.room.power_levels", ""
|
||||
const powerLevelEvent = room.currentState.getStateEvents(
|
||||
"m.room.power_levels", "",
|
||||
);
|
||||
return success(
|
||||
MatrixClientPeg.get().setPowerLevel(
|
||||
room_id, args, undefined, powerLevelEvent
|
||||
)
|
||||
roomId, args, undefined, powerLevelEvent,
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
return reject(this.getUsage());
|
||||
})
|
||||
}),
|
||||
|
||||
// Verify a user, device, and pubkey tuple
|
||||
verify: new Command("verify", "<userId> <deviceId> <deviceSigningKey>", function(roomId, args) {
|
||||
if (args) {
|
||||
const matches = args.match(/^(\S+) +(\S+) +(\S+)$/);
|
||||
if (matches) {
|
||||
const userId = matches[1];
|
||||
const deviceId = matches[2];
|
||||
const fingerprint = matches[3];
|
||||
|
||||
const device = MatrixClientPeg.get().getStoredDevice(userId, deviceId);
|
||||
if (!device) {
|
||||
return reject(_t(`Unknown (user, device) pair:`) + ` (${userId}, ${deviceId})`);
|
||||
}
|
||||
|
||||
if (device.isVerified()) {
|
||||
if (device.getFingerprint() === fingerprint) {
|
||||
return reject(_t(`Device already verified!`));
|
||||
} else {
|
||||
return reject(_t(`WARNING: Device already verified, but keys do NOT MATCH!`));
|
||||
}
|
||||
}
|
||||
|
||||
if (device.getFingerprint() === fingerprint) {
|
||||
MatrixClientPeg.get().setDeviceVerified(
|
||||
userId, deviceId, true,
|
||||
);
|
||||
|
||||
// Tell the user we verified everything!
|
||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
Modal.createDialog(QuestionDialog, {
|
||||
title: _t("Verified key"),
|
||||
description: (
|
||||
<div>
|
||||
<p>
|
||||
{
|
||||
_t("The signing key you provided matches the signing key you received " +
|
||||
"from %(userId)s's device %(deviceId)s. Device marked as verified.",
|
||||
{userId: userId, deviceId: deviceId})
|
||||
}
|
||||
</p>
|
||||
</div>
|
||||
),
|
||||
hasCancelButton: false,
|
||||
});
|
||||
|
||||
return success();
|
||||
} else {
|
||||
const fprint = device.getFingerprint();
|
||||
return reject(
|
||||
_t('WARNING: KEY VERIFICATION FAILED! The signing key for %(userId)s and device' +
|
||||
' %(deviceId)s is "%(fprint)s" which does not match the provided key' +
|
||||
' "%(fingerprint)s". This could mean your communications are being intercepted!',
|
||||
{deviceId: deviceId, fprint: fprint, userId: userId, fingerprint: fingerprint}));
|
||||
}
|
||||
}
|
||||
}
|
||||
return reject(this.getUsage());
|
||||
}),
|
||||
};
|
||||
/* eslint-enable babel/no-invalid-this */
|
||||
|
||||
|
||||
// helpful aliases
|
||||
var aliases = {
|
||||
j: "join"
|
||||
const aliases = {
|
||||
j: "join",
|
||||
};
|
||||
|
||||
module.exports = {
|
||||
@@ -304,13 +373,13 @@ module.exports = {
|
||||
// IRC-style commands
|
||||
input = input.replace(/\s+$/, "");
|
||||
if (input[0] === "/" && input[1] !== "/") {
|
||||
var bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
||||
var cmd, args;
|
||||
const bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
||||
let cmd;
|
||||
let args;
|
||||
if (bits) {
|
||||
cmd = bits[1].substring(1).toLowerCase();
|
||||
args = bits[3];
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
cmd = input;
|
||||
}
|
||||
if (cmd === "me") return null;
|
||||
@@ -319,9 +388,8 @@ module.exports = {
|
||||
}
|
||||
if (commands[cmd]) {
|
||||
return commands[cmd].run(roomId, args);
|
||||
}
|
||||
else {
|
||||
return reject("Unrecognised command: " + input);
|
||||
} else {
|
||||
return reject(_t("Unrecognised command:") + ' ' + input);
|
||||
}
|
||||
}
|
||||
return null; // not a command
|
||||
@@ -329,12 +397,12 @@ module.exports = {
|
||||
|
||||
getCommandList: function() {
|
||||
// Return all the commands plus /me and /markdown which aren't handled like normal commands
|
||||
var cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
||||
const cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
||||
return commands[cmdKey];
|
||||
});
|
||||
cmds.push(new Command("me", "<action>", function() {}));
|
||||
cmds.push(new Command("markdown", "<on|off>", function() {}));
|
||||
|
||||
return cmds;
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
@@ -13,10 +13,9 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
var CallHandler = require("./CallHandler");
|
||||
|
||||
import MatrixClientPeg from "./MatrixClientPeg";
|
||||
import CallHandler from "./CallHandler";
|
||||
import { _t } from './languageHandler';
|
||||
import * as Roles from './Roles';
|
||||
|
||||
function textForMemberEvent(ev) {
|
||||
@@ -25,95 +24,103 @@ function textForMemberEvent(ev) {
|
||||
var targetName = ev.target ? ev.target.name : ev.getStateKey();
|
||||
var ConferenceHandler = CallHandler.getConferenceHandler();
|
||||
var reason = ev.getContent().reason ? (
|
||||
" Reason: " + ev.getContent().reason
|
||||
_t('Reason') + ': ' + ev.getContent().reason
|
||||
) : "";
|
||||
switch (ev.getContent().membership) {
|
||||
case 'invite':
|
||||
var threePidContent = ev.getContent().third_party_invite;
|
||||
if (threePidContent) {
|
||||
if (threePidContent.display_name) {
|
||||
return targetName + " accepted the invitation for " +
|
||||
threePidContent.display_name + ".";
|
||||
return _t('%(targetName)s accepted the invitation for %(displayName)s.', {targetName: targetName, displayName: threePidContent.display_name});
|
||||
} else {
|
||||
return targetName + " accepted an invitation.";
|
||||
return _t('%(targetName)s accepted an invitation.', {targetName: targetName});
|
||||
}
|
||||
}
|
||||
else {
|
||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||
return senderName + " requested a VoIP conference";
|
||||
return _t('%(senderName)s requested a VoIP conference.', {senderName: senderName});
|
||||
}
|
||||
else {
|
||||
return senderName + " invited " + targetName + ".";
|
||||
return _t('%(senderName)s invited %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||
}
|
||||
}
|
||||
case 'ban':
|
||||
return senderName + " banned " + targetName + "." + reason;
|
||||
return _t(
|
||||
'%(senderName)s banned %(targetName)s.',
|
||||
{senderName: senderName, targetName: targetName}
|
||||
) + ' ' + reason;
|
||||
case 'join':
|
||||
if (ev.getPrevContent() && ev.getPrevContent().membership == 'join') {
|
||||
if (ev.getPrevContent().displayname && ev.getContent().displayname && ev.getPrevContent().displayname != ev.getContent().displayname) {
|
||||
return ev.getSender() + " changed their display name from " +
|
||||
ev.getPrevContent().displayname + " to " +
|
||||
ev.getContent().displayname;
|
||||
return _t('%(senderName)s changed their display name from %(oldDisplayName)s to %(displayName)s.', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname, displayName: ev.getContent().displayname});
|
||||
} else if (!ev.getPrevContent().displayname && ev.getContent().displayname) {
|
||||
return ev.getSender() + " set their display name to " + ev.getContent().displayname;
|
||||
return _t('%(senderName)s set their display name to %(displayName)s.', {senderName: ev.getSender(), displayName: ev.getContent().displayname});
|
||||
} else if (ev.getPrevContent().displayname && !ev.getContent().displayname) {
|
||||
return ev.getSender() + " removed their display name (" + ev.getPrevContent().displayname + ")";
|
||||
return _t('%(senderName)s removed their display name (%(oldDisplayName)s).', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname});
|
||||
} else if (ev.getPrevContent().avatar_url && !ev.getContent().avatar_url) {
|
||||
return senderName + " removed their profile picture";
|
||||
return _t('%(senderName)s removed their profile picture.', {senderName: senderName});
|
||||
} else if (ev.getPrevContent().avatar_url && ev.getContent().avatar_url && ev.getPrevContent().avatar_url != ev.getContent().avatar_url) {
|
||||
return senderName + " changed their profile picture";
|
||||
return _t('%(senderName)s changed their profile picture.', {senderName: senderName});
|
||||
} else if (!ev.getPrevContent().avatar_url && ev.getContent().avatar_url) {
|
||||
return senderName + " set a profile picture";
|
||||
return _t('%(senderName)s set a profile picture.', {senderName: senderName});
|
||||
} else {
|
||||
// hacky hack for https://github.com/vector-im/vector-web/issues/2020
|
||||
return senderName + " rejoined the room.";
|
||||
// suppress null rejoins
|
||||
return '';
|
||||
}
|
||||
} else {
|
||||
if (!ev.target) console.warn("Join message has no target! -- " + ev.getContent().state_key);
|
||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||
return "VoIP conference started";
|
||||
return _t('VoIP conference started.');
|
||||
}
|
||||
else {
|
||||
return targetName + " joined the room.";
|
||||
return _t('%(targetName)s joined the room.', {targetName: targetName});
|
||||
}
|
||||
}
|
||||
case 'leave':
|
||||
if (ev.getSender() === ev.getStateKey()) {
|
||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||
return "VoIP conference finished";
|
||||
return _t('VoIP conference finished.');
|
||||
}
|
||||
else if (ev.getPrevContent().membership === "invite") {
|
||||
return targetName + " rejected the invitation.";
|
||||
return _t('%(targetName)s rejected the invitation.', {targetName: targetName});
|
||||
}
|
||||
else {
|
||||
return targetName + " left the room.";
|
||||
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||
}
|
||||
}
|
||||
else if (ev.getPrevContent().membership === "ban") {
|
||||
return senderName + " unbanned " + targetName + ".";
|
||||
return _t('%(senderName)s unbanned %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||
}
|
||||
else if (ev.getPrevContent().membership === "join") {
|
||||
return senderName + " kicked " + targetName + "." + reason;
|
||||
return _t(
|
||||
'%(senderName)s kicked %(targetName)s.',
|
||||
{senderName: senderName, targetName: targetName}
|
||||
) + ' ' + reason;
|
||||
}
|
||||
else if (ev.getPrevContent().membership === "invite") {
|
||||
return senderName + " withdrew " + targetName + "'s invitation." + reason;
|
||||
return _t(
|
||||
'%(senderName)s withdrew %(targetName)s\'s invitation.',
|
||||
{senderName: senderName, targetName: targetName}
|
||||
) + ' ' + reason;
|
||||
}
|
||||
else {
|
||||
return targetName + " left the room.";
|
||||
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
function textForTopicEvent(ev) {
|
||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||
|
||||
return senderDisplayName + ' changed the topic to "' + ev.getContent().topic + '"';
|
||||
return _t('%(senderDisplayName)s changed the topic to "%(topic)s".', {senderDisplayName: senderDisplayName, topic: ev.getContent().topic});
|
||||
}
|
||||
|
||||
function textForRoomNameEvent(ev) {
|
||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||
|
||||
return senderDisplayName + ' changed the room name to "' + ev.getContent().name + '"';
|
||||
if (!ev.getContent().name || ev.getContent().name.trim().length === 0) {
|
||||
return _t('%(senderDisplayName)s removed the room name.', {senderDisplayName: senderDisplayName});
|
||||
}
|
||||
return _t('%(senderDisplayName)s changed the room name to %(roomName)s.', {senderDisplayName: senderDisplayName, roomName: ev.getContent().name});
|
||||
}
|
||||
|
||||
function textForMessageEvent(ev) {
|
||||
@@ -122,66 +129,78 @@ function textForMessageEvent(ev) {
|
||||
if (ev.getContent().msgtype === "m.emote") {
|
||||
message = "* " + senderDisplayName + " " + message;
|
||||
} else if (ev.getContent().msgtype === "m.image") {
|
||||
message = senderDisplayName + " sent an image.";
|
||||
message = _t('%(senderDisplayName)s sent an image.', {senderDisplayName: senderDisplayName});
|
||||
}
|
||||
return message;
|
||||
}
|
||||
|
||||
function textForCallAnswerEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : "Someone";
|
||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
||||
return senderName + " answered the call." + supported;
|
||||
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||
return _t('%(senderName)s answered the call.', {senderName: senderName}) + ' ' + supported;
|
||||
}
|
||||
|
||||
function textForCallHangupEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : "Someone";
|
||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
||||
return senderName + " ended the call." + supported;
|
||||
const senderName = event.sender ? event.sender.name : _t('Someone');
|
||||
const eventContent = event.getContent();
|
||||
let reason = "";
|
||||
if(!MatrixClientPeg.get().supportsVoip()) {
|
||||
reason = _t('(not supported by this browser)');
|
||||
} else if(eventContent.reason) {
|
||||
if (eventContent.reason === "ice_failed") {
|
||||
reason = _t('(could not connect media)');
|
||||
} else if (eventContent.reason === "invite_timeout") {
|
||||
reason = _t('(no answer)');
|
||||
} else {
|
||||
reason = _t('(unknown failure: %(reason)s)', {reason: eventContent.reason});
|
||||
}
|
||||
}
|
||||
return _t('%(senderName)s ended the call.', {senderName}) + ' ' + reason;
|
||||
}
|
||||
|
||||
function textForCallInviteEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : "Someone";
|
||||
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||
// FIXME: Find a better way to determine this from the event?
|
||||
var type = "voice";
|
||||
if (event.getContent().offer && event.getContent().offer.sdp &&
|
||||
event.getContent().offer.sdp.indexOf('m=video') !== -1) {
|
||||
type = "video";
|
||||
}
|
||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
||||
return senderName + " placed a " + type + " call." + supported;
|
||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||
return _t('%(senderName)s placed a %(callType)s call.', {senderName: senderName, callType: type}) + ' ' + supported;
|
||||
}
|
||||
|
||||
function textForThreePidInviteEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||
return senderName + " sent an invitation to " + event.getContent().display_name +
|
||||
" to join the room.";
|
||||
return _t('%(senderName)s sent an invitation to %(targetDisplayName)s to join the room.', {senderName: senderName, targetDisplayName: event.getContent().display_name});
|
||||
}
|
||||
|
||||
function textForHistoryVisibilityEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||
var vis = event.getContent().history_visibility;
|
||||
var text = senderName + " made future room history visible to ";
|
||||
// XXX: This i18n just isn't going to work for languages with different sentence structure.
|
||||
var text = _t('%(senderName)s made future room history visible to', {senderName: senderName}) + ' ';
|
||||
if (vis === "invited") {
|
||||
text += "all room members, from the point they are invited.";
|
||||
text += _t('all room members, from the point they are invited') + '.';
|
||||
}
|
||||
else if (vis === "joined") {
|
||||
text += "all room members, from the point they joined.";
|
||||
text += _t('all room members, from the point they joined') + '.';
|
||||
}
|
||||
else if (vis === "shared") {
|
||||
text += "all room members.";
|
||||
text += _t('all room members') + '.';
|
||||
}
|
||||
else if (vis === "world_readable") {
|
||||
text += "anyone.";
|
||||
text += _t('anyone') + '.';
|
||||
}
|
||||
else {
|
||||
text += " unknown (" + vis + ")";
|
||||
text += ' ' + _t('unknown') + ' (' + vis + ').';
|
||||
}
|
||||
return text;
|
||||
}
|
||||
|
||||
function textForEncryptionEvent(event) {
|
||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||
return senderName + " turned on end-to-end encryption (algorithm " + event.getContent().algorithm + ")";
|
||||
return _t('%(senderName)s turned on end-to-end encryption (algorithm %(algorithm)s).', {senderName: senderName, algorithm: event.getContent().algorithm});
|
||||
}
|
||||
|
||||
// Currently will only display a change if a user's power level is changed
|
||||
@@ -204,6 +223,7 @@ function textForPowerEvent(event) {
|
||||
}
|
||||
);
|
||||
let diff = [];
|
||||
// XXX: This is also surely broken for i18n
|
||||
users.forEach((userId) => {
|
||||
// Previous power level
|
||||
const from = event.getPrevContent().users[userId];
|
||||
@@ -211,16 +231,21 @@ function textForPowerEvent(event) {
|
||||
const to = event.getContent().users[userId];
|
||||
if (to !== from) {
|
||||
diff.push(
|
||||
userId +
|
||||
' from ' + Roles.textualPowerLevel(from, userDefault) +
|
||||
' to ' + Roles.textualPowerLevel(to, userDefault)
|
||||
_t('%(userId)s from %(fromPowerLevel)s to %(toPowerLevel)s', {
|
||||
userId: userId,
|
||||
fromPowerLevel: Roles.textualPowerLevel(from, userDefault),
|
||||
toPowerLevel: Roles.textualPowerLevel(to, userDefault)
|
||||
})
|
||||
);
|
||||
}
|
||||
});
|
||||
if (!diff.length) {
|
||||
return '';
|
||||
}
|
||||
return senderName + ' changed the power level of ' + diff.join(', ');
|
||||
return _t('%(senderName)s changed the power level of %(powerLevelDiffText)s.', {
|
||||
senderName: senderName,
|
||||
powerLevelDiffText: diff.join(", ")
|
||||
});
|
||||
}
|
||||
|
||||
var handlers = {
|
||||
|
||||
@@ -22,7 +22,7 @@ let isDialogOpen = false;
|
||||
|
||||
const onAction = function(payload) {
|
||||
if (payload.action === 'unknown_device_error' && !isDialogOpen) {
|
||||
var UnknownDeviceDialog = sdk.getComponent("dialogs.UnknownDeviceDialog");
|
||||
const UnknownDeviceDialog = sdk.getComponent('dialogs.UnknownDeviceDialog');
|
||||
isDialogOpen = true;
|
||||
Modal.createDialog(UnknownDeviceDialog, {
|
||||
devices: payload.err.devices,
|
||||
@@ -33,17 +33,17 @@ const onAction = function(payload) {
|
||||
// https://github.com/vector-im/riot-web/issues/3148
|
||||
console.log('UnknownDeviceDialog closed with '+r);
|
||||
},
|
||||
}, "mx_Dialog_unknownDevice");
|
||||
}, 'mx_Dialog_unknownDevice');
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
let ref = null;
|
||||
|
||||
export function startListening () {
|
||||
export function startListening() {
|
||||
ref = dis.register(onAction);
|
||||
}
|
||||
|
||||
export function stopListening () {
|
||||
export function stopListening() {
|
||||
if (ref) {
|
||||
dis.unregister(ref);
|
||||
ref = null;
|
||||
|
||||
@@ -25,7 +25,9 @@ module.exports = {
|
||||
eventTriggersUnreadCount: function(ev) {
|
||||
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) {
|
||||
return false;
|
||||
} else if (ev.getType() == "m.room.member") {
|
||||
} else if (ev.getType() == 'm.room.member') {
|
||||
return false;
|
||||
} else if (ev.getType() == 'm.call.answer' || ev.getType() == 'm.call.hangup') {
|
||||
return false;
|
||||
} else if (ev.getType == 'm.room.message' && ev.getContent().msgtype == 'm.notify') {
|
||||
return false;
|
||||
@@ -35,7 +37,26 @@ module.exports = {
|
||||
},
|
||||
|
||||
doesRoomHaveUnreadMessages: function(room) {
|
||||
var readUpToId = room.getEventReadUpTo(MatrixClientPeg.get().credentials.userId);
|
||||
var myUserId = MatrixClientPeg.get().credentials.userId;
|
||||
|
||||
// get the most recent read receipt sent by our account.
|
||||
// N.B. this is NOT a read marker (RM, aka "read up to marker"),
|
||||
// despite the name of the method :((
|
||||
var readUpToId = room.getEventReadUpTo(myUserId);
|
||||
|
||||
// as we don't send RRs for our own messages, make sure we special case that
|
||||
// if *we* sent the last message into the room, we consider it not unread!
|
||||
// Should fix: https://github.com/vector-im/riot-web/issues/3263
|
||||
// https://github.com/vector-im/riot-web/issues/2427
|
||||
// ...and possibly some of the others at
|
||||
// https://github.com/vector-im/riot-web/issues/3363
|
||||
if (room.timeline.length &&
|
||||
room.timeline[room.timeline.length - 1].sender &&
|
||||
room.timeline[room.timeline.length - 1].sender.userId === myUserId)
|
||||
{
|
||||
return false;
|
||||
}
|
||||
|
||||
// this just looks at whatever history we have, which if we've only just started
|
||||
// up probably won't be very much, so if the last couple of events are ones that
|
||||
// don't count, we don't know if there are any events that do count between where
|
||||
|
||||
@@ -14,10 +14,10 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var dis = require("./dispatcher");
|
||||
import dis from './dispatcher';
|
||||
|
||||
var MIN_DISPATCH_INTERVAL_MS = 500;
|
||||
var CURRENTLY_ACTIVE_THRESHOLD_MS = 2000;
|
||||
const MIN_DISPATCH_INTERVAL_MS = 500;
|
||||
const CURRENTLY_ACTIVE_THRESHOLD_MS = 2000;
|
||||
|
||||
/**
|
||||
* This class watches for user activity (moving the mouse or pressing a key)
|
||||
@@ -32,7 +32,7 @@ class UserActivity {
|
||||
start() {
|
||||
document.onmousedown = this._onUserActivity.bind(this);
|
||||
document.onmousemove = this._onUserActivity.bind(this);
|
||||
document.onkeypress = this._onUserActivity.bind(this);
|
||||
document.onkeydown = this._onUserActivity.bind(this);
|
||||
// can't use document.scroll here because that's only the document
|
||||
// itself being scrolled. Need to use addEventListener's useCapture.
|
||||
// also this needs to be the wheel event, not scroll, as scroll is
|
||||
@@ -50,7 +50,7 @@ class UserActivity {
|
||||
stop() {
|
||||
document.onmousedown = undefined;
|
||||
document.onmousemove = undefined;
|
||||
document.onkeypress = undefined;
|
||||
document.onkeydown = undefined;
|
||||
window.removeEventListener('wheel', this._onUserActivity.bind(this),
|
||||
{ passive: true, capture: true });
|
||||
}
|
||||
@@ -58,16 +58,15 @@ class UserActivity {
|
||||
/**
|
||||
* Return true if there has been user activity very recently
|
||||
* (ie. within a few seconds)
|
||||
* @returns {boolean} true if user is currently/very recently active
|
||||
*/
|
||||
userCurrentlyActive() {
|
||||
return this.lastActivityAtTs > new Date().getTime() - CURRENTLY_ACTIVE_THRESHOLD_MS;
|
||||
}
|
||||
|
||||
_onUserActivity(event) {
|
||||
if (event.screenX && event.type == "mousemove") {
|
||||
if (event.screenX === this.lastScreenX &&
|
||||
event.screenY === this.lastScreenY)
|
||||
{
|
||||
if (event.screenX && event.type === "mousemove") {
|
||||
if (event.screenX === this.lastScreenX && event.screenY === this.lastScreenY) {
|
||||
// mouse hasn't actually moved
|
||||
return;
|
||||
}
|
||||
@@ -79,28 +78,24 @@ class UserActivity {
|
||||
if (this.lastDispatchAtTs < this.lastActivityAtTs - MIN_DISPATCH_INTERVAL_MS) {
|
||||
this.lastDispatchAtTs = this.lastActivityAtTs;
|
||||
dis.dispatch({
|
||||
action: 'user_activity'
|
||||
action: 'user_activity',
|
||||
});
|
||||
if (!this.activityEndTimer) {
|
||||
this.activityEndTimer = setTimeout(
|
||||
this._onActivityEndTimer.bind(this), MIN_DISPATCH_INTERVAL_MS
|
||||
);
|
||||
this.activityEndTimer = setTimeout(this._onActivityEndTimer.bind(this), MIN_DISPATCH_INTERVAL_MS);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_onActivityEndTimer() {
|
||||
var now = new Date().getTime();
|
||||
var targetTime = this.lastActivityAtTs + MIN_DISPATCH_INTERVAL_MS;
|
||||
const now = new Date().getTime();
|
||||
const targetTime = this.lastActivityAtTs + MIN_DISPATCH_INTERVAL_MS;
|
||||
if (now >= targetTime) {
|
||||
dis.dispatch({
|
||||
action: 'user_activity_end'
|
||||
action: 'user_activity_end',
|
||||
});
|
||||
this.activityEndTimer = undefined;
|
||||
} else {
|
||||
this.activityEndTimer = setTimeout(
|
||||
this._onActivityEndTimer.bind(this), targetTime - now
|
||||
);
|
||||
this.activityEndTimer = setTimeout(this._onActivityEndTimer.bind(this), targetTime - now);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -14,26 +14,31 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
'use strict';
|
||||
var q = require("q");
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
var Notifier = require("./Notifier");
|
||||
import q from 'q';
|
||||
import MatrixClientPeg from './MatrixClientPeg';
|
||||
import Notifier from './Notifier';
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
/*
|
||||
* TODO: Make things use this. This is all WIP - see UserSettings.js for usage.
|
||||
*/
|
||||
|
||||
module.exports = {
|
||||
export default {
|
||||
LABS_FEATURES: [
|
||||
{
|
||||
name: 'New Composer & Autocomplete',
|
||||
id: 'rich_text_editor',
|
||||
name: "-",
|
||||
id: 'matrix_apps',
|
||||
default: false,
|
||||
},
|
||||
],
|
||||
|
||||
// horrible but it works. The locality makes this somewhat more palatable.
|
||||
doTranslations: function() {
|
||||
this.LABS_FEATURES[0].name = _t("Matrix Apps");
|
||||
},
|
||||
|
||||
loadProfileInfo: function() {
|
||||
var cli = MatrixClientPeg.get();
|
||||
const cli = MatrixClientPeg.get();
|
||||
return cli.getProfileInfo(cli.credentials.userId);
|
||||
},
|
||||
|
||||
@@ -44,7 +49,7 @@ module.exports = {
|
||||
loadThreePids: function() {
|
||||
if (MatrixClientPeg.get().isGuest()) {
|
||||
return q({
|
||||
threepids: []
|
||||
threepids: [],
|
||||
}); // guests can't poke 3pid endpoint
|
||||
}
|
||||
return MatrixClientPeg.get().getThreePids();
|
||||
@@ -73,19 +78,19 @@ module.exports = {
|
||||
Notifier.setAudioEnabled(enable);
|
||||
},
|
||||
|
||||
changePassword: function(old_password, new_password) {
|
||||
var cli = MatrixClientPeg.get();
|
||||
changePassword: function(oldPassword, newPassword) {
|
||||
const cli = MatrixClientPeg.get();
|
||||
|
||||
var authDict = {
|
||||
const authDict = {
|
||||
type: 'm.login.password',
|
||||
user: cli.credentials.userId,
|
||||
password: old_password
|
||||
password: oldPassword,
|
||||
};
|
||||
|
||||
return cli.setPassword(authDict, new_password);
|
||||
return cli.setPassword(authDict, newPassword);
|
||||
},
|
||||
|
||||
/**
|
||||
/*
|
||||
* Returns the email pusher (pusher of type 'email') for a given
|
||||
* email address. Email pushers all have the same app ID, so since
|
||||
* pushers are unique over (app ID, pushkey), there will be at most
|
||||
@@ -95,8 +100,8 @@ module.exports = {
|
||||
if (pushers === undefined) {
|
||||
return undefined;
|
||||
}
|
||||
for (var i = 0; i < pushers.length; ++i) {
|
||||
if (pushers[i].kind == 'email' && pushers[i].pushkey == address) {
|
||||
for (let i = 0; i < pushers.length; ++i) {
|
||||
if (pushers[i].kind === 'email' && pushers[i].pushkey === address) {
|
||||
return pushers[i];
|
||||
}
|
||||
}
|
||||
@@ -110,7 +115,7 @@ module.exports = {
|
||||
addEmailPusher: function(address, data) {
|
||||
return MatrixClientPeg.get().setPusher({
|
||||
kind: 'email',
|
||||
app_id: "m.email",
|
||||
app_id: 'm.email',
|
||||
pushkey: address,
|
||||
app_display_name: 'Email Notifications',
|
||||
device_display_name: address,
|
||||
@@ -121,46 +126,46 @@ module.exports = {
|
||||
},
|
||||
|
||||
getUrlPreviewsDisabled: function() {
|
||||
var event = MatrixClientPeg.get().getAccountData("org.matrix.preview_urls");
|
||||
const event = MatrixClientPeg.get().getAccountData('org.matrix.preview_urls');
|
||||
return (event && event.getContent().disable);
|
||||
},
|
||||
|
||||
setUrlPreviewsDisabled: function(disabled) {
|
||||
// FIXME: handle errors
|
||||
return MatrixClientPeg.get().setAccountData("org.matrix.preview_urls", {
|
||||
disable: disabled
|
||||
return MatrixClientPeg.get().setAccountData('org.matrix.preview_urls', {
|
||||
disable: disabled,
|
||||
});
|
||||
},
|
||||
|
||||
getSyncedSettings: function() {
|
||||
var event = MatrixClientPeg.get().getAccountData("im.vector.web.settings");
|
||||
const event = MatrixClientPeg.get().getAccountData('im.vector.web.settings');
|
||||
return event ? event.getContent() : {};
|
||||
},
|
||||
|
||||
getSyncedSetting: function(type, defaultValue = null) {
|
||||
var settings = this.getSyncedSettings();
|
||||
return settings.hasOwnProperty(type) ? settings[type] : null;
|
||||
const settings = this.getSyncedSettings();
|
||||
return settings.hasOwnProperty(type) ? settings[type] : defaultValue;
|
||||
},
|
||||
|
||||
setSyncedSetting: function(type, value) {
|
||||
var settings = this.getSyncedSettings();
|
||||
const settings = this.getSyncedSettings();
|
||||
settings[type] = value;
|
||||
// FIXME: handle errors
|
||||
return MatrixClientPeg.get().setAccountData("im.vector.web.settings", settings);
|
||||
return MatrixClientPeg.get().setAccountData('im.vector.web.settings', settings);
|
||||
},
|
||||
|
||||
getLocalSettings: function() {
|
||||
var localSettingsString = localStorage.getItem('mx_local_settings') || '{}';
|
||||
const localSettingsString = localStorage.getItem('mx_local_settings') || '{}';
|
||||
return JSON.parse(localSettingsString);
|
||||
},
|
||||
|
||||
getLocalSetting: function(type, defaultValue = null) {
|
||||
var settings = this.getLocalSettings();
|
||||
return settings.hasOwnProperty(type) ? settings[type] : null;
|
||||
const settings = this.getLocalSettings();
|
||||
return settings.hasOwnProperty(type) ? settings[type] : defaultValue;
|
||||
},
|
||||
|
||||
setLocalSetting: function(type, value) {
|
||||
var settings = this.getLocalSettings();
|
||||
const settings = this.getLocalSettings();
|
||||
settings[type] = value;
|
||||
// FIXME: handle errors
|
||||
localStorage.setItem('mx_local_settings', JSON.stringify(settings));
|
||||
@@ -171,8 +176,8 @@ module.exports = {
|
||||
if (MatrixClientPeg.get().isGuest()) return false;
|
||||
|
||||
if (localStorage.getItem(`mx_labs_feature_${feature}`) === null) {
|
||||
for (var i = 0; i < this.LABS_FEATURES.length; i++) {
|
||||
var f = this.LABS_FEATURES[i];
|
||||
for (let i = 0; i < this.LABS_FEATURES.length; i++) {
|
||||
const f = this.LABS_FEATURES[i];
|
||||
if (f.id === feature) {
|
||||
return f.default;
|
||||
}
|
||||
@@ -183,5 +188,5 @@ module.exports = {
|
||||
|
||||
setFeatureEnabled: function(feature: string, enabled: boolean) {
|
||||
localStorage.setItem(`mx_labs_feature_${feature}`, enabled);
|
||||
}
|
||||
},
|
||||
};
|
||||
|
||||
@@ -64,7 +64,7 @@ module.exports = React.createClass({
|
||||
});
|
||||
//console.log("translation: "+oldNode.style.left+" -> "+c.props.style.left);
|
||||
}
|
||||
if (oldNode.style.visibility == 'hidden' && c.props.style.visibility == 'visible') {
|
||||
if (oldNode && oldNode.style.visibility == 'hidden' && c.props.style.visibility == 'visible') {
|
||||
oldNode.style.visibility = c.props.style.visibility;
|
||||
}
|
||||
self.children[c.key] = old;
|
||||
|
||||
@@ -15,6 +15,7 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||
import { _t } from './languageHandler';
|
||||
|
||||
module.exports = {
|
||||
usersTypingApartFromMe: function(room) {
|
||||
@@ -56,18 +57,18 @@ module.exports = {
|
||||
if (whoIsTyping.length == 0) {
|
||||
return '';
|
||||
} else if (whoIsTyping.length == 1) {
|
||||
return whoIsTyping[0].name + ' is typing';
|
||||
return _t('%(displayName)s is typing', {displayName: whoIsTyping[0].name});
|
||||
}
|
||||
const names = whoIsTyping.map(function(m) {
|
||||
return m.name;
|
||||
});
|
||||
if (othersCount) {
|
||||
const other = ' other' + (othersCount > 1 ? 's' : '');
|
||||
return names.slice(0, limit - 1).join(', ') + ' and ' +
|
||||
othersCount + other + ' are typing';
|
||||
if (othersCount==1) {
|
||||
return _t('%(names)s and one other are typing', {names: names.slice(0, limit - 1).join(', ')});
|
||||
} else if (othersCount>1) {
|
||||
return _t('%(names)s and %(count)s others are typing', {names: names.slice(0, limit - 1).join(', '), count: othersCount});
|
||||
} else {
|
||||
const lastPerson = names.pop();
|
||||
return names.join(', ') + ' and ' + lastPerson + ' are typing';
|
||||
return _t('%(names)s and %(lastPerson)s are typing', {names: names.join(', '), lastPerson: lastPerson});
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
@@ -15,6 +15,7 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
var React = require("react");
|
||||
import { _t } from '../../../languageHandler';
|
||||
var sdk = require('../../../index');
|
||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||
|
||||
@@ -78,33 +79,33 @@ module.exports = React.createClass({
|
||||
_renderDeviceInfo: function() {
|
||||
var device = this.state.device;
|
||||
if (!device) {
|
||||
return (<i>unknown device</i>);
|
||||
return (<i>{ _t('unknown device') }</i>);
|
||||
}
|
||||
|
||||
var verificationStatus = (<b>NOT verified</b>);
|
||||
var verificationStatus = (<b>{ _t('NOT verified') }</b>);
|
||||
if (device.isBlocked()) {
|
||||
verificationStatus = (<b>Blacklisted</b>);
|
||||
verificationStatus = (<b>{ _t('Blacklisted') }</b>);
|
||||
} else if (device.isVerified()) {
|
||||
verificationStatus = "verified";
|
||||
verificationStatus = _t('verified');
|
||||
}
|
||||
|
||||
return (
|
||||
<table>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>Name</td>
|
||||
<td>{ _t('Name') }</td>
|
||||
<td>{ device.getDisplayName() }</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Device ID</td>
|
||||
<td>{ _t('Device ID') }</td>
|
||||
<td><code>{ device.deviceId }</code></td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Verification</td>
|
||||
<td>{ _t('Verification') }</td>
|
||||
<td>{ verificationStatus }</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Ed25519 fingerprint</td>
|
||||
<td>{ _t('Ed25519 fingerprint') }</td>
|
||||
<td><code>{device.getFingerprint()}</code></td>
|
||||
</tr>
|
||||
</tbody>
|
||||
@@ -119,32 +120,32 @@ module.exports = React.createClass({
|
||||
<table>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>User ID</td>
|
||||
<td>{ _t('User ID') }</td>
|
||||
<td>{ event.getSender() }</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Curve25519 identity key</td>
|
||||
<td><code>{ event.getSenderKey() || <i>none</i> }</code></td>
|
||||
<td>{ _t('Curve25519 identity key') }</td>
|
||||
<td><code>{ event.getSenderKey() || <i>{ _t('none') }</i> }</code></td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Claimed Ed25519 fingerprint key</td>
|
||||
<td><code>{ event.getKeysClaimed().ed25519 || <i>none</i> }</code></td>
|
||||
<td>{ _t('Claimed Ed25519 fingerprint key') }</td>
|
||||
<td><code>{ event.getKeysClaimed().ed25519 || <i>{ _t('none') }</i> }</code></td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>Algorithm</td>
|
||||
<td>{ event.getWireContent().algorithm || <i>unencrypted</i> }</td>
|
||||
<td>{ _t('Algorithm') }</td>
|
||||
<td>{ event.getWireContent().algorithm || <i>{ _t('unencrypted') }</i> }</td>
|
||||
</tr>
|
||||
{
|
||||
event.getContent().msgtype === 'm.bad.encrypted' ? (
|
||||
<tr>
|
||||
<td>Decryption error</td>
|
||||
<td>{ _t('Decryption error') }</td>
|
||||
<td>{ event.getContent().body }</td>
|
||||
</tr>
|
||||
) : null
|
||||
}
|
||||
<tr>
|
||||
<td>Session ID</td>
|
||||
<td><code>{ event.getWireContent().session_id || <i>none</i> }</code></td>
|
||||
<td>{ _t('Session ID') }</td>
|
||||
<td><code>{ event.getWireContent().session_id || <i>{ _t('none') }</i> }</code></td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -166,18 +167,18 @@ module.exports = React.createClass({
|
||||
return (
|
||||
<div className="mx_EncryptedEventDialog" onKeyDown={ this.onKeyDown }>
|
||||
<div className="mx_Dialog_title">
|
||||
End-to-end encryption information
|
||||
{ _t('End-to-end encryption information') }
|
||||
</div>
|
||||
<div className="mx_Dialog_content">
|
||||
<h4>Event information</h4>
|
||||
<h4>{ _t('Event information') }</h4>
|
||||
{this._renderEventInfo()}
|
||||
|
||||
<h4>Sender device information</h4>
|
||||
<h4>{ _t('Sender device information') }</h4>
|
||||
{this._renderDeviceInfo()}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={ this.props.onFinished } autoFocus={ true }>
|
||||
OK
|
||||
{ _t('OK') }
|
||||
</button>
|
||||
{buttons}
|
||||
</div>
|
||||
|
||||
@@ -16,6 +16,7 @@ limitations under the License.
|
||||
|
||||
import FileSaver from 'file-saver';
|
||||
import React from 'react';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
import * as Matrix from 'matrix-js-sdk';
|
||||
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
||||
@@ -52,11 +53,11 @@ export default React.createClass({
|
||||
|
||||
const passphrase = this.refs.passphrase1.value;
|
||||
if (passphrase !== this.refs.passphrase2.value) {
|
||||
this.setState({errStr: 'Passphrases must match'});
|
||||
this.setState({errStr: _t('Passphrases must match')});
|
||||
return false;
|
||||
}
|
||||
if (!passphrase) {
|
||||
this.setState({errStr: 'Passphrase must not be empty'});
|
||||
this.setState({errStr: _t('Passphrase must not be empty')});
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -80,11 +81,13 @@ export default React.createClass({
|
||||
FileSaver.saveAs(blob, 'riot-keys.txt');
|
||||
this.props.onFinished(true);
|
||||
}).catch((e) => {
|
||||
console.error("Error exporting e2e keys:", e);
|
||||
if (this._unmounted) {
|
||||
return;
|
||||
}
|
||||
const msg = e.friendlyText || _t('Unknown error');
|
||||
this.setState({
|
||||
errStr: e.message,
|
||||
errStr: msg,
|
||||
phase: PHASE_EDIT,
|
||||
});
|
||||
});
|
||||
@@ -109,24 +112,28 @@ export default React.createClass({
|
||||
return (
|
||||
<BaseDialog className='mx_exportE2eKeysDialog'
|
||||
onFinished={this.props.onFinished}
|
||||
title="Export room keys"
|
||||
title={_t("Export room keys")}
|
||||
>
|
||||
<form onSubmit={this._onPassphraseFormSubmit}>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>
|
||||
This process allows you to export the keys for messages
|
||||
you have received in encrypted rooms to a local file. You
|
||||
will then be able to import the file into another Matrix
|
||||
client in the future, so that client will also be able to
|
||||
decrypt these messages.
|
||||
{ _t(
|
||||
'This process allows you to export the keys for messages ' +
|
||||
'you have received in encrypted rooms to a local file. You ' +
|
||||
'will then be able to import the file into another Matrix ' +
|
||||
'client in the future, so that client will also be able to ' +
|
||||
'decrypt these messages.',
|
||||
) }
|
||||
</p>
|
||||
<p>
|
||||
The exported file will allow anyone who can read it to decrypt
|
||||
any encrypted messages that you can see, so you should be
|
||||
careful to keep it secure. To help with this, you should enter
|
||||
a passphrase below, which will be used to encrypt the exported
|
||||
data. It will only be possible to import the data by using the
|
||||
same passphrase.
|
||||
{ _t(
|
||||
'The exported file will allow anyone who can read it to decrypt ' +
|
||||
'any encrypted messages that you can see, so you should be ' +
|
||||
'careful to keep it secure. To help with this, you should enter ' +
|
||||
'a passphrase below, which will be used to encrypt the exported ' +
|
||||
'data. It will only be possible to import the data by using the ' +
|
||||
'same passphrase.',
|
||||
) }
|
||||
</p>
|
||||
<div className='error'>
|
||||
{this.state.errStr}
|
||||
@@ -135,7 +142,7 @@ export default React.createClass({
|
||||
<div className='mx_E2eKeysDialog_inputRow'>
|
||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||
<label htmlFor='passphrase1'>
|
||||
Enter passphrase
|
||||
{_t("Enter passphrase")}
|
||||
</label>
|
||||
</div>
|
||||
<div className='mx_E2eKeysDialog_inputCell'>
|
||||
@@ -148,7 +155,7 @@ export default React.createClass({
|
||||
<div className='mx_E2eKeysDialog_inputRow'>
|
||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||
<label htmlFor='passphrase2'>
|
||||
Confirm passphrase
|
||||
{_t("Confirm passphrase")}
|
||||
</label>
|
||||
</div>
|
||||
<div className='mx_E2eKeysDialog_inputCell'>
|
||||
@@ -161,11 +168,11 @@ export default React.createClass({
|
||||
</div>
|
||||
</div>
|
||||
<div className='mx_Dialog_buttons'>
|
||||
<input className='mx_Dialog_primary' type='submit' value='Export'
|
||||
<input className='mx_Dialog_primary' type='submit' value={_t('Export')}
|
||||
disabled={disableForm}
|
||||
/>
|
||||
<button onClick={this._onCancelClick} disabled={disableForm}>
|
||||
Cancel
|
||||
{_t("Cancel")}
|
||||
</button>
|
||||
</div>
|
||||
</form>
|
||||
|
||||
@@ -19,6 +19,7 @@ import React from 'react';
|
||||
import * as Matrix from 'matrix-js-sdk';
|
||||
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
function readFileAsArrayBuffer(file) {
|
||||
return new Promise((resolve, reject) => {
|
||||
@@ -88,11 +89,13 @@ export default React.createClass({
|
||||
// TODO: it would probably be nice to give some feedback about what we've imported here.
|
||||
this.props.onFinished(true);
|
||||
}).catch((e) => {
|
||||
console.error("Error importing e2e keys:", e);
|
||||
if (this._unmounted) {
|
||||
return;
|
||||
}
|
||||
const msg = e.friendlyText || _t('Unknown error');
|
||||
this.setState({
|
||||
errStr: e.message,
|
||||
errStr: msg,
|
||||
phase: PHASE_EDIT,
|
||||
});
|
||||
});
|
||||
@@ -112,20 +115,23 @@ export default React.createClass({
|
||||
return (
|
||||
<BaseDialog className='mx_importE2eKeysDialog'
|
||||
onFinished={this.props.onFinished}
|
||||
title="Import room keys"
|
||||
title={_t("Import room keys")}
|
||||
>
|
||||
<form onSubmit={this._onFormSubmit}>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>
|
||||
This process allows you to import encryption keys
|
||||
that you had previously exported from another Matrix
|
||||
client. You will then be able to decrypt any
|
||||
messages that the other client could decrypt.
|
||||
{ _t(
|
||||
'This process allows you to import encryption keys ' +
|
||||
'that you had previously exported from another Matrix ' +
|
||||
'client. You will then be able to decrypt any ' +
|
||||
'messages that the other client could decrypt.',
|
||||
) }
|
||||
</p>
|
||||
<p>
|
||||
The export file will be protected with a passphrase.
|
||||
You should enter the passphrase here, to decrypt the
|
||||
file.
|
||||
{ _t(
|
||||
'The export file will be protected with a passphrase. ' +
|
||||
'You should enter the passphrase here, to decrypt the file.',
|
||||
) }
|
||||
</p>
|
||||
<div className='error'>
|
||||
{this.state.errStr}
|
||||
@@ -134,7 +140,7 @@ export default React.createClass({
|
||||
<div className='mx_E2eKeysDialog_inputRow'>
|
||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||
<label htmlFor='importFile'>
|
||||
File to import
|
||||
{_t("File to import")}
|
||||
</label>
|
||||
</div>
|
||||
<div className='mx_E2eKeysDialog_inputCell'>
|
||||
@@ -147,7 +153,7 @@ export default React.createClass({
|
||||
<div className='mx_E2eKeysDialog_inputRow'>
|
||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||
<label htmlFor='passphrase'>
|
||||
Enter passphrase
|
||||
{_t("Enter passphrase")}
|
||||
</label>
|
||||
</div>
|
||||
<div className='mx_E2eKeysDialog_inputCell'>
|
||||
@@ -160,11 +166,11 @@ export default React.createClass({
|
||||
</div>
|
||||
</div>
|
||||
<div className='mx_Dialog_buttons'>
|
||||
<input className='mx_Dialog_primary' type='submit' value='Import'
|
||||
<input className='mx_Dialog_primary' type='submit' value={_t('Import')}
|
||||
disabled={!this.state.enableSubmit || disableForm}
|
||||
/>
|
||||
<button onClick={this._onCancelClick} disabled={disableForm}>
|
||||
Cancel
|
||||
{_t("Cancel")}
|
||||
</button>
|
||||
</div>
|
||||
</form>
|
||||
|
||||
@@ -1,8 +1,25 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import type {Completion, SelectionRange} from './Autocompleter';
|
||||
|
||||
export default class AutocompleteProvider {
|
||||
constructor(commandRegex?: RegExp, fuseOpts?: any) {
|
||||
constructor(commandRegex?: RegExp) {
|
||||
if (commandRegex) {
|
||||
if (!commandRegex.global) {
|
||||
throw new Error('commandRegex must have global flag set');
|
||||
|
||||
@@ -1,3 +1,19 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
// @flow
|
||||
|
||||
import type {Component} from 'react';
|
||||
@@ -43,7 +59,7 @@ export async function getCompletions(query: string, selection: SelectionRange, f
|
||||
PROVIDERS.map(provider => {
|
||||
return Q(provider.getCompletions(query, selection, force))
|
||||
.timeout(PROVIDER_COMPLETION_TIMEOUT);
|
||||
})
|
||||
}),
|
||||
);
|
||||
|
||||
return completionsList
|
||||
|
||||
@@ -1,8 +1,28 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../languageHandler';
|
||||
import AutocompleteProvider from './AutocompleteProvider';
|
||||
import Fuse from 'fuse.js';
|
||||
import FuzzyMatcher from './FuzzyMatcher';
|
||||
import {TextualCompletion} from './Components';
|
||||
|
||||
// TODO merge this with the factory mechanics of SlashCommands?
|
||||
// Warning: Since the description string will be translated in _t(result.description), all these strings below must be in i18n/strings/en_EN.json file
|
||||
const COMMANDS = [
|
||||
{
|
||||
command: '/me',
|
||||
@@ -14,6 +34,16 @@ const COMMANDS = [
|
||||
args: '<user-id> [reason]',
|
||||
description: 'Bans user with given id',
|
||||
},
|
||||
{
|
||||
command: '/unban',
|
||||
args: '<user-id>',
|
||||
description: 'Unbans user with given id',
|
||||
},
|
||||
{
|
||||
command: '/op',
|
||||
args: '<user-id> [<power-level>]',
|
||||
description: 'Define the power level of a user',
|
||||
},
|
||||
{
|
||||
command: '/deop',
|
||||
args: '<user-id>',
|
||||
@@ -29,6 +59,16 @@ const COMMANDS = [
|
||||
args: '<room-alias>',
|
||||
description: 'Joins room with given alias',
|
||||
},
|
||||
{
|
||||
command: '/part',
|
||||
args: '[<room-alias>]',
|
||||
description: 'Leave room',
|
||||
},
|
||||
{
|
||||
command: '/topic',
|
||||
args: '<topic>',
|
||||
description: 'Sets the room topic',
|
||||
},
|
||||
{
|
||||
command: '/kick',
|
||||
args: '<user-id> [reason]',
|
||||
@@ -43,32 +83,43 @@ const COMMANDS = [
|
||||
command: '/ddg',
|
||||
args: '<query>',
|
||||
description: 'Searches DuckDuckGo for results',
|
||||
}
|
||||
},
|
||||
{
|
||||
command: '/tint',
|
||||
args: '<color1> [<color2>]',
|
||||
description: 'Changes colour scheme of current room',
|
||||
},
|
||||
{
|
||||
command: '/verify',
|
||||
args: '<user-id> <device-id> <device-signing-key>',
|
||||
description: 'Verifies a user, device, and pubkey tuple',
|
||||
},
|
||||
// Omitting `/markdown` as it only seems to apply to OldComposer
|
||||
];
|
||||
|
||||
let COMMAND_RE = /(^\/\w*)/g;
|
||||
const COMMAND_RE = /(^\/\w*)/g;
|
||||
|
||||
let instance = null;
|
||||
|
||||
export default class CommandProvider extends AutocompleteProvider {
|
||||
constructor() {
|
||||
super(COMMAND_RE);
|
||||
this.fuse = new Fuse(COMMANDS, {
|
||||
this.matcher = new FuzzyMatcher(COMMANDS, {
|
||||
keys: ['command', 'args', 'description'],
|
||||
});
|
||||
}
|
||||
|
||||
async getCompletions(query: string, selection: {start: number, end: number}) {
|
||||
let completions = [];
|
||||
let {command, range} = this.getCurrentCommand(query, selection);
|
||||
const {command, range} = this.getCurrentCommand(query, selection);
|
||||
if (command) {
|
||||
completions = this.fuse.search(command[0]).map(result => {
|
||||
completions = this.matcher.match(command[0]).map((result) => {
|
||||
return {
|
||||
completion: result.command + ' ',
|
||||
component: (<TextualCompletion
|
||||
title={result.command}
|
||||
subtitle={result.args}
|
||||
description={result.description}
|
||||
description={ _t(result.description) }
|
||||
/>),
|
||||
range,
|
||||
};
|
||||
@@ -78,12 +129,11 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
getName() {
|
||||
return '*️⃣ Commands';
|
||||
return '*️⃣ ' + _t('Commands');
|
||||
}
|
||||
|
||||
static getInstance(): CommandProvider {
|
||||
if (instance == null)
|
||||
{instance = new CommandProvider();}
|
||||
if (instance === null) instance = new CommandProvider();
|
||||
|
||||
return instance;
|
||||
}
|
||||
|
||||
@@ -1,5 +1,20 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import ReactDOM from 'react-dom';
|
||||
import classNames from 'classnames';
|
||||
|
||||
/* These were earlier stateless functional components but had to be converted
|
||||
|
||||
@@ -1,4 +1,22 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../languageHandler';
|
||||
import AutocompleteProvider from './AutocompleteProvider';
|
||||
import 'whatwg-fetch';
|
||||
|
||||
@@ -75,7 +93,7 @@ export default class DuckDuckGoProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
getName() {
|
||||
return '🔍 Results from DuckDuckGo';
|
||||
return '🔍 ' + _t('Results from DuckDuckGo');
|
||||
}
|
||||
|
||||
static getInstance(): DuckDuckGoProvider {
|
||||
|
||||
@@ -1,30 +1,99 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../languageHandler';
|
||||
import AutocompleteProvider from './AutocompleteProvider';
|
||||
import {emojioneList, shortnameToImage, shortnameToUnicode} from 'emojione';
|
||||
import Fuse from 'fuse.js';
|
||||
import {emojioneList, shortnameToImage, shortnameToUnicode, asciiRegexp, unicodeRegexp} from 'emojione';
|
||||
import FuzzyMatcher from './FuzzyMatcher';
|
||||
import sdk from '../index';
|
||||
import {PillCompletion} from './Components';
|
||||
import type {SelectionRange, Completion} from './Autocompleter';
|
||||
|
||||
const EMOJI_REGEX = /:\w*:?/g;
|
||||
const EMOJI_SHORTNAMES = Object.keys(emojioneList);
|
||||
import EmojiData from '../stripped-emoji.json';
|
||||
|
||||
const LIMIT = 20;
|
||||
const CATEGORY_ORDER = [
|
||||
'people',
|
||||
'food',
|
||||
'objects',
|
||||
'activity',
|
||||
'nature',
|
||||
'travel',
|
||||
'flags',
|
||||
'symbols',
|
||||
'unicode9',
|
||||
'modifier',
|
||||
];
|
||||
|
||||
// Match for ":wink:" or ascii-style ";-)" provided by emojione
|
||||
// (^|\s|(emojiUnicode)) to make sure we're either at the start of the string or there's a
|
||||
// whitespace character or an emoji before the emoji. The reason for unicodeRegexp is
|
||||
// that we need to support inputting multiple emoji with no space between them.
|
||||
const EMOJI_REGEX = new RegExp('(?:^|\\s|' + unicodeRegexp + ')(' + asciiRegexp + '|:\\w*:?)$', 'g');
|
||||
|
||||
// We also need to match the non-zero-length prefixes to remove them from the final match,
|
||||
// and update the range so that we don't replace the whitespace or the previous emoji.
|
||||
const MATCH_PREFIX_REGEX = new RegExp('(\\s|' + unicodeRegexp + ')');
|
||||
|
||||
const EMOJI_SHORTNAMES = Object.keys(EmojiData).map((key) => EmojiData[key]).sort(
|
||||
(a, b) => {
|
||||
if (a.category === b.category) {
|
||||
return a.emoji_order - b.emoji_order;
|
||||
}
|
||||
return CATEGORY_ORDER.indexOf(a.category) - CATEGORY_ORDER.indexOf(b.category);
|
||||
},
|
||||
).map((a) => {
|
||||
return {
|
||||
name: a.name,
|
||||
shortname: a.shortname,
|
||||
aliases_ascii: a.aliases_ascii ? a.aliases_ascii.join(' ') : '',
|
||||
};
|
||||
});
|
||||
|
||||
let instance = null;
|
||||
|
||||
export default class EmojiProvider extends AutocompleteProvider {
|
||||
constructor() {
|
||||
super(EMOJI_REGEX);
|
||||
this.fuse = new Fuse(EMOJI_SHORTNAMES);
|
||||
this.matcher = new FuzzyMatcher(EMOJI_SHORTNAMES, {
|
||||
keys: ['aliases_ascii', 'shortname', 'name'],
|
||||
// For matching against ascii equivalents
|
||||
shouldMatchWordsOnly: false,
|
||||
});
|
||||
}
|
||||
|
||||
async getCompletions(query: string, selection: SelectionRange) {
|
||||
const EmojiText = sdk.getComponent('views.elements.EmojiText');
|
||||
|
||||
let completions = [];
|
||||
let {command, range} = this.getCurrentCommand(query, selection);
|
||||
const {command, range} = this.getCurrentCommand(query, selection);
|
||||
if (command) {
|
||||
completions = this.fuse.search(command[0]).map(result => {
|
||||
const shortname = EMOJI_SHORTNAMES[result];
|
||||
let matchedString = command[0];
|
||||
|
||||
// Remove prefix of any length (single whitespace or unicode emoji)
|
||||
const prefixMatch = MATCH_PREFIX_REGEX.exec(matchedString);
|
||||
if (prefixMatch) {
|
||||
matchedString = matchedString.slice(prefixMatch[0].length);
|
||||
range.start += prefixMatch[0].length;
|
||||
}
|
||||
|
||||
completions = this.matcher.match(matchedString).map((result) => {
|
||||
const {shortname} = result;
|
||||
const unicode = shortnameToUnicode(shortname);
|
||||
return {
|
||||
completion: unicode,
|
||||
@@ -33,13 +102,13 @@ export default class EmojiProvider extends AutocompleteProvider {
|
||||
),
|
||||
range,
|
||||
};
|
||||
}).slice(0, 8);
|
||||
}).slice(0, LIMIT);
|
||||
}
|
||||
return completions;
|
||||
}
|
||||
|
||||
getName() {
|
||||
return '😃 Emoji';
|
||||
return '😃 ' + _t('Emoji');
|
||||
}
|
||||
|
||||
static getInstance() {
|
||||
@@ -49,7 +118,7 @@ export default class EmojiProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
renderCompletions(completions: [React.Component]): ?React.Component {
|
||||
return <div className="mx_Autocomplete_Completion_container_pill">
|
||||
return <div className="mx_Autocomplete_Completion_container_pill mx_Autocomplete_Completion_container_truncate">
|
||||
{completions}
|
||||
</div>;
|
||||
}
|
||||
|
||||
107
src/autocomplete/FuzzyMatcher.js
Normal file
107
src/autocomplete/FuzzyMatcher.js
Normal file
@@ -0,0 +1,107 @@
|
||||
/*
|
||||
Copyright 2017 Aviral Dasgupta
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
//import Levenshtein from 'liblevenshtein';
|
||||
//import _at from 'lodash/at';
|
||||
//import _flatMap from 'lodash/flatMap';
|
||||
//import _sortBy from 'lodash/sortBy';
|
||||
//import _sortedUniq from 'lodash/sortedUniq';
|
||||
//import _keys from 'lodash/keys';
|
||||
//
|
||||
//class KeyMap {
|
||||
// keys: Array<String>;
|
||||
// objectMap: {[String]: Array<Object>};
|
||||
// priorityMap: {[String]: number}
|
||||
//}
|
||||
//
|
||||
//const DEFAULT_RESULT_COUNT = 10;
|
||||
//const DEFAULT_DISTANCE = 5;
|
||||
|
||||
// FIXME Until Fuzzy matching works better, we use prefix matching.
|
||||
|
||||
import PrefixMatcher from './QueryMatcher';
|
||||
export default PrefixMatcher;
|
||||
|
||||
//class FuzzyMatcher { // eslint-disable-line no-unused-vars
|
||||
// /**
|
||||
// * @param {object[]} objects the objects to perform a match on
|
||||
// * @param {string[]} keys an array of keys within each object to match on
|
||||
// * Keys can refer to object properties by name and as in JavaScript (for nested properties)
|
||||
// *
|
||||
// * To use, simply presort objects by required criteria, run through this function and create a FuzzyMatcher with the
|
||||
// * resulting KeyMap.
|
||||
// *
|
||||
// * TODO: Handle arrays and objects (Fuse did this, RoomProvider uses it)
|
||||
// * @return {KeyMap}
|
||||
// */
|
||||
// static valuesToKeyMap(objects: Array<Object>, keys: Array<String>): KeyMap {
|
||||
// const keyMap = new KeyMap();
|
||||
// const map = {};
|
||||
// const priorities = {};
|
||||
//
|
||||
// objects.forEach((object, i) => {
|
||||
// const keyValues = _at(object, keys);
|
||||
// console.log(object, keyValues, keys);
|
||||
// for (const keyValue of keyValues) {
|
||||
// if (!map.hasOwnProperty(keyValue)) {
|
||||
// map[keyValue] = [];
|
||||
// }
|
||||
// map[keyValue].push(object);
|
||||
// }
|
||||
// priorities[object] = i;
|
||||
// });
|
||||
//
|
||||
// keyMap.objectMap = map;
|
||||
// keyMap.priorityMap = priorities;
|
||||
// keyMap.keys = _sortBy(_keys(map), [(value) => priorities[value]]);
|
||||
// return keyMap;
|
||||
// }
|
||||
//
|
||||
// constructor(objects: Array<Object>, options: {[Object]: Object} = {}) {
|
||||
// this.options = options;
|
||||
// this.keys = options.keys;
|
||||
// this.setObjects(objects);
|
||||
// }
|
||||
//
|
||||
// setObjects(objects: Array<Object>) {
|
||||
// this.keyMap = FuzzyMatcher.valuesToKeyMap(objects, this.keys);
|
||||
// console.log(this.keyMap.keys);
|
||||
// this.matcher = new Levenshtein.Builder()
|
||||
// .dictionary(this.keyMap.keys, true)
|
||||
// .algorithm('transposition')
|
||||
// .sort_candidates(false)
|
||||
// .case_insensitive_sort(true)
|
||||
// .include_distance(true)
|
||||
// .maximum_candidates(this.options.resultCount || DEFAULT_RESULT_COUNT) // result count 0 doesn't make much sense
|
||||
// .build();
|
||||
// }
|
||||
//
|
||||
// match(query: String): Array<Object> {
|
||||
// const candidates = this.matcher.transduce(query, this.options.distance || DEFAULT_DISTANCE);
|
||||
// // TODO FIXME This is hideous. Clean up when possible.
|
||||
// const val = _sortedUniq(_sortBy(_flatMap(candidates, (candidate) => {
|
||||
// return this.keyMap.objectMap[candidate[0]].map((value) => {
|
||||
// return {
|
||||
// distance: candidate[1],
|
||||
// ...value,
|
||||
// };
|
||||
// });
|
||||
// }),
|
||||
// [(candidate) => candidate.distance, (candidate) => this.keyMap.priorityMap[candidate]]));
|
||||
// console.log(val);
|
||||
// return val;
|
||||
// }
|
||||
//}
|
||||
112
src/autocomplete/QueryMatcher.js
Normal file
112
src/autocomplete/QueryMatcher.js
Normal file
@@ -0,0 +1,112 @@
|
||||
//@flow
|
||||
/*
|
||||
Copyright 2017 Aviral Dasgupta
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import _at from 'lodash/at';
|
||||
import _flatMap from 'lodash/flatMap';
|
||||
import _sortBy from 'lodash/sortBy';
|
||||
import _sortedUniq from 'lodash/sortedUniq';
|
||||
import _keys from 'lodash/keys';
|
||||
|
||||
class KeyMap {
|
||||
keys: Array<String>;
|
||||
objectMap: {[String]: Array<Object>};
|
||||
priorityMap = new Map();
|
||||
}
|
||||
|
||||
export default class QueryMatcher {
|
||||
/**
|
||||
* @param {object[]} objects the objects to perform a match on
|
||||
* @param {string[]} keys an array of keys within each object to match on
|
||||
* Keys can refer to object properties by name and as in JavaScript (for nested properties)
|
||||
*
|
||||
* To use, simply presort objects by required criteria, run through this function and create a QueryMatcher with the
|
||||
* resulting KeyMap.
|
||||
*
|
||||
* TODO: Handle arrays and objects (Fuse did this, RoomProvider uses it)
|
||||
* @return {KeyMap}
|
||||
*/
|
||||
static valuesToKeyMap(objects: Array<Object>, keys: Array<String>): KeyMap {
|
||||
const keyMap = new KeyMap();
|
||||
const map = {};
|
||||
|
||||
objects.forEach((object, i) => {
|
||||
const keyValues = _at(object, keys);
|
||||
for (const keyValue of keyValues) {
|
||||
if (!map.hasOwnProperty(keyValue)) {
|
||||
map[keyValue] = [];
|
||||
}
|
||||
map[keyValue].push(object);
|
||||
}
|
||||
keyMap.priorityMap.set(object, i);
|
||||
});
|
||||
|
||||
keyMap.objectMap = map;
|
||||
keyMap.keys = _keys(map);
|
||||
return keyMap;
|
||||
}
|
||||
|
||||
constructor(objects: Array<Object>, options: {[Object]: Object} = {}) {
|
||||
this.options = options;
|
||||
this.keys = options.keys;
|
||||
this.setObjects(objects);
|
||||
|
||||
// By default, we remove any non-alphanumeric characters ([^A-Za-z0-9_]) from the
|
||||
// query and the value being queried before matching
|
||||
if (this.options.shouldMatchWordsOnly === undefined) {
|
||||
this.options.shouldMatchWordsOnly = true;
|
||||
}
|
||||
|
||||
// By default, match anywhere in the string being searched. If enabled, only return
|
||||
// matches that are prefixed with the query.
|
||||
if (this.options.shouldMatchPrefix === undefined) {
|
||||
this.options.shouldMatchPrefix = false;
|
||||
}
|
||||
}
|
||||
|
||||
setObjects(objects: Array<Object>) {
|
||||
this.keyMap = QueryMatcher.valuesToKeyMap(objects, this.keys);
|
||||
}
|
||||
|
||||
match(query: String): Array<Object> {
|
||||
query = query.toLowerCase();
|
||||
if (this.options.shouldMatchWordsOnly) {
|
||||
query = query.replace(/[^\w]/g, '');
|
||||
}
|
||||
if (query.length === 0) {
|
||||
return [];
|
||||
}
|
||||
const results = [];
|
||||
this.keyMap.keys.forEach((key) => {
|
||||
let resultKey = key.toLowerCase();
|
||||
if (this.options.shouldMatchWordsOnly) {
|
||||
resultKey = resultKey.replace(/[^\w]/g, '');
|
||||
}
|
||||
const index = resultKey.indexOf(query);
|
||||
if (index !== -1 && (!this.options.shouldMatchPrefix || index === 0)) {
|
||||
results.push({key, index});
|
||||
}
|
||||
});
|
||||
|
||||
return _sortedUniq(_flatMap(_sortBy(results, (candidate) => {
|
||||
return candidate.index;
|
||||
}).map((candidate) => {
|
||||
// return an array of objects (those given to setObjects) that have the given
|
||||
// key as a property.
|
||||
return this.keyMap.objectMap[candidate.key];
|
||||
})));
|
||||
}
|
||||
}
|
||||
@@ -1,7 +1,25 @@
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../languageHandler';
|
||||
import AutocompleteProvider from './AutocompleteProvider';
|
||||
import MatrixClientPeg from '../MatrixClientPeg';
|
||||
import Fuse from 'fuse.js';
|
||||
import FuzzyMatcher from './FuzzyMatcher';
|
||||
import {PillCompletion} from './Components';
|
||||
import {getDisplayAliasForRoom} from '../Rooms';
|
||||
import sdk from '../index';
|
||||
@@ -12,11 +30,9 @@ let instance = null;
|
||||
|
||||
export default class RoomProvider extends AutocompleteProvider {
|
||||
constructor() {
|
||||
super(ROOM_REGEX, {
|
||||
keys: ['displayName', 'userId'],
|
||||
});
|
||||
this.fuse = new Fuse([], {
|
||||
keys: ['name', 'roomId', 'aliases'],
|
||||
super(ROOM_REGEX);
|
||||
this.matcher = new FuzzyMatcher([], {
|
||||
keys: ['name', 'roomId', 'aliases'],
|
||||
});
|
||||
}
|
||||
|
||||
@@ -28,17 +44,17 @@ export default class RoomProvider extends AutocompleteProvider {
|
||||
const {command, range} = this.getCurrentCommand(query, selection, force);
|
||||
if (command) {
|
||||
// the only reason we need to do this is because Fuse only matches on properties
|
||||
this.fuse.set(client.getRooms().filter(room => !!room).map(room => {
|
||||
this.matcher.setObjects(client.getRooms().filter(room => !!room && !!getDisplayAliasForRoom(room)).map(room => {
|
||||
return {
|
||||
room: room,
|
||||
name: room.name,
|
||||
aliases: room.getAliases(),
|
||||
};
|
||||
}));
|
||||
completions = this.fuse.search(command[0]).map(room => {
|
||||
completions = this.matcher.match(command[0]).map(room => {
|
||||
let displayAlias = getDisplayAliasForRoom(room.room) || room.roomId;
|
||||
return {
|
||||
completion: displayAlias,
|
||||
completion: displayAlias + ' ',
|
||||
component: (
|
||||
<PillCompletion initialComponent={<RoomAvatar width={24} height={24} room={room.room} />} title={room.name} description={displayAlias} />
|
||||
),
|
||||
@@ -50,7 +66,7 @@ export default class RoomProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
getName() {
|
||||
return '💬 Rooms';
|
||||
return '💬 ' + _t('Rooms');
|
||||
}
|
||||
|
||||
static getInstance() {
|
||||
@@ -62,12 +78,8 @@ export default class RoomProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
renderCompletions(completions: [React.Component]): ?React.Component {
|
||||
return <div className="mx_Autocomplete_Completion_container_pill">
|
||||
return <div className="mx_Autocomplete_Completion_container_pill mx_Autocomplete_Completion_container_truncate">
|
||||
{completions}
|
||||
</div>;
|
||||
}
|
||||
|
||||
shouldForceComplete(): boolean {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,22 +1,47 @@
|
||||
//@flow
|
||||
/*
|
||||
Copyright 2016 Aviral Dasgupta
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../languageHandler';
|
||||
import AutocompleteProvider from './AutocompleteProvider';
|
||||
import Q from 'q';
|
||||
import Fuse from 'fuse.js';
|
||||
import {PillCompletion} from './Components';
|
||||
import sdk from '../index';
|
||||
import FuzzyMatcher from './FuzzyMatcher';
|
||||
import _pull from 'lodash/pull';
|
||||
import _sortBy from 'lodash/sortBy';
|
||||
import MatrixClientPeg from '../MatrixClientPeg';
|
||||
|
||||
import type {Room, RoomMember} from 'matrix-js-sdk';
|
||||
|
||||
const USER_REGEX = /@\S*/g;
|
||||
|
||||
let instance = null;
|
||||
|
||||
export default class UserProvider extends AutocompleteProvider {
|
||||
users: Array<RoomMember> = [];
|
||||
|
||||
constructor() {
|
||||
super(USER_REGEX, {
|
||||
keys: ['name', 'userId'],
|
||||
keys: ['name'],
|
||||
});
|
||||
this.users = [];
|
||||
this.fuse = new Fuse([], {
|
||||
keys: ['name', 'userId'],
|
||||
this.matcher = new FuzzyMatcher([], {
|
||||
keys: ['name'],
|
||||
shouldMatchPrefix: true,
|
||||
});
|
||||
}
|
||||
|
||||
@@ -26,8 +51,7 @@ export default class UserProvider extends AutocompleteProvider {
|
||||
let completions = [];
|
||||
let {command, range} = this.getCurrentCommand(query, selection, force);
|
||||
if (command) {
|
||||
this.fuse.set(this.users);
|
||||
completions = this.fuse.search(command[0]).map(user => {
|
||||
completions = this.matcher.match(command[0]).slice(0, 4).map((user) => {
|
||||
let displayName = (user.name || user.userId || '').replace(' (IRC)', ''); // FIXME when groups are done
|
||||
let completion = displayName;
|
||||
if (range.start === 0) {
|
||||
@@ -45,17 +69,43 @@ export default class UserProvider extends AutocompleteProvider {
|
||||
),
|
||||
range,
|
||||
};
|
||||
}).slice(0, 4);
|
||||
});
|
||||
}
|
||||
return completions;
|
||||
}
|
||||
|
||||
getName() {
|
||||
return '👥 Users';
|
||||
return '👥 ' + _t('Users');
|
||||
}
|
||||
|
||||
setUserList(users) {
|
||||
this.users = users;
|
||||
setUserListFromRoom(room: Room) {
|
||||
const events = room.getLiveTimeline().getEvents();
|
||||
const lastSpoken = {};
|
||||
|
||||
for(const event of events) {
|
||||
lastSpoken[event.getSender()] = event.getTs();
|
||||
}
|
||||
|
||||
const currentUserId = MatrixClientPeg.get().credentials.userId;
|
||||
this.users = room.getJoinedMembers().filter((member) => {
|
||||
if (member.userId !== currentUserId) return true;
|
||||
});
|
||||
|
||||
this.users = _sortBy(this.users, (member) =>
|
||||
1E20 - lastSpoken[member.userId] || 1E20,
|
||||
);
|
||||
|
||||
this.matcher.setObjects(this.users);
|
||||
}
|
||||
|
||||
onUserSpoke(user: RoomMember) {
|
||||
if(user.userId === MatrixClientPeg.get().credentials.userId) return;
|
||||
|
||||
this.users = this.users.splice(
|
||||
this.users.findIndex((user2) => user2.userId === user.userId), 1);
|
||||
this.users = [user, ...this.users];
|
||||
|
||||
this.matcher.setObjects(this.users);
|
||||
}
|
||||
|
||||
static getInstance(): UserProvider {
|
||||
@@ -66,7 +116,7 @@ export default class UserProvider extends AutocompleteProvider {
|
||||
}
|
||||
|
||||
renderCompletions(completions: [React.Component]): ?React.Component {
|
||||
return <div className="mx_Autocomplete_Completion_container_pill">
|
||||
return <div className="mx_Autocomplete_Completion_container_pill mx_Autocomplete_Completion_container_truncate">
|
||||
{completions}
|
||||
</div>;
|
||||
}
|
||||
|
||||
@@ -1,253 +0,0 @@
|
||||
/*
|
||||
Copyright 2015, 2016 OpenMarket Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
/*
|
||||
* THIS FILE IS AUTO-GENERATED
|
||||
* You can edit it you like, but your changes will be overwritten,
|
||||
* so you'd just be trying to swim upstream like a salmon.
|
||||
* You are not a salmon.
|
||||
*
|
||||
* To update it, run:
|
||||
* ./reskindex.js -h header
|
||||
*/
|
||||
|
||||
module.exports.components = {};
|
||||
import structures$ContextualMenu from './components/structures/ContextualMenu';
|
||||
structures$ContextualMenu && (module.exports.components['structures.ContextualMenu'] = structures$ContextualMenu);
|
||||
import structures$CreateRoom from './components/structures/CreateRoom';
|
||||
structures$CreateRoom && (module.exports.components['structures.CreateRoom'] = structures$CreateRoom);
|
||||
import structures$FilePanel from './components/structures/FilePanel';
|
||||
structures$FilePanel && (module.exports.components['structures.FilePanel'] = structures$FilePanel);
|
||||
import structures$InteractiveAuth from './components/structures/InteractiveAuth';
|
||||
structures$InteractiveAuth && (module.exports.components['structures.InteractiveAuth'] = structures$InteractiveAuth);
|
||||
import structures$LoggedInView from './components/structures/LoggedInView';
|
||||
structures$LoggedInView && (module.exports.components['structures.LoggedInView'] = structures$LoggedInView);
|
||||
import structures$MatrixChat from './components/structures/MatrixChat';
|
||||
structures$MatrixChat && (module.exports.components['structures.MatrixChat'] = structures$MatrixChat);
|
||||
import structures$MessagePanel from './components/structures/MessagePanel';
|
||||
structures$MessagePanel && (module.exports.components['structures.MessagePanel'] = structures$MessagePanel);
|
||||
import structures$NotificationPanel from './components/structures/NotificationPanel';
|
||||
structures$NotificationPanel && (module.exports.components['structures.NotificationPanel'] = structures$NotificationPanel);
|
||||
import structures$RoomStatusBar from './components/structures/RoomStatusBar';
|
||||
structures$RoomStatusBar && (module.exports.components['structures.RoomStatusBar'] = structures$RoomStatusBar);
|
||||
import structures$RoomView from './components/structures/RoomView';
|
||||
structures$RoomView && (module.exports.components['structures.RoomView'] = structures$RoomView);
|
||||
import structures$ScrollPanel from './components/structures/ScrollPanel';
|
||||
structures$ScrollPanel && (module.exports.components['structures.ScrollPanel'] = structures$ScrollPanel);
|
||||
import structures$TimelinePanel from './components/structures/TimelinePanel';
|
||||
structures$TimelinePanel && (module.exports.components['structures.TimelinePanel'] = structures$TimelinePanel);
|
||||
import structures$UploadBar from './components/structures/UploadBar';
|
||||
structures$UploadBar && (module.exports.components['structures.UploadBar'] = structures$UploadBar);
|
||||
import structures$UserSettings from './components/structures/UserSettings';
|
||||
structures$UserSettings && (module.exports.components['structures.UserSettings'] = structures$UserSettings);
|
||||
import structures$login$ForgotPassword from './components/structures/login/ForgotPassword';
|
||||
structures$login$ForgotPassword && (module.exports.components['structures.login.ForgotPassword'] = structures$login$ForgotPassword);
|
||||
import structures$login$Login from './components/structures/login/Login';
|
||||
structures$login$Login && (module.exports.components['structures.login.Login'] = structures$login$Login);
|
||||
import structures$login$PostRegistration from './components/structures/login/PostRegistration';
|
||||
structures$login$PostRegistration && (module.exports.components['structures.login.PostRegistration'] = structures$login$PostRegistration);
|
||||
import structures$login$Registration from './components/structures/login/Registration';
|
||||
structures$login$Registration && (module.exports.components['structures.login.Registration'] = structures$login$Registration);
|
||||
import views$avatars$BaseAvatar from './components/views/avatars/BaseAvatar';
|
||||
views$avatars$BaseAvatar && (module.exports.components['views.avatars.BaseAvatar'] = views$avatars$BaseAvatar);
|
||||
import views$avatars$MemberAvatar from './components/views/avatars/MemberAvatar';
|
||||
views$avatars$MemberAvatar && (module.exports.components['views.avatars.MemberAvatar'] = views$avatars$MemberAvatar);
|
||||
import views$avatars$RoomAvatar from './components/views/avatars/RoomAvatar';
|
||||
views$avatars$RoomAvatar && (module.exports.components['views.avatars.RoomAvatar'] = views$avatars$RoomAvatar);
|
||||
import views$create_room$CreateRoomButton from './components/views/create_room/CreateRoomButton';
|
||||
views$create_room$CreateRoomButton && (module.exports.components['views.create_room.CreateRoomButton'] = views$create_room$CreateRoomButton);
|
||||
import views$create_room$Presets from './components/views/create_room/Presets';
|
||||
views$create_room$Presets && (module.exports.components['views.create_room.Presets'] = views$create_room$Presets);
|
||||
import views$create_room$RoomAlias from './components/views/create_room/RoomAlias';
|
||||
views$create_room$RoomAlias && (module.exports.components['views.create_room.RoomAlias'] = views$create_room$RoomAlias);
|
||||
import views$dialogs$BaseDialog from './components/views/dialogs/BaseDialog';
|
||||
views$dialogs$BaseDialog && (module.exports.components['views.dialogs.BaseDialog'] = views$dialogs$BaseDialog);
|
||||
import views$dialogs$ChatCreateOrReuseDialog from './components/views/dialogs/ChatCreateOrReuseDialog';
|
||||
views$dialogs$ChatCreateOrReuseDialog && (module.exports.components['views.dialogs.ChatCreateOrReuseDialog'] = views$dialogs$ChatCreateOrReuseDialog);
|
||||
import views$dialogs$ChatInviteDialog from './components/views/dialogs/ChatInviteDialog';
|
||||
views$dialogs$ChatInviteDialog && (module.exports.components['views.dialogs.ChatInviteDialog'] = views$dialogs$ChatInviteDialog);
|
||||
import views$dialogs$ConfirmRedactDialog from './components/views/dialogs/ConfirmRedactDialog';
|
||||
views$dialogs$ConfirmRedactDialog && (module.exports.components['views.dialogs.ConfirmRedactDialog'] = views$dialogs$ConfirmRedactDialog);
|
||||
import views$dialogs$ConfirmUserActionDialog from './components/views/dialogs/ConfirmUserActionDialog';
|
||||
views$dialogs$ConfirmUserActionDialog && (module.exports.components['views.dialogs.ConfirmUserActionDialog'] = views$dialogs$ConfirmUserActionDialog);
|
||||
import views$dialogs$DeactivateAccountDialog from './components/views/dialogs/DeactivateAccountDialog';
|
||||
views$dialogs$DeactivateAccountDialog && (module.exports.components['views.dialogs.DeactivateAccountDialog'] = views$dialogs$DeactivateAccountDialog);
|
||||
import views$dialogs$ErrorDialog from './components/views/dialogs/ErrorDialog';
|
||||
views$dialogs$ErrorDialog && (module.exports.components['views.dialogs.ErrorDialog'] = views$dialogs$ErrorDialog);
|
||||
import views$dialogs$InteractiveAuthDialog from './components/views/dialogs/InteractiveAuthDialog';
|
||||
views$dialogs$InteractiveAuthDialog && (module.exports.components['views.dialogs.InteractiveAuthDialog'] = views$dialogs$InteractiveAuthDialog);
|
||||
import views$dialogs$NeedToRegisterDialog from './components/views/dialogs/NeedToRegisterDialog';
|
||||
views$dialogs$NeedToRegisterDialog && (module.exports.components['views.dialogs.NeedToRegisterDialog'] = views$dialogs$NeedToRegisterDialog);
|
||||
import views$dialogs$QuestionDialog from './components/views/dialogs/QuestionDialog';
|
||||
views$dialogs$QuestionDialog && (module.exports.components['views.dialogs.QuestionDialog'] = views$dialogs$QuestionDialog);
|
||||
import views$dialogs$SessionRestoreErrorDialog from './components/views/dialogs/SessionRestoreErrorDialog';
|
||||
views$dialogs$SessionRestoreErrorDialog && (module.exports.components['views.dialogs.SessionRestoreErrorDialog'] = views$dialogs$SessionRestoreErrorDialog);
|
||||
import views$dialogs$SetDisplayNameDialog from './components/views/dialogs/SetDisplayNameDialog';
|
||||
views$dialogs$SetDisplayNameDialog && (module.exports.components['views.dialogs.SetDisplayNameDialog'] = views$dialogs$SetDisplayNameDialog);
|
||||
import views$dialogs$TextInputDialog from './components/views/dialogs/TextInputDialog';
|
||||
views$dialogs$TextInputDialog && (module.exports.components['views.dialogs.TextInputDialog'] = views$dialogs$TextInputDialog);
|
||||
import views$dialogs$UnknownDeviceDialog from './components/views/dialogs/UnknownDeviceDialog';
|
||||
views$dialogs$UnknownDeviceDialog && (module.exports.components['views.dialogs.UnknownDeviceDialog'] = views$dialogs$UnknownDeviceDialog);
|
||||
import views$elements$AccessibleButton from './components/views/elements/AccessibleButton';
|
||||
views$elements$AccessibleButton && (module.exports.components['views.elements.AccessibleButton'] = views$elements$AccessibleButton);
|
||||
import views$elements$AddressSelector from './components/views/elements/AddressSelector';
|
||||
views$elements$AddressSelector && (module.exports.components['views.elements.AddressSelector'] = views$elements$AddressSelector);
|
||||
import views$elements$AddressTile from './components/views/elements/AddressTile';
|
||||
views$elements$AddressTile && (module.exports.components['views.elements.AddressTile'] = views$elements$AddressTile);
|
||||
import views$elements$DeviceVerifyButtons from './components/views/elements/DeviceVerifyButtons';
|
||||
views$elements$DeviceVerifyButtons && (module.exports.components['views.elements.DeviceVerifyButtons'] = views$elements$DeviceVerifyButtons);
|
||||
import views$elements$DirectorySearchBox from './components/views/elements/DirectorySearchBox';
|
||||
views$elements$DirectorySearchBox && (module.exports.components['views.elements.DirectorySearchBox'] = views$elements$DirectorySearchBox);
|
||||
import views$elements$Dropdown from './components/views/elements/Dropdown';
|
||||
views$elements$Dropdown && (module.exports.components['views.elements.Dropdown'] = views$elements$Dropdown);
|
||||
import views$elements$EditableText from './components/views/elements/EditableText';
|
||||
views$elements$EditableText && (module.exports.components['views.elements.EditableText'] = views$elements$EditableText);
|
||||
import views$elements$EditableTextContainer from './components/views/elements/EditableTextContainer';
|
||||
views$elements$EditableTextContainer && (module.exports.components['views.elements.EditableTextContainer'] = views$elements$EditableTextContainer);
|
||||
import views$elements$EmojiText from './components/views/elements/EmojiText';
|
||||
views$elements$EmojiText && (module.exports.components['views.elements.EmojiText'] = views$elements$EmojiText);
|
||||
import views$elements$MemberEventListSummary from './components/views/elements/MemberEventListSummary';
|
||||
views$elements$MemberEventListSummary && (module.exports.components['views.elements.MemberEventListSummary'] = views$elements$MemberEventListSummary);
|
||||
import views$elements$PowerSelector from './components/views/elements/PowerSelector';
|
||||
views$elements$PowerSelector && (module.exports.components['views.elements.PowerSelector'] = views$elements$PowerSelector);
|
||||
import views$elements$ProgressBar from './components/views/elements/ProgressBar';
|
||||
views$elements$ProgressBar && (module.exports.components['views.elements.ProgressBar'] = views$elements$ProgressBar);
|
||||
import views$elements$TintableSvg from './components/views/elements/TintableSvg';
|
||||
views$elements$TintableSvg && (module.exports.components['views.elements.TintableSvg'] = views$elements$TintableSvg);
|
||||
import views$elements$TruncatedList from './components/views/elements/TruncatedList';
|
||||
views$elements$TruncatedList && (module.exports.components['views.elements.TruncatedList'] = views$elements$TruncatedList);
|
||||
import views$elements$UserSelector from './components/views/elements/UserSelector';
|
||||
views$elements$UserSelector && (module.exports.components['views.elements.UserSelector'] = views$elements$UserSelector);
|
||||
import views$login$CaptchaForm from './components/views/login/CaptchaForm';
|
||||
views$login$CaptchaForm && (module.exports.components['views.login.CaptchaForm'] = views$login$CaptchaForm);
|
||||
import views$login$CasLogin from './components/views/login/CasLogin';
|
||||
views$login$CasLogin && (module.exports.components['views.login.CasLogin'] = views$login$CasLogin);
|
||||
import views$login$CountryDropdown from './components/views/login/CountryDropdown';
|
||||
views$login$CountryDropdown && (module.exports.components['views.login.CountryDropdown'] = views$login$CountryDropdown);
|
||||
import views$login$CustomServerDialog from './components/views/login/CustomServerDialog';
|
||||
views$login$CustomServerDialog && (module.exports.components['views.login.CustomServerDialog'] = views$login$CustomServerDialog);
|
||||
import views$login$InteractiveAuthEntryComponents from './components/views/login/InteractiveAuthEntryComponents';
|
||||
views$login$InteractiveAuthEntryComponents && (module.exports.components['views.login.InteractiveAuthEntryComponents'] = views$login$InteractiveAuthEntryComponents);
|
||||
import views$login$LoginFooter from './components/views/login/LoginFooter';
|
||||
views$login$LoginFooter && (module.exports.components['views.login.LoginFooter'] = views$login$LoginFooter);
|
||||
import views$login$LoginHeader from './components/views/login/LoginHeader';
|
||||
views$login$LoginHeader && (module.exports.components['views.login.LoginHeader'] = views$login$LoginHeader);
|
||||
import views$login$PasswordLogin from './components/views/login/PasswordLogin';
|
||||
views$login$PasswordLogin && (module.exports.components['views.login.PasswordLogin'] = views$login$PasswordLogin);
|
||||
import views$login$RegistrationForm from './components/views/login/RegistrationForm';
|
||||
views$login$RegistrationForm && (module.exports.components['views.login.RegistrationForm'] = views$login$RegistrationForm);
|
||||
import views$login$ServerConfig from './components/views/login/ServerConfig';
|
||||
views$login$ServerConfig && (module.exports.components['views.login.ServerConfig'] = views$login$ServerConfig);
|
||||
import views$messages$MAudioBody from './components/views/messages/MAudioBody';
|
||||
views$messages$MAudioBody && (module.exports.components['views.messages.MAudioBody'] = views$messages$MAudioBody);
|
||||
import views$messages$MFileBody from './components/views/messages/MFileBody';
|
||||
views$messages$MFileBody && (module.exports.components['views.messages.MFileBody'] = views$messages$MFileBody);
|
||||
import views$messages$MImageBody from './components/views/messages/MImageBody';
|
||||
views$messages$MImageBody && (module.exports.components['views.messages.MImageBody'] = views$messages$MImageBody);
|
||||
import views$messages$MVideoBody from './components/views/messages/MVideoBody';
|
||||
views$messages$MVideoBody && (module.exports.components['views.messages.MVideoBody'] = views$messages$MVideoBody);
|
||||
import views$messages$MessageEvent from './components/views/messages/MessageEvent';
|
||||
views$messages$MessageEvent && (module.exports.components['views.messages.MessageEvent'] = views$messages$MessageEvent);
|
||||
import views$messages$SenderProfile from './components/views/messages/SenderProfile';
|
||||
views$messages$SenderProfile && (module.exports.components['views.messages.SenderProfile'] = views$messages$SenderProfile);
|
||||
import views$messages$TextualBody from './components/views/messages/TextualBody';
|
||||
views$messages$TextualBody && (module.exports.components['views.messages.TextualBody'] = views$messages$TextualBody);
|
||||
import views$messages$TextualEvent from './components/views/messages/TextualEvent';
|
||||
views$messages$TextualEvent && (module.exports.components['views.messages.TextualEvent'] = views$messages$TextualEvent);
|
||||
import views$messages$UnknownBody from './components/views/messages/UnknownBody';
|
||||
views$messages$UnknownBody && (module.exports.components['views.messages.UnknownBody'] = views$messages$UnknownBody);
|
||||
import views$room_settings$AliasSettings from './components/views/room_settings/AliasSettings';
|
||||
views$room_settings$AliasSettings && (module.exports.components['views.room_settings.AliasSettings'] = views$room_settings$AliasSettings);
|
||||
import views$room_settings$ColorSettings from './components/views/room_settings/ColorSettings';
|
||||
views$room_settings$ColorSettings && (module.exports.components['views.room_settings.ColorSettings'] = views$room_settings$ColorSettings);
|
||||
import views$room_settings$UrlPreviewSettings from './components/views/room_settings/UrlPreviewSettings';
|
||||
views$room_settings$UrlPreviewSettings && (module.exports.components['views.room_settings.UrlPreviewSettings'] = views$room_settings$UrlPreviewSettings);
|
||||
import views$rooms$Autocomplete from './components/views/rooms/Autocomplete';
|
||||
views$rooms$Autocomplete && (module.exports.components['views.rooms.Autocomplete'] = views$rooms$Autocomplete);
|
||||
import views$rooms$AuxPanel from './components/views/rooms/AuxPanel';
|
||||
views$rooms$AuxPanel && (module.exports.components['views.rooms.AuxPanel'] = views$rooms$AuxPanel);
|
||||
import views$rooms$EntityTile from './components/views/rooms/EntityTile';
|
||||
views$rooms$EntityTile && (module.exports.components['views.rooms.EntityTile'] = views$rooms$EntityTile);
|
||||
import views$rooms$EventTile from './components/views/rooms/EventTile';
|
||||
views$rooms$EventTile && (module.exports.components['views.rooms.EventTile'] = views$rooms$EventTile);
|
||||
import views$rooms$LinkPreviewWidget from './components/views/rooms/LinkPreviewWidget';
|
||||
views$rooms$LinkPreviewWidget && (module.exports.components['views.rooms.LinkPreviewWidget'] = views$rooms$LinkPreviewWidget);
|
||||
import views$rooms$MemberDeviceInfo from './components/views/rooms/MemberDeviceInfo';
|
||||
views$rooms$MemberDeviceInfo && (module.exports.components['views.rooms.MemberDeviceInfo'] = views$rooms$MemberDeviceInfo);
|
||||
import views$rooms$MemberInfo from './components/views/rooms/MemberInfo';
|
||||
views$rooms$MemberInfo && (module.exports.components['views.rooms.MemberInfo'] = views$rooms$MemberInfo);
|
||||
import views$rooms$MemberList from './components/views/rooms/MemberList';
|
||||
views$rooms$MemberList && (module.exports.components['views.rooms.MemberList'] = views$rooms$MemberList);
|
||||
import views$rooms$MemberTile from './components/views/rooms/MemberTile';
|
||||
views$rooms$MemberTile && (module.exports.components['views.rooms.MemberTile'] = views$rooms$MemberTile);
|
||||
import views$rooms$MessageComposer from './components/views/rooms/MessageComposer';
|
||||
views$rooms$MessageComposer && (module.exports.components['views.rooms.MessageComposer'] = views$rooms$MessageComposer);
|
||||
import views$rooms$MessageComposerInput from './components/views/rooms/MessageComposerInput';
|
||||
views$rooms$MessageComposerInput && (module.exports.components['views.rooms.MessageComposerInput'] = views$rooms$MessageComposerInput);
|
||||
import views$rooms$MessageComposerInputOld from './components/views/rooms/MessageComposerInputOld';
|
||||
views$rooms$MessageComposerInputOld && (module.exports.components['views.rooms.MessageComposerInputOld'] = views$rooms$MessageComposerInputOld);
|
||||
import views$rooms$PresenceLabel from './components/views/rooms/PresenceLabel';
|
||||
views$rooms$PresenceLabel && (module.exports.components['views.rooms.PresenceLabel'] = views$rooms$PresenceLabel);
|
||||
import views$rooms$ReadReceiptMarker from './components/views/rooms/ReadReceiptMarker';
|
||||
views$rooms$ReadReceiptMarker && (module.exports.components['views.rooms.ReadReceiptMarker'] = views$rooms$ReadReceiptMarker);
|
||||
import views$rooms$RoomHeader from './components/views/rooms/RoomHeader';
|
||||
views$rooms$RoomHeader && (module.exports.components['views.rooms.RoomHeader'] = views$rooms$RoomHeader);
|
||||
import views$rooms$RoomList from './components/views/rooms/RoomList';
|
||||
views$rooms$RoomList && (module.exports.components['views.rooms.RoomList'] = views$rooms$RoomList);
|
||||
import views$rooms$RoomNameEditor from './components/views/rooms/RoomNameEditor';
|
||||
views$rooms$RoomNameEditor && (module.exports.components['views.rooms.RoomNameEditor'] = views$rooms$RoomNameEditor);
|
||||
import views$rooms$RoomPreviewBar from './components/views/rooms/RoomPreviewBar';
|
||||
views$rooms$RoomPreviewBar && (module.exports.components['views.rooms.RoomPreviewBar'] = views$rooms$RoomPreviewBar);
|
||||
import views$rooms$RoomSettings from './components/views/rooms/RoomSettings';
|
||||
views$rooms$RoomSettings && (module.exports.components['views.rooms.RoomSettings'] = views$rooms$RoomSettings);
|
||||
import views$rooms$RoomTile from './components/views/rooms/RoomTile';
|
||||
views$rooms$RoomTile && (module.exports.components['views.rooms.RoomTile'] = views$rooms$RoomTile);
|
||||
import views$rooms$RoomTopicEditor from './components/views/rooms/RoomTopicEditor';
|
||||
views$rooms$RoomTopicEditor && (module.exports.components['views.rooms.RoomTopicEditor'] = views$rooms$RoomTopicEditor);
|
||||
import views$rooms$SearchResultTile from './components/views/rooms/SearchResultTile';
|
||||
views$rooms$SearchResultTile && (module.exports.components['views.rooms.SearchResultTile'] = views$rooms$SearchResultTile);
|
||||
import views$rooms$SearchableEntityList from './components/views/rooms/SearchableEntityList';
|
||||
views$rooms$SearchableEntityList && (module.exports.components['views.rooms.SearchableEntityList'] = views$rooms$SearchableEntityList);
|
||||
import views$rooms$SimpleRoomHeader from './components/views/rooms/SimpleRoomHeader';
|
||||
views$rooms$SimpleRoomHeader && (module.exports.components['views.rooms.SimpleRoomHeader'] = views$rooms$SimpleRoomHeader);
|
||||
import views$rooms$TabCompleteBar from './components/views/rooms/TabCompleteBar';
|
||||
views$rooms$TabCompleteBar && (module.exports.components['views.rooms.TabCompleteBar'] = views$rooms$TabCompleteBar);
|
||||
import views$rooms$TopUnreadMessagesBar from './components/views/rooms/TopUnreadMessagesBar';
|
||||
views$rooms$TopUnreadMessagesBar && (module.exports.components['views.rooms.TopUnreadMessagesBar'] = views$rooms$TopUnreadMessagesBar);
|
||||
import views$rooms$UserTile from './components/views/rooms/UserTile';
|
||||
views$rooms$UserTile && (module.exports.components['views.rooms.UserTile'] = views$rooms$UserTile);
|
||||
import views$settings$AddPhoneNumber from './components/views/settings/AddPhoneNumber';
|
||||
views$settings$AddPhoneNumber && (module.exports.components['views.settings.AddPhoneNumber'] = views$settings$AddPhoneNumber);
|
||||
import views$settings$ChangeAvatar from './components/views/settings/ChangeAvatar';
|
||||
views$settings$ChangeAvatar && (module.exports.components['views.settings.ChangeAvatar'] = views$settings$ChangeAvatar);
|
||||
import views$settings$ChangeDisplayName from './components/views/settings/ChangeDisplayName';
|
||||
views$settings$ChangeDisplayName && (module.exports.components['views.settings.ChangeDisplayName'] = views$settings$ChangeDisplayName);
|
||||
import views$settings$ChangePassword from './components/views/settings/ChangePassword';
|
||||
views$settings$ChangePassword && (module.exports.components['views.settings.ChangePassword'] = views$settings$ChangePassword);
|
||||
import views$settings$DevicesPanel from './components/views/settings/DevicesPanel';
|
||||
views$settings$DevicesPanel && (module.exports.components['views.settings.DevicesPanel'] = views$settings$DevicesPanel);
|
||||
import views$settings$DevicesPanelEntry from './components/views/settings/DevicesPanelEntry';
|
||||
views$settings$DevicesPanelEntry && (module.exports.components['views.settings.DevicesPanelEntry'] = views$settings$DevicesPanelEntry);
|
||||
import views$settings$EnableNotificationsButton from './components/views/settings/EnableNotificationsButton';
|
||||
views$settings$EnableNotificationsButton && (module.exports.components['views.settings.EnableNotificationsButton'] = views$settings$EnableNotificationsButton);
|
||||
import views$voip$CallView from './components/views/voip/CallView';
|
||||
views$voip$CallView && (module.exports.components['views.voip.CallView'] = views$voip$CallView);
|
||||
import views$voip$IncomingCallBox from './components/views/voip/IncomingCallBox';
|
||||
views$voip$IncomingCallBox && (module.exports.components['views.voip.IncomingCallBox'] = views$voip$IncomingCallBox);
|
||||
import views$voip$VideoFeed from './components/views/voip/VideoFeed';
|
||||
views$voip$VideoFeed && (module.exports.components['views.voip.VideoFeed'] = views$voip$VideoFeed);
|
||||
import views$voip$VideoView from './components/views/voip/VideoView';
|
||||
views$voip$VideoView && (module.exports.components['views.voip.VideoView'] = views$voip$VideoView);
|
||||
@@ -16,15 +16,15 @@ limitations under the License.
|
||||
|
||||
'use strict';
|
||||
|
||||
var React = require("react");
|
||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||
var PresetValues = {
|
||||
import React from 'react';
|
||||
import { _t } from '../../languageHandler';
|
||||
import sdk from '../../index';
|
||||
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||
const PresetValues = {
|
||||
PrivateChat: "private_chat",
|
||||
PublicChat: "public_chat",
|
||||
Custom: "custom",
|
||||
};
|
||||
var q = require('q');
|
||||
var sdk = require('../../index');
|
||||
|
||||
module.exports = React.createClass({
|
||||
displayName: 'CreateRoom',
|
||||
@@ -231,7 +231,7 @@ module.exports = React.createClass({
|
||||
if (curr_phase == this.phases.ERROR) {
|
||||
error_box = (
|
||||
<div className="mx_Error">
|
||||
An error occured: {this.state.error_string}
|
||||
{_t('An error occurred: %(error_string)s', {error_string: this.state.error_string})}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
@@ -246,29 +246,29 @@ module.exports = React.createClass({
|
||||
|
||||
return (
|
||||
<div className="mx_CreateRoom">
|
||||
<SimpleRoomHeader title="CreateRoom" collapsedRhs={ this.props.collapsedRhs }/>
|
||||
<SimpleRoomHeader title={_t("Create Room")} collapsedRhs={ this.props.collapsedRhs }/>
|
||||
<div className="mx_CreateRoom_body">
|
||||
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder="Name"/> <br />
|
||||
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder="Topic"/> <br />
|
||||
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder={_t('Name')}/> <br />
|
||||
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder={_t('Topic')}/> <br />
|
||||
<RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
|
||||
<UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
|
||||
<Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
|
||||
<div>
|
||||
<label>
|
||||
<input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
|
||||
Make this room private
|
||||
{_t('Make this room private')}
|
||||
</label>
|
||||
</div>
|
||||
<div>
|
||||
<label>
|
||||
<input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
|
||||
Share message history with new users
|
||||
{_t('Share message history with new users')}
|
||||
</label>
|
||||
</div>
|
||||
<div className="mx_CreateRoom_encrypt">
|
||||
<label>
|
||||
<input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
|
||||
Encrypt room
|
||||
{_t('Encrypt room')}
|
||||
</label>
|
||||
</div>
|
||||
<div>
|
||||
|
||||
@@ -14,13 +14,12 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var React = require('react');
|
||||
var ReactDOM = require("react-dom");
|
||||
import React from 'react';
|
||||
|
||||
var Matrix = require("matrix-js-sdk");
|
||||
var sdk = require('../../index');
|
||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||
var dis = require("../../dispatcher");
|
||||
import Matrix from 'matrix-js-sdk';
|
||||
import sdk from '../../index';
|
||||
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||
import { _t, _tJsx } from '../../languageHandler';
|
||||
|
||||
/*
|
||||
* Component which shows the filtered file using a TimelinePanel
|
||||
@@ -59,6 +58,8 @@ var FilePanel = React.createClass({
|
||||
var client = MatrixClientPeg.get();
|
||||
var room = client.getRoom(roomId);
|
||||
|
||||
this.noRoom = !room;
|
||||
|
||||
if (room) {
|
||||
var filter = new Matrix.Filter(client.credentials.userId);
|
||||
filter.setDefinition(
|
||||
@@ -82,13 +83,24 @@ var FilePanel = React.createClass({
|
||||
console.error("Failed to get or create file panel filter", error);
|
||||
}
|
||||
);
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
console.error("Failed to add filtered timelineSet for FilePanel as no room!");
|
||||
}
|
||||
},
|
||||
|
||||
render: function() {
|
||||
if (MatrixClientPeg.get().isGuest()) {
|
||||
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||
<div className="mx_RoomView_empty">
|
||||
{_tJsx("You must <a>register</a> to use this functionality", /<a>(.*?)<\/a>/, (sub) => <a href="#/register" key="sub">{sub}</a>)}
|
||||
</div>
|
||||
</div>;
|
||||
} else if (this.noRoom) {
|
||||
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||
<div className="mx_RoomView_empty">{_t("You must join the room to see its files")}</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
// wrap a TimelinePanel with the jump-to-event bits turned off.
|
||||
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
||||
var Loader = sdk.getComponent("elements.Spinner");
|
||||
@@ -105,7 +117,7 @@ var FilePanel = React.createClass({
|
||||
showUrlPreview = { false }
|
||||
tileShape="file_grid"
|
||||
opacity={ this.props.opacity }
|
||||
empty="There are no visible files in this room"
|
||||
empty={_t('There are no visible files in this room')}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
143
src/components/structures/GroupView.js
Normal file
143
src/components/structures/GroupView.js
Normal file
@@ -0,0 +1,143 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd.
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||
import sdk from '../../index';
|
||||
import { sanitizedHtmlNode } from '../../HtmlUtils';
|
||||
import { _t } from '../../languageHandler';
|
||||
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'GroupView',
|
||||
|
||||
propTypes: {
|
||||
groupId: PropTypes.string.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
summary: null,
|
||||
error: null,
|
||||
};
|
||||
},
|
||||
|
||||
componentWillMount: function() {
|
||||
this._loadGroupFromServer(this.props.groupId);
|
||||
},
|
||||
|
||||
componentWillReceiveProps: function(newProps) {
|
||||
if (this.props.groupId != newProps.groupId) {
|
||||
this.setState({
|
||||
summary: null,
|
||||
error: null,
|
||||
}, () => {
|
||||
this._loadGroupFromServer(newProps.groupId);
|
||||
});
|
||||
}
|
||||
},
|
||||
|
||||
_loadGroupFromServer: function(groupId) {
|
||||
MatrixClientPeg.get().getGroupSummary(groupId).done((res) => {
|
||||
this.setState({
|
||||
summary: res,
|
||||
error: null,
|
||||
});
|
||||
}, (err) => {
|
||||
this.setState({
|
||||
summary: null,
|
||||
error: err,
|
||||
});
|
||||
});
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const GroupAvatar = sdk.getComponent("avatars.GroupAvatar");
|
||||
const Loader = sdk.getComponent("elements.Spinner");
|
||||
|
||||
if (this.state.summary === null && this.state.error === null) {
|
||||
return <Loader />;
|
||||
} else if (this.state.summary) {
|
||||
const summary = this.state.summary;
|
||||
let description = null;
|
||||
if (summary.profile && summary.profile.long_description) {
|
||||
description = sanitizedHtmlNode(summary.profile.long_description);
|
||||
}
|
||||
|
||||
let nameNode;
|
||||
if (summary.profile && summary.profile.name) {
|
||||
nameNode = <div className="mx_RoomHeader_name">
|
||||
<span>{summary.profile.name}</span>
|
||||
<span className="mx_GroupView_header_groupid">
|
||||
({this.props.groupId})
|
||||
</span>
|
||||
</div>;
|
||||
} else {
|
||||
nameNode = <div className="mx_RoomHeader_name">
|
||||
<span>{this.props.groupId}</span>
|
||||
</div>;
|
||||
}
|
||||
|
||||
const groupAvatarUrl = summary.profile ? summary.profile.avatar_url : null;
|
||||
|
||||
return (
|
||||
<div className="mx_GroupView">
|
||||
<div className="mx_RoomHeader">
|
||||
<div className="mx_RoomHeader_wrapper">
|
||||
<div className="mx_RoomHeader_avatar">
|
||||
<GroupAvatar
|
||||
groupId={this.props.groupId}
|
||||
groupAvatarUrl={groupAvatarUrl}
|
||||
width={48} height={48}
|
||||
/>
|
||||
</div>
|
||||
<div className="mx_RoomHeader_info">
|
||||
{nameNode}
|
||||
<div className="mx_RoomHeader_topic">
|
||||
{summary.profile.short_description}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
{description}
|
||||
</div>
|
||||
);
|
||||
} else if (this.state.error) {
|
||||
if (this.state.error.httpStatus === 404) {
|
||||
return (
|
||||
<div className="mx_GroupView_error">
|
||||
Group {this.props.groupId} not found
|
||||
</div>
|
||||
);
|
||||
} else {
|
||||
let extraText;
|
||||
if (this.state.error.errcode === 'M_UNRECOGNIZED') {
|
||||
extraText = <div>{_t('This Home server does not support groups')}</div>;
|
||||
}
|
||||
return (
|
||||
<div className="mx_GroupView_error">
|
||||
Failed to load {this.props.groupId}
|
||||
{extraText}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
} else {
|
||||
console.error("Invalid state for GroupView");
|
||||
return <div />;
|
||||
}
|
||||
},
|
||||
});
|
||||
@@ -19,8 +19,6 @@ const InteractiveAuth = Matrix.InteractiveAuth;
|
||||
|
||||
import React from 'react';
|
||||
|
||||
import sdk from '../../index';
|
||||
|
||||
import {getEntryComponentForLoginType} from '../views/login/InteractiveAuthEntryComponents';
|
||||
|
||||
export default React.createClass({
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2015, 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -17,11 +18,15 @@ limitations under the License.
|
||||
import * as Matrix from 'matrix-js-sdk';
|
||||
import React from 'react';
|
||||
|
||||
import UserSettingsStore from '../../UserSettingsStore';
|
||||
import KeyCode from '../../KeyCode';
|
||||
import Notifier from '../../Notifier';
|
||||
import PageTypes from '../../PageTypes';
|
||||
import CallMediaHandler from '../../CallMediaHandler';
|
||||
import sdk from '../../index';
|
||||
import dis from '../../dispatcher';
|
||||
import sessionStore from '../../stores/SessionStore';
|
||||
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||
|
||||
/**
|
||||
* This is what our MatrixChat shows when we are logged in. The precise view is
|
||||
@@ -38,10 +43,13 @@ export default React.createClass({
|
||||
propTypes: {
|
||||
matrixClient: React.PropTypes.instanceOf(Matrix.MatrixClient).isRequired,
|
||||
page_type: React.PropTypes.string.isRequired,
|
||||
onRoomIdResolved: React.PropTypes.func,
|
||||
onRoomCreated: React.PropTypes.func,
|
||||
onUserSettingsClose: React.PropTypes.func,
|
||||
|
||||
// Called with the credentials of a registered user (if they were a ROU that
|
||||
// transitioned to PWLU)
|
||||
onRegistered: React.PropTypes.func,
|
||||
|
||||
teamToken: React.PropTypes.string,
|
||||
|
||||
// and lots and lots of other stuff.
|
||||
@@ -62,6 +70,13 @@ export default React.createClass({
|
||||
};
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
// use compact timeline view
|
||||
useCompactLayout: UserSettingsStore.getSyncedSetting('useCompactLayout'),
|
||||
};
|
||||
},
|
||||
|
||||
componentWillMount: function() {
|
||||
// stash the MatrixClient in case we log out before we are unmounted
|
||||
this._matrixClient = this.props.matrixClient;
|
||||
@@ -70,11 +85,35 @@ export default React.createClass({
|
||||
// RoomView.getScrollState()
|
||||
this._scrollStateMap = {};
|
||||
|
||||
CallMediaHandler.loadDevices();
|
||||
|
||||
document.addEventListener('keydown', this._onKeyDown);
|
||||
|
||||
this._sessionStore = sessionStore;
|
||||
this._sessionStoreToken = this._sessionStore.addListener(
|
||||
this._setStateFromSessionStore,
|
||||
);
|
||||
this._setStateFromSessionStore();
|
||||
|
||||
this._matrixClient.on("accountData", this.onAccountData);
|
||||
},
|
||||
|
||||
componentWillUnmount: function() {
|
||||
document.removeEventListener('keydown', this._onKeyDown);
|
||||
this._matrixClient.removeListener("accountData", this.onAccountData);
|
||||
if (this._sessionStoreToken) {
|
||||
this._sessionStoreToken.remove();
|
||||
}
|
||||
},
|
||||
|
||||
// Child components assume that the client peg will not be null, so give them some
|
||||
// sort of assurance here by only allowing a re-render if the client is truthy.
|
||||
//
|
||||
// This is required because `LoggedInView` maintains its own state and if this state
|
||||
// updates after the client peg has been made null (during logout), then it will
|
||||
// attempt to re-render and the children will throw errors.
|
||||
shouldComponentUpdate: function() {
|
||||
return Boolean(MatrixClientPeg.get());
|
||||
},
|
||||
|
||||
getScrollStateForRoom: function(roomId) {
|
||||
@@ -88,6 +127,20 @@ export default React.createClass({
|
||||
return this.refs.roomView.canResetTimeline();
|
||||
},
|
||||
|
||||
_setStateFromSessionStore() {
|
||||
this.setState({
|
||||
userHasGeneratedPassword: Boolean(this._sessionStore.getCachedPassword()),
|
||||
});
|
||||
},
|
||||
|
||||
onAccountData: function(event) {
|
||||
if (event.getType() === "im.vector.web.settings") {
|
||||
this.setState({
|
||||
useCompactLayout: event.getContent().useCompactLayout,
|
||||
});
|
||||
}
|
||||
},
|
||||
|
||||
_onKeyDown: function(ev) {
|
||||
/*
|
||||
// Remove this for now as ctrl+alt = alt-gr so this breaks keyboards which rely on alt-gr for numbers
|
||||
@@ -106,20 +159,9 @@ export default React.createClass({
|
||||
var handled = false;
|
||||
|
||||
switch (ev.keyCode) {
|
||||
case KeyCode.ESCAPE:
|
||||
|
||||
// Implemented this way so possible handling for other pages is neater
|
||||
switch (this.props.page_type) {
|
||||
case PageTypes.UserSettings:
|
||||
this.props.onUserSettingsClose();
|
||||
handled = true;
|
||||
break;
|
||||
}
|
||||
|
||||
break;
|
||||
case KeyCode.UP:
|
||||
case KeyCode.DOWN:
|
||||
if (ev.altKey) {
|
||||
if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
|
||||
var action = ev.keyCode == KeyCode.UP ?
|
||||
'view_prev_room' : 'view_next_room';
|
||||
dis.dispatch({action: action});
|
||||
@@ -129,13 +171,15 @@ export default React.createClass({
|
||||
|
||||
case KeyCode.PAGE_UP:
|
||||
case KeyCode.PAGE_DOWN:
|
||||
this._onScrollKeyPressed(ev);
|
||||
handled = true;
|
||||
if (!ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this._onScrollKeyPressed(ev);
|
||||
handled = true;
|
||||
}
|
||||
break;
|
||||
|
||||
case KeyCode.HOME:
|
||||
case KeyCode.END:
|
||||
if (ev.ctrlKey) {
|
||||
if (ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this._onScrollKeyPressed(ev);
|
||||
handled = true;
|
||||
}
|
||||
@@ -153,54 +197,60 @@ export default React.createClass({
|
||||
if (this.refs.roomView) {
|
||||
this.refs.roomView.handleScrollKey(ev);
|
||||
}
|
||||
else if (this.refs.roomDirectory) {
|
||||
this.refs.roomDirectory.handleScrollKey(ev);
|
||||
}
|
||||
},
|
||||
|
||||
render: function() {
|
||||
var LeftPanel = sdk.getComponent('structures.LeftPanel');
|
||||
var RightPanel = sdk.getComponent('structures.RightPanel');
|
||||
var RoomView = sdk.getComponent('structures.RoomView');
|
||||
var UserSettings = sdk.getComponent('structures.UserSettings');
|
||||
var CreateRoom = sdk.getComponent('structures.CreateRoom');
|
||||
var RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
||||
var HomePage = sdk.getComponent('structures.HomePage');
|
||||
var MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
||||
var GuestWarningBar = sdk.getComponent('globals.GuestWarningBar');
|
||||
var NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
||||
const LeftPanel = sdk.getComponent('structures.LeftPanel');
|
||||
const RightPanel = sdk.getComponent('structures.RightPanel');
|
||||
const RoomView = sdk.getComponent('structures.RoomView');
|
||||
const UserSettings = sdk.getComponent('structures.UserSettings');
|
||||
const CreateRoom = sdk.getComponent('structures.CreateRoom');
|
||||
const RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
||||
const HomePage = sdk.getComponent('structures.HomePage');
|
||||
const GroupView = sdk.getComponent('structures.GroupView');
|
||||
const MyGroups = sdk.getComponent('structures.MyGroups');
|
||||
const MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
||||
const NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
||||
const UpdateCheckBar = sdk.getComponent('globals.UpdateCheckBar');
|
||||
const PasswordNagBar = sdk.getComponent('globals.PasswordNagBar');
|
||||
|
||||
var page_element;
|
||||
var right_panel = '';
|
||||
let page_element;
|
||||
let right_panel = '';
|
||||
|
||||
switch (this.props.page_type) {
|
||||
case PageTypes.RoomView:
|
||||
page_element = <RoomView
|
||||
ref='roomView'
|
||||
roomAddress={this.props.currentRoomAlias || this.props.currentRoomId}
|
||||
autoJoin={this.props.autoJoin}
|
||||
onRoomIdResolved={this.props.onRoomIdResolved}
|
||||
eventId={this.props.initialEventId}
|
||||
onRegistered={this.props.onRegistered}
|
||||
thirdPartyInvite={this.props.thirdPartyInvite}
|
||||
oobData={this.props.roomOobData}
|
||||
highlightedEventId={this.props.highlightedEventId}
|
||||
eventPixelOffset={this.props.initialEventPixelOffset}
|
||||
key={this.props.currentRoomAlias || this.props.currentRoomId}
|
||||
key={this.props.currentRoomId || 'roomview'}
|
||||
opacity={this.props.middleOpacity}
|
||||
collapsedRhs={this.props.collapse_rhs}
|
||||
ConferenceHandler={this.props.ConferenceHandler}
|
||||
scrollStateMap={this._scrollStateMap}
|
||||
/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.sideOpacity} />;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.rightOpacity} />;
|
||||
break;
|
||||
|
||||
case PageTypes.UserSettings:
|
||||
page_element = <UserSettings
|
||||
onClose={this.props.onUserSettingsClose}
|
||||
brand={this.props.config.brand}
|
||||
collapsedRhs={this.props.collapse_rhs}
|
||||
enableLabs={this.props.config.enableLabs}
|
||||
referralBaseUrl={this.props.config.referralBaseUrl}
|
||||
teamToken={this.props.teamToken}
|
||||
/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||
break;
|
||||
|
||||
case PageTypes.MyGroups:
|
||||
page_element = <MyGroups />;
|
||||
break;
|
||||
|
||||
case PageTypes.CreateRoom:
|
||||
@@ -208,42 +258,54 @@ export default React.createClass({
|
||||
onRoomCreated={this.props.onRoomCreated}
|
||||
collapsedRhs={this.props.collapse_rhs}
|
||||
/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||
break;
|
||||
|
||||
case PageTypes.RoomDirectory:
|
||||
page_element = <RoomDirectory
|
||||
collapsedRhs={this.props.collapse_rhs}
|
||||
ref="roomDirectory"
|
||||
config={this.props.config.roomDirectory}
|
||||
/>;
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
||||
break;
|
||||
|
||||
case PageTypes.HomePage:
|
||||
page_element = <HomePage
|
||||
collapsedRhs={this.props.collapse_rhs}
|
||||
teamServerUrl={this.props.config.teamServerConfig.teamServerURL}
|
||||
teamToken={this.props.teamToken}
|
||||
/>
|
||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>
|
||||
{
|
||||
// If team server config is present, pass the teamServerURL. props.teamToken
|
||||
// must also be set for the team page to be displayed, otherwise the
|
||||
// welcomePageUrl is used (which might be undefined).
|
||||
const teamServerUrl = this.props.config.teamServerConfig ?
|
||||
this.props.config.teamServerConfig.teamServerURL : null;
|
||||
|
||||
page_element = <HomePage
|
||||
teamServerUrl={teamServerUrl}
|
||||
teamToken={this.props.teamToken}
|
||||
homePageUrl={this.props.config.welcomePageUrl}
|
||||
/>;
|
||||
}
|
||||
break;
|
||||
|
||||
case PageTypes.UserView:
|
||||
page_element = null; // deliberately null for now
|
||||
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.sideOpacity} />;
|
||||
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.rightOpacity} />;
|
||||
break;
|
||||
case PageTypes.GroupView:
|
||||
page_element = <GroupView
|
||||
groupId={this.props.currentGroupId}
|
||||
/>;
|
||||
break;
|
||||
}
|
||||
|
||||
var topBar;
|
||||
let topBar;
|
||||
const isGuest = this.props.matrixClient.isGuest();
|
||||
if (this.props.hasNewVersion) {
|
||||
topBar = <NewVersionBar version={this.props.version} newVersion={this.props.newVersion}
|
||||
releaseNotes={this.props.newVersionReleaseNotes}
|
||||
releaseNotes={this.props.newVersionReleaseNotes}
|
||||
/>;
|
||||
}
|
||||
else if (this.props.matrixClient.isGuest()) {
|
||||
topBar = <GuestWarningBar />;
|
||||
}
|
||||
else if (Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
|
||||
} else if (this.props.checkingForUpdate) {
|
||||
topBar = <UpdateCheckBar {...this.props.checkingForUpdate} />;
|
||||
} else if (this.state.userHasGeneratedPassword) {
|
||||
topBar = <PasswordNagBar />;
|
||||
} else if (!isGuest && Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
|
||||
topBar = <MatrixToolbar />;
|
||||
}
|
||||
|
||||
@@ -251,6 +313,9 @@ export default React.createClass({
|
||||
if (topBar) {
|
||||
bodyClasses += ' mx_MatrixChat_toolbarShowing';
|
||||
}
|
||||
if (this.state.useCompactLayout) {
|
||||
bodyClasses += ' mx_MatrixChat_useCompactLayout';
|
||||
}
|
||||
|
||||
return (
|
||||
<div className='mx_MatrixChat_wrapper'>
|
||||
@@ -259,8 +324,7 @@ export default React.createClass({
|
||||
<LeftPanel
|
||||
selectedRoom={this.props.currentRoomId}
|
||||
collapsed={this.props.collapse_lhs || false}
|
||||
opacity={this.props.sideOpacity}
|
||||
teamToken={this.props.teamToken}
|
||||
opacity={this.props.leftOpacity}
|
||||
/>
|
||||
<main className='mx_MatrixChat_middlePanel'>
|
||||
{page_element}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -84,6 +84,15 @@ module.exports = React.createClass({
|
||||
|
||||
// shape parameter to be passed to EventTiles
|
||||
tileShape: React.PropTypes.string,
|
||||
|
||||
// show twelve hour timestamps
|
||||
isTwelveHour: React.PropTypes.bool,
|
||||
|
||||
// show timestamps always
|
||||
alwaysShowTimestamps: React.PropTypes.bool,
|
||||
|
||||
// hide redacted events as per old behaviour
|
||||
hideRedactions: React.PropTypes.bool,
|
||||
},
|
||||
|
||||
componentWillMount: function() {
|
||||
@@ -230,8 +239,8 @@ module.exports = React.createClass({
|
||||
},
|
||||
|
||||
_getEventTiles: function() {
|
||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||
const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
|
||||
|
||||
this.eventNodes = {};
|
||||
@@ -279,20 +288,19 @@ module.exports = React.createClass({
|
||||
this.currentGhostEventId = null;
|
||||
}
|
||||
|
||||
var isMembershipChange = (e) =>
|
||||
e.getType() === 'm.room.member'
|
||||
&& (!e.getPrevContent() || e.getContent().membership !== e.getPrevContent().membership);
|
||||
var isMembershipChange = (e) => e.getType() === 'm.room.member';
|
||||
|
||||
for (i = 0; i < this.props.events.length; i++) {
|
||||
var mxEv = this.props.events[i];
|
||||
var wantTile = true;
|
||||
var eventId = mxEv.getId();
|
||||
let mxEv = this.props.events[i];
|
||||
let wantTile = true;
|
||||
let eventId = mxEv.getId();
|
||||
let readMarkerInMels = false;
|
||||
|
||||
if (!EventTile.haveTileForEvent(mxEv)) {
|
||||
wantTile = false;
|
||||
}
|
||||
|
||||
var last = (i == lastShownEventIndex);
|
||||
let last = (i == lastShownEventIndex);
|
||||
|
||||
// Wrap consecutive member events in a ListSummary, ignore if redacted
|
||||
if (isMembershipChange(mxEv) &&
|
||||
@@ -311,7 +319,7 @@ module.exports = React.createClass({
|
||||
const key = "membereventlistsummary-" + (prevEvent ? mxEv.getId() : "initial");
|
||||
|
||||
if (this._wantsDateSeparator(prevEvent, mxEv.getDate())) {
|
||||
let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1}/></li>;
|
||||
let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
|
||||
ret.push(dateSeparator);
|
||||
}
|
||||
|
||||
@@ -334,6 +342,9 @@ module.exports = React.createClass({
|
||||
|
||||
let eventTiles = summarisedEvents.map(
|
||||
(e) => {
|
||||
if (e.getId() === this.props.readMarkerEventId) {
|
||||
readMarkerInMels = true;
|
||||
}
|
||||
// In order to prevent DateSeparators from appearing in the expanded form
|
||||
// of MemberEventListSummary, render each member event as if the previous
|
||||
// one was itself. This way, the timestamp of the previous event === the
|
||||
@@ -352,12 +363,16 @@ module.exports = React.createClass({
|
||||
<MemberEventListSummary
|
||||
key={key}
|
||||
events={summarisedEvents}
|
||||
data-scroll-token={eventId}
|
||||
onToggle={this._onWidgetLoad} // Update scroll state
|
||||
>
|
||||
{eventTiles}
|
||||
</MemberEventListSummary>
|
||||
);
|
||||
|
||||
if (readMarkerInMels) {
|
||||
ret.push(this._getReadMarkerTile(visible));
|
||||
}
|
||||
|
||||
continue;
|
||||
}
|
||||
|
||||
@@ -388,6 +403,8 @@ module.exports = React.createClass({
|
||||
isVisibleReadMarker = visible;
|
||||
}
|
||||
|
||||
// XXX: there should be no need for a ghost tile - we should just use a
|
||||
// a dispatch (user_activity_end) to start the RM animation.
|
||||
if (eventId == this.currentGhostEventId) {
|
||||
// if we're showing an animation, continue to show it.
|
||||
ret.push(this._getReadMarkerGhostTile());
|
||||
@@ -405,8 +422,8 @@ module.exports = React.createClass({
|
||||
},
|
||||
|
||||
_getTilesForEvent: function(prevEvent, mxEv, last) {
|
||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||
var ret = [];
|
||||
|
||||
// is this a continuation of the previous message?
|
||||
@@ -444,11 +461,13 @@ module.exports = React.createClass({
|
||||
|
||||
// do we need a date separator since the last event?
|
||||
if (this._wantsDateSeparator(prevEvent, eventDate)) {
|
||||
var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1}/></li>;
|
||||
var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
|
||||
ret.push(dateSeparator);
|
||||
continuation = false;
|
||||
}
|
||||
|
||||
if (mxEv.isRedacted() && this.props.hideRedactions) return ret;
|
||||
|
||||
var eventId = mxEv.getId();
|
||||
var highlight = (eventId == this.props.highlightedEventId);
|
||||
|
||||
@@ -460,11 +479,10 @@ module.exports = React.createClass({
|
||||
if (this.props.manageReadReceipts) {
|
||||
readReceipts = this._getReadReceiptsForEvent(mxEv);
|
||||
}
|
||||
|
||||
ret.push(
|
||||
<li key={eventId}
|
||||
ref={this._collectEventNode.bind(this, eventId)}
|
||||
data-scroll-token={scrollToken}>
|
||||
data-scroll-tokens={scrollToken}>
|
||||
<EventTile mxEvent={mxEv} continuation={continuation}
|
||||
isRedacted={mxEv.isRedacted()}
|
||||
onWidgetLoad={this._onWidgetLoad}
|
||||
@@ -474,6 +492,7 @@ module.exports = React.createClass({
|
||||
checkUnmounting={this._isUnmounting}
|
||||
eventSendStatus={mxEv.status}
|
||||
tileShape={this.props.tileShape}
|
||||
isTwelveHour={this.props.isTwelveHour}
|
||||
last={last} isSelectedEvent={highlight}/>
|
||||
</li>
|
||||
);
|
||||
@@ -607,8 +626,13 @@ module.exports = React.createClass({
|
||||
var style = this.props.hidden ? { display: 'none' } : {};
|
||||
style.opacity = this.props.opacity;
|
||||
|
||||
var className = this.props.className + " mx_fadable";
|
||||
if (this.props.alwaysShowTimestamps) {
|
||||
className += " mx_MessagePanel_alwaysShowTimestamps";
|
||||
}
|
||||
|
||||
return (
|
||||
<ScrollPanel ref="scrollPanel" className={ this.props.className + " mx_fadable" }
|
||||
<ScrollPanel ref="scrollPanel" className={ className }
|
||||
onScroll={ this.props.onScroll }
|
||||
onResize={ this.onResize }
|
||||
onFillRequest={ this.props.onFillRequest }
|
||||
|
||||
141
src/components/structures/MyGroups.js
Normal file
141
src/components/structures/MyGroups.js
Normal file
@@ -0,0 +1,141 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../index';
|
||||
import { _t, _tJsx } from '../../languageHandler';
|
||||
import withMatrixClient from '../../wrappers/withMatrixClient';
|
||||
import AccessibleButton from '../views/elements/AccessibleButton';
|
||||
import dis from '../../dispatcher';
|
||||
import PropTypes from 'prop-types';
|
||||
import Modal from '../../Modal';
|
||||
|
||||
const GroupTile = React.createClass({
|
||||
displayName: 'GroupTile',
|
||||
|
||||
propTypes: {
|
||||
groupId: PropTypes.string.isRequired,
|
||||
},
|
||||
|
||||
onClick: function(e) {
|
||||
e.preventDefault();
|
||||
dis.dispatch({
|
||||
action: 'view_group',
|
||||
group_id: this.props.groupId,
|
||||
});
|
||||
},
|
||||
|
||||
render: function() {
|
||||
return <a onClick={this.onClick} href="#">{this.props.groupId}</a>;
|
||||
},
|
||||
});
|
||||
|
||||
export default withMatrixClient(React.createClass({
|
||||
displayName: 'MyGroups',
|
||||
|
||||
propTypes: {
|
||||
matrixClient: React.PropTypes.object.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
groups: null,
|
||||
error: null,
|
||||
};
|
||||
},
|
||||
|
||||
componentWillMount: function() {
|
||||
this._fetch();
|
||||
},
|
||||
|
||||
_onCreateGroupClick: function() {
|
||||
const CreateGroupDialog = sdk.getComponent("dialogs.CreateGroupDialog");
|
||||
Modal.createDialog(CreateGroupDialog);
|
||||
},
|
||||
|
||||
_fetch: function() {
|
||||
this.props.matrixClient.getJoinedGroups().done((result) => {
|
||||
this.setState({groups: result.groups, error: null});
|
||||
}, (err) => {
|
||||
this.setState({groups: null, error: err});
|
||||
});
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const Loader = sdk.getComponent("elements.Spinner");
|
||||
const SimpleRoomHeader = sdk.getComponent('rooms.SimpleRoomHeader');
|
||||
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||
|
||||
let content;
|
||||
if (this.state.groups) {
|
||||
const groupNodes = [];
|
||||
this.state.groups.forEach((g) => {
|
||||
groupNodes.push(
|
||||
<div key={g}>
|
||||
<GroupTile groupId={g} />
|
||||
</div>,
|
||||
);
|
||||
});
|
||||
content = <div>
|
||||
<div>{_t('You are a member of these groups:')}</div>
|
||||
{groupNodes}
|
||||
</div>;
|
||||
} else if (this.state.error) {
|
||||
content = <div className="mx_MyGroups_error">
|
||||
{_t('Error whilst fetching joined groups')}
|
||||
</div>;
|
||||
} else {
|
||||
content = <Loader />;
|
||||
}
|
||||
|
||||
return <div className="mx_MyGroups">
|
||||
<SimpleRoomHeader title={ _t("Groups") } />
|
||||
<div className='mx_MyGroups_joinCreateBox'>
|
||||
<div className="mx_MyGroups_createBox">
|
||||
<div className="mx_MyGroups_joinCreateHeader">
|
||||
{_t('Create a new group')}
|
||||
</div>
|
||||
<AccessibleButton className='mx_MyGroups_joinCreateButton' onClick={this._onCreateGroupClick}>
|
||||
<TintableSvg src="img/icons-create-room.svg" width="50" height="50" />
|
||||
</AccessibleButton>
|
||||
{_t(
|
||||
'Create a group to represent your community! '+
|
||||
'Define a set of rooms and your own custom homepage '+
|
||||
'to mark out your space in the Matrix universe.',
|
||||
)}
|
||||
</div>
|
||||
<div className="mx_MyGroups_joinBox">
|
||||
<div className="mx_MyGroups_joinCreateHeader">
|
||||
{_t('Join an existing group')}
|
||||
</div>
|
||||
<AccessibleButton className='mx_MyGroups_joinCreateButton' onClick={this._onJoinGroupClick}>
|
||||
<TintableSvg src="img/icons-create-room.svg" width="50" height="50" />
|
||||
</AccessibleButton>
|
||||
{_tJsx(
|
||||
'To join an exisitng group you\'ll have to '+
|
||||
'know its group identifier; this will look '+
|
||||
'something like <i>+example:matrix.org</i>.',
|
||||
/<i>(.*)<\/i>/,
|
||||
(sub) => <i>{sub}</i>,
|
||||
)}
|
||||
</div>
|
||||
</div>
|
||||
<div className="mx_MyGroups_content">
|
||||
{content}
|
||||
</div>
|
||||
</div>;
|
||||
},
|
||||
}));
|
||||
@@ -16,7 +16,7 @@ limitations under the License.
|
||||
|
||||
var React = require('react');
|
||||
var ReactDOM = require("react-dom");
|
||||
|
||||
import { _t } from '../../languageHandler';
|
||||
var Matrix = require("matrix-js-sdk");
|
||||
var sdk = require('../../index');
|
||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||
@@ -37,7 +37,6 @@ var NotificationPanel = React.createClass({
|
||||
var Loader = sdk.getComponent("elements.Spinner");
|
||||
|
||||
var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
|
||||
|
||||
if (timelineSet) {
|
||||
return (
|
||||
<TimelinePanel key={"NotificationPanel_" + this.props.roomId}
|
||||
@@ -48,7 +47,7 @@ var NotificationPanel = React.createClass({
|
||||
showUrlPreview = { false }
|
||||
opacity={ this.props.opacity }
|
||||
tileShape="notif"
|
||||
empty="You have no visible notifications"
|
||||
empty={ _t('You have no visible notifications') }
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -14,12 +14,12 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
var React = require('react');
|
||||
var sdk = require('../../index');
|
||||
var dis = require("../../dispatcher");
|
||||
var WhoIsTyping = require("../../WhoIsTyping");
|
||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||
const MemberAvatar = require("../views/avatars/MemberAvatar");
|
||||
import React from 'react';
|
||||
import { _t, _tJsx } from '../../languageHandler';
|
||||
import sdk from '../../index';
|
||||
import WhoIsTyping from '../../WhoIsTyping';
|
||||
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||
import MemberAvatar from '../views/avatars/MemberAvatar';
|
||||
|
||||
const HIDE_DEBOUNCE_MS = 10000;
|
||||
const STATUS_BAR_HIDDEN = 0;
|
||||
@@ -175,8 +175,8 @@ module.exports = React.createClass({
|
||||
<div className="mx_RoomStatusBar_scrollDownIndicator"
|
||||
onClick={ this.props.onScrollToBottomClick }>
|
||||
<img src="img/scrolldown.svg" width="24" height="24"
|
||||
alt="Scroll to bottom of page"
|
||||
title="Scroll to bottom of page"/>
|
||||
alt={ _t("Scroll to bottom of page") }
|
||||
title={ _t("Scroll to bottom of page") }/>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
@@ -250,10 +250,10 @@ module.exports = React.createClass({
|
||||
<div className="mx_RoomStatusBar_connectionLostBar">
|
||||
<img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
|
||||
<div className="mx_RoomStatusBar_connectionLostBar_title">
|
||||
Connectivity to the server has been lost.
|
||||
{_t('Connectivity to the server has been lost.')}
|
||||
</div>
|
||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||
Sent messages will be stored until your connection has returned.
|
||||
{_t('Sent messages will be stored until your connection has returned.')}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
@@ -266,7 +266,7 @@ module.exports = React.createClass({
|
||||
<TabCompleteBar tabComplete={this.props.tabComplete} />
|
||||
<div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
|
||||
<TintableSvg src="img/eol.svg" width="22" height="16"/>
|
||||
Auto-complete
|
||||
{_t('Auto-complete')}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
@@ -281,15 +281,13 @@ module.exports = React.createClass({
|
||||
{ this.props.unsentMessageError }
|
||||
</div>
|
||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||
<a className="mx_RoomStatusBar_resend_link"
|
||||
onClick={ this.props.onResendAllClick }>
|
||||
Resend all
|
||||
</a> or <a
|
||||
className="mx_RoomStatusBar_resend_link"
|
||||
onClick={ this.props.onCancelAllClick }>
|
||||
cancel all
|
||||
</a> now. You can also select individual messages to
|
||||
resend or cancel.
|
||||
{_tJsx("<a>Resend all</a> or <a>cancel all</a> now. You can also select individual messages to resend or cancel.",
|
||||
[/<a>(.*?)<\/a>/, /<a>(.*?)<\/a>/],
|
||||
[
|
||||
(sub) => <a className="mx_RoomStatusBar_resend_link" key="resend" onClick={ this.props.onResendAllClick }>{sub}</a>,
|
||||
(sub) => <a className="mx_RoomStatusBar_resend_link" key="cancel" onClick={ this.props.onCancelAllClick }>{sub}</a>,
|
||||
]
|
||||
)}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
@@ -298,8 +296,8 @@ module.exports = React.createClass({
|
||||
// unread count trumps who is typing since the unread count is only
|
||||
// set when you've scrolled up
|
||||
if (this.props.numUnreadMessages) {
|
||||
var unreadMsgs = this.props.numUnreadMessages + " new message" +
|
||||
(this.props.numUnreadMessages > 1 ? "s" : "");
|
||||
// MUST use var name "count" for pluralization to kick in
|
||||
var unreadMsgs = _t("%(count)s new messages", {count: this.props.numUnreadMessages});
|
||||
|
||||
return (
|
||||
<div className="mx_RoomStatusBar_unreadMessagesBar"
|
||||
@@ -324,7 +322,7 @@ module.exports = React.createClass({
|
||||
if (this.props.hasActiveCall) {
|
||||
return (
|
||||
<div className="mx_RoomStatusBar_callBar">
|
||||
<b>Active call</b>
|
||||
<b>{_t('Active call')}</b>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -46,9 +46,13 @@ if (DEBUG_SCROLL) {
|
||||
* It also provides a hook which allows parents to provide more list elements
|
||||
* when we get close to the start or end of the list.
|
||||
*
|
||||
* Each child element should have a 'data-scroll-token'. This token is used to
|
||||
* serialise the scroll state, and returned as the 'trackedScrollToken'
|
||||
* attribute by getScrollState().
|
||||
* Each child element should have a 'data-scroll-tokens'. This string of
|
||||
* comma-separated tokens may contain a single token or many, where many indicates
|
||||
* that the element contains elements that have scroll tokens themselves. The first
|
||||
* token in 'data-scroll-tokens' is used to serialise the scroll state, and returned
|
||||
* as the 'trackedScrollToken' attribute by getScrollState().
|
||||
*
|
||||
* IMPORTANT: INDIVIDUAL TOKENS WITHIN 'data-scroll-tokens' MUST NOT CONTAIN COMMAS.
|
||||
*
|
||||
* Some notes about the implementation:
|
||||
*
|
||||
@@ -348,13 +352,14 @@ module.exports = React.createClass({
|
||||
const tile = tiles[backwards ? i : tiles.length - 1 - i];
|
||||
// Subtract height of tile as if it were unpaginated
|
||||
excessHeight -= tile.clientHeight;
|
||||
// The tile may not have a scroll token, so guard it
|
||||
if (tile.dataset.scrollToken) {
|
||||
markerScrollToken = tile.dataset.scrollToken;
|
||||
}
|
||||
//If removing the tile would lead to future pagination, break before setting scroll token
|
||||
if (tile.clientHeight > excessHeight) {
|
||||
break;
|
||||
}
|
||||
// The tile may not have a scroll token, so guard it
|
||||
if (tile.dataset.scrollTokens) {
|
||||
markerScrollToken = tile.dataset.scrollTokens.split(',')[0];
|
||||
}
|
||||
}
|
||||
|
||||
if (markerScrollToken) {
|
||||
@@ -419,7 +424,8 @@ module.exports = React.createClass({
|
||||
* scroll. false if we are tracking a particular child.
|
||||
*
|
||||
* string trackedScrollToken: undefined if stuckAtBottom is true; if it is
|
||||
* false, the data-scroll-token of the child which we are tracking.
|
||||
* false, the first token in data-scroll-tokens of the child which we are
|
||||
* tracking.
|
||||
*
|
||||
* number pixelOffset: undefined if stuckAtBottom is true; if it is false,
|
||||
* the number of pixels the bottom of the tracked child is above the
|
||||
@@ -483,21 +489,25 @@ module.exports = React.createClass({
|
||||
handleScrollKey: function(ev) {
|
||||
switch (ev.keyCode) {
|
||||
case KeyCode.PAGE_UP:
|
||||
this.scrollRelative(-1);
|
||||
if (!ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this.scrollRelative(-1);
|
||||
}
|
||||
break;
|
||||
|
||||
case KeyCode.PAGE_DOWN:
|
||||
this.scrollRelative(1);
|
||||
if (!ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this.scrollRelative(1);
|
||||
}
|
||||
break;
|
||||
|
||||
case KeyCode.HOME:
|
||||
if (ev.ctrlKey) {
|
||||
if (ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this.scrollToTop();
|
||||
}
|
||||
break;
|
||||
|
||||
case KeyCode.END:
|
||||
if (ev.ctrlKey) {
|
||||
if (ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey) {
|
||||
this.scrollToBottom();
|
||||
}
|
||||
break;
|
||||
@@ -547,8 +557,10 @@ module.exports = React.createClass({
|
||||
var messages = this.refs.itemlist.children;
|
||||
for (var i = messages.length-1; i >= 0; --i) {
|
||||
var m = messages[i];
|
||||
if (!m.dataset.scrollToken) continue;
|
||||
if (m.dataset.scrollToken == scrollToken) {
|
||||
// 'data-scroll-tokens' is a DOMString of comma-separated scroll tokens
|
||||
// There might only be one scroll token
|
||||
if (m.dataset.scrollTokens &&
|
||||
m.dataset.scrollTokens.split(',').indexOf(scrollToken) !== -1) {
|
||||
node = m;
|
||||
break;
|
||||
}
|
||||
@@ -564,7 +576,7 @@ module.exports = React.createClass({
|
||||
var boundingRect = node.getBoundingClientRect();
|
||||
var scrollDelta = boundingRect.bottom + pixelOffset - wrapperRect.bottom;
|
||||
|
||||
debuglog("ScrollPanel: scrolling to token '" + node.dataset.scrollToken + "'+" +
|
||||
debuglog("ScrollPanel: scrolling to token '" + scrollToken + "'+" +
|
||||
pixelOffset + " (delta: "+scrollDelta+")");
|
||||
|
||||
if(scrollDelta != 0) {
|
||||
@@ -587,12 +599,12 @@ module.exports = React.createClass({
|
||||
|
||||
for (var i = messages.length-1; i >= 0; --i) {
|
||||
var node = messages[i];
|
||||
if (!node.dataset.scrollToken) continue;
|
||||
if (!node.dataset.scrollTokens) continue;
|
||||
|
||||
var boundingRect = node.getBoundingClientRect();
|
||||
newScrollState = {
|
||||
stuckAtBottom: false,
|
||||
trackedScrollToken: node.dataset.scrollToken,
|
||||
trackedScrollToken: node.dataset.scrollTokens.split(',')[0],
|
||||
pixelOffset: wrapperRect.bottom - boundingRect.bottom,
|
||||
};
|
||||
// If the bottom of the panel intersects the ClientRect of node, use this node
|
||||
@@ -604,7 +616,7 @@ module.exports = React.createClass({
|
||||
break;
|
||||
}
|
||||
}
|
||||
// This is only false if there were no nodes with `node.dataset.scrollToken` set.
|
||||
// This is only false if there were no nodes with `node.dataset.scrollTokens` set.
|
||||
if (newScrollState) {
|
||||
this.scrollState = newScrollState;
|
||||
debuglog("ScrollPanel: saved scroll state", this.scrollState);
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
@@ -22,12 +23,14 @@ var Matrix = require("matrix-js-sdk");
|
||||
var EventTimeline = Matrix.EventTimeline;
|
||||
|
||||
var sdk = require('../../index');
|
||||
import { _t } from '../../languageHandler';
|
||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||
var dis = require("../../dispatcher");
|
||||
var ObjectUtils = require('../../ObjectUtils');
|
||||
var Modal = require("../../Modal");
|
||||
var UserActivity = require("../../UserActivity");
|
||||
var KeyCode = require('../../KeyCode');
|
||||
import UserSettingsStore from '../../UserSettingsStore';
|
||||
|
||||
var PAGINATE_SIZE = 20;
|
||||
var INITIAL_SIZE = 20;
|
||||
@@ -102,9 +105,6 @@ var TimelinePanel = React.createClass({
|
||||
},
|
||||
|
||||
statics: {
|
||||
// a map from room id to read marker event ID
|
||||
roomReadMarkerMap: {},
|
||||
|
||||
// a map from room id to read marker event timestamp
|
||||
roomReadMarkerTsMap: {},
|
||||
},
|
||||
@@ -121,12 +121,18 @@ var TimelinePanel = React.createClass({
|
||||
getInitialState: function() {
|
||||
// XXX: we could track RM per TimelineSet rather than per Room.
|
||||
// but for now we just do it per room for simplicity.
|
||||
let initialReadMarker = null;
|
||||
if (this.props.manageReadMarkers) {
|
||||
var initialReadMarker =
|
||||
TimelinePanel.roomReadMarkerMap[this.props.timelineSet.room.roomId]
|
||||
|| this._getCurrentReadReceipt();
|
||||
const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
|
||||
if (readmarker) {
|
||||
initialReadMarker = readmarker.getContent().event_id;
|
||||
} else {
|
||||
initialReadMarker = this._getCurrentReadReceipt();
|
||||
}
|
||||
}
|
||||
|
||||
const syncedSettings = UserSettingsStore.getSyncedSettings();
|
||||
|
||||
return {
|
||||
events: [],
|
||||
timelineLoading: true, // track whether our room timeline is loading
|
||||
@@ -166,13 +172,26 @@ var TimelinePanel = React.createClass({
|
||||
|
||||
backPaginating: false,
|
||||
forwardPaginating: false,
|
||||
|
||||
// cache of matrixClient.getSyncState() (but from the 'sync' event)
|
||||
clientSyncState: MatrixClientPeg.get().getSyncState(),
|
||||
|
||||
// should the event tiles have twelve hour times
|
||||
isTwelveHour: syncedSettings.showTwelveHourTimestamps,
|
||||
|
||||
// always show timestamps on event tiles?
|
||||
alwaysShowTimestamps: syncedSettings.alwaysShowTimestamps,
|
||||
|
||||
// hide redacted events as per old behaviour
|
||||
hideRedactions: syncedSettings.hideRedactions,
|
||||
};
|
||||
},
|
||||
|
||||
componentWillMount: function() {
|
||||
debuglog("TimelinePanel: mounting");
|
||||
|
||||
this.last_rr_sent_event_id = undefined;
|
||||
this.lastRRSentEventId = undefined;
|
||||
this.lastRMSentEventId = undefined;
|
||||
|
||||
this.dispatcherRef = dis.register(this.onAction);
|
||||
MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
|
||||
@@ -180,6 +199,8 @@ var TimelinePanel = React.createClass({
|
||||
MatrixClientPeg.get().on("Room.redaction", this.onRoomRedaction);
|
||||
MatrixClientPeg.get().on("Room.receipt", this.onRoomReceipt);
|
||||
MatrixClientPeg.get().on("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
||||
MatrixClientPeg.get().on("Room.accountData", this.onAccountData);
|
||||
MatrixClientPeg.get().on("sync", this.onSync);
|
||||
|
||||
this._initTimeline(this.props);
|
||||
},
|
||||
@@ -247,6 +268,8 @@ var TimelinePanel = React.createClass({
|
||||
client.removeListener("Room.redaction", this.onRoomRedaction);
|
||||
client.removeListener("Room.receipt", this.onRoomReceipt);
|
||||
client.removeListener("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
||||
client.removeListener("Room.accountData", this.onAccountData);
|
||||
client.removeListener("sync", this.onSync);
|
||||
}
|
||||
},
|
||||
|
||||
@@ -414,6 +437,7 @@ var TimelinePanel = React.createClass({
|
||||
} else if(lastEv && this.getReadMarkerPosition() === 0) {
|
||||
// we know we're stuckAtBottom, so we can advance the RM
|
||||
// immediately, to save a later render cycle
|
||||
|
||||
this._setReadMarker(lastEv.getId(), lastEv.getTs(), true);
|
||||
updatedState.readMarkerVisible = false;
|
||||
updatedState.readMarkerEventId = lastEv.getId();
|
||||
@@ -466,6 +490,25 @@ var TimelinePanel = React.createClass({
|
||||
this._reloadEvents();
|
||||
},
|
||||
|
||||
onAccountData: function(ev, room) {
|
||||
if (this.unmounted) return;
|
||||
|
||||
// ignore events for other rooms
|
||||
if (room !== this.props.timelineSet.room) return;
|
||||
|
||||
if (ev.getType() !== "m.fully_read") return;
|
||||
|
||||
// XXX: roomReadMarkerTsMap not updated here so it is now inconsistent. Replace
|
||||
// this mechanism of determining where the RM is relative to the view-port with
|
||||
// one supported by the server (the client needs more than an event ID).
|
||||
this.setState({
|
||||
readMarkerEventId: ev.getContent().event_id,
|
||||
}, this.props.onReadMarkerUpdated);
|
||||
},
|
||||
|
||||
onSync: function(state, prevState, data) {
|
||||
this.setState({clientSyncState: state});
|
||||
},
|
||||
|
||||
sendReadReceipt: function() {
|
||||
if (!this.refs.messagePanel) return;
|
||||
@@ -473,11 +516,14 @@ var TimelinePanel = React.createClass({
|
||||
// This happens on user_activity_end which is delayed, and it's
|
||||
// very possible have logged out within that timeframe, so check
|
||||
// we still have a client.
|
||||
if (!MatrixClientPeg.get()) return;
|
||||
const cli = MatrixClientPeg.get();
|
||||
// if no client or client is guest don't send RR or RM
|
||||
if (!cli || cli.isGuest()) return;
|
||||
|
||||
var currentReadUpToEventId = this._getCurrentReadReceipt(true);
|
||||
var currentReadUpToEventIndex = this._indexForEventId(currentReadUpToEventId);
|
||||
let shouldSendRR = true;
|
||||
|
||||
const currentRREventId = this._getCurrentReadReceipt(true);
|
||||
const currentRREventIndex = this._indexForEventId(currentRREventId);
|
||||
// We want to avoid sending out read receipts when we are looking at
|
||||
// events in the past which are before the latest RR.
|
||||
//
|
||||
@@ -491,26 +537,60 @@ var TimelinePanel = React.createClass({
|
||||
// RRs) - but that is a bit of a niche case. It will sort itself out when
|
||||
// the user eventually hits the live timeline.
|
||||
//
|
||||
if (currentReadUpToEventId && currentReadUpToEventIndex === null &&
|
||||
if (currentRREventId && currentRREventIndex === null &&
|
||||
this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
|
||||
return;
|
||||
shouldSendRR = false;
|
||||
}
|
||||
|
||||
var lastReadEventIndex = this._getLastDisplayedEventIndex({
|
||||
ignoreOwn: true
|
||||
const lastReadEventIndex = this._getLastDisplayedEventIndex({
|
||||
ignoreOwn: true,
|
||||
});
|
||||
if (lastReadEventIndex === null) return;
|
||||
if (lastReadEventIndex === null) {
|
||||
shouldSendRR = false;
|
||||
}
|
||||
let lastReadEvent = this.state.events[lastReadEventIndex];
|
||||
shouldSendRR = shouldSendRR &&
|
||||
// Only send a RR if the last read event is ahead in the timeline relative to
|
||||
// the current RR event.
|
||||
lastReadEventIndex > currentRREventIndex &&
|
||||
// Only send a RR if the last RR set != the one we would send
|
||||
this.lastRRSentEventId != lastReadEvent.getId();
|
||||
|
||||
var lastReadEvent = this.state.events[lastReadEventIndex];
|
||||
// Only send a RM if the last RM sent != the one we would send
|
||||
const shouldSendRM =
|
||||
this.lastRMSentEventId != this.state.readMarkerEventId;
|
||||
|
||||
// we also remember the last read receipt we sent to avoid spamming the
|
||||
// same one at the server repeatedly
|
||||
if (lastReadEventIndex > currentReadUpToEventIndex
|
||||
&& this.last_rr_sent_event_id != lastReadEvent.getId()) {
|
||||
this.last_rr_sent_event_id = lastReadEvent.getId();
|
||||
MatrixClientPeg.get().sendReadReceipt(lastReadEvent).catch(() => {
|
||||
if (shouldSendRR || shouldSendRM) {
|
||||
if (shouldSendRR) {
|
||||
this.lastRRSentEventId = lastReadEvent.getId();
|
||||
} else {
|
||||
lastReadEvent = null;
|
||||
}
|
||||
this.lastRMSentEventId = this.state.readMarkerEventId;
|
||||
|
||||
debuglog('TimelinePanel: Sending Read Markers for ',
|
||||
this.props.timelineSet.room.roomId,
|
||||
'rm', this.state.readMarkerEventId,
|
||||
lastReadEvent ? 'rr ' + lastReadEvent.getId() : '',
|
||||
);
|
||||
MatrixClientPeg.get().setRoomReadMarkers(
|
||||
this.props.timelineSet.room.roomId,
|
||||
this.state.readMarkerEventId,
|
||||
lastReadEvent, // Could be null, in which case no RR is sent
|
||||
).catch((e) => {
|
||||
// /read_markers API is not implemented on this HS, fallback to just RR
|
||||
if (e.errcode === 'M_UNRECOGNIZED' && lastReadEvent) {
|
||||
return MatrixClientPeg.get().sendReadReceipt(
|
||||
lastReadEvent,
|
||||
).catch(() => {
|
||||
this.lastRRSentEventId = undefined;
|
||||
});
|
||||
}
|
||||
// it failed, so allow retries next time the user is active
|
||||
this.last_rr_sent_event_id = undefined;
|
||||
this.lastRRSentEventId = undefined;
|
||||
this.lastRMSentEventId = undefined;
|
||||
});
|
||||
|
||||
// do a quick-reset of our unreadNotificationCount to avoid having
|
||||
@@ -706,7 +786,7 @@ var TimelinePanel = React.createClass({
|
||||
|
||||
// the messagePanel doesn't know where the read marker is.
|
||||
// if we know the timestamp of the read marker, make a guess based on that.
|
||||
var rmTs = TimelinePanel.roomReadMarkerTsMap[this.props.timelineSet.roomId];
|
||||
const rmTs = TimelinePanel.roomReadMarkerTsMap[this.props.timelineSet.room.roomId];
|
||||
if (rmTs && this.state.events.length > 0) {
|
||||
if (rmTs < this.state.events[0].getTs()) {
|
||||
return -1;
|
||||
@@ -718,6 +798,19 @@ var TimelinePanel = React.createClass({
|
||||
return null;
|
||||
},
|
||||
|
||||
canJumpToReadMarker: function() {
|
||||
// 1. Do not show jump bar if neither the RM nor the RR are set.
|
||||
// 2. Only show jump bar if RR !== RM. If they are the same, there are only fully
|
||||
// read messages and unread messages. We already have a badge count and the bottom
|
||||
// bar to jump to "live" when we have unread messages.
|
||||
// 3. We want to show the bar if the read-marker is off the top of the screen.
|
||||
// 4. Also, if pos === null, the event might not be paginated - show the unread bar
|
||||
const pos = this.getReadMarkerPosition();
|
||||
return this.state.readMarkerEventId !== null && // 1.
|
||||
this.state.readMarkerEventId !== this._getCurrentReadReceipt() && // 2.
|
||||
(pos < 0 || pos === null); // 3., 4.
|
||||
},
|
||||
|
||||
/**
|
||||
* called by the parent component when PageUp/Down/etc is pressed.
|
||||
*
|
||||
@@ -728,7 +821,9 @@ var TimelinePanel = React.createClass({
|
||||
|
||||
// jump to the live timeline on ctrl-end, rather than the end of the
|
||||
// timeline window.
|
||||
if (ev.ctrlKey && ev.keyCode == KeyCode.END) {
|
||||
if (ev.ctrlKey && !ev.shiftKey && !ev.altKey && !ev.metaKey &&
|
||||
ev.keyCode == KeyCode.END)
|
||||
{
|
||||
this.jumpToLiveTimeline();
|
||||
} else {
|
||||
this.refs.messagePanel.handleScrollKey(ev);
|
||||
@@ -807,6 +902,9 @@ var TimelinePanel = React.createClass({
|
||||
|
||||
var onError = (error) => {
|
||||
this.setState({timelineLoading: false});
|
||||
console.error(
|
||||
`Error loading timeline panel at ${eventId}: ${error}`,
|
||||
);
|
||||
var msg = error.message ? error.message : JSON.stringify(error);
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
|
||||
@@ -825,14 +923,11 @@ var TimelinePanel = React.createClass({
|
||||
});
|
||||
};
|
||||
}
|
||||
var message = "Tried to load a specific point in this room's timeline, but ";
|
||||
if (error.errcode == 'M_FORBIDDEN') {
|
||||
message += "you do not have permission to view the message in question.";
|
||||
} else {
|
||||
message += "was unable to find it.";
|
||||
}
|
||||
var message = (error.errcode == 'M_FORBIDDEN')
|
||||
? _t("Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question.")
|
||||
: _t("Tried to load a specific point in this room's timeline, but was unable to find it.");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Failed to load timeline position",
|
||||
title: _t("Failed to load timeline position"),
|
||||
description: message,
|
||||
onFinished: onFinished,
|
||||
});
|
||||
@@ -956,16 +1051,12 @@ var TimelinePanel = React.createClass({
|
||||
_setReadMarker: function(eventId, eventTs, inhibitSetState) {
|
||||
var roomId = this.props.timelineSet.room.roomId;
|
||||
|
||||
if (TimelinePanel.roomReadMarkerMap[roomId] == eventId) {
|
||||
// don't update the state (and cause a re-render) if there is
|
||||
// no change to the RM.
|
||||
// don't update the state (and cause a re-render) if there is
|
||||
// no change to the RM.
|
||||
if (eventId === this.state.readMarkerEventId) {
|
||||
return;
|
||||
}
|
||||
|
||||
// ideally we'd sync these via the server, but for now just stash them
|
||||
// in a map.
|
||||
TimelinePanel.roomReadMarkerMap[roomId] = eventId;
|
||||
|
||||
// in order to later figure out if the read marker is
|
||||
// above or below the visible timeline, we stash the timestamp.
|
||||
TimelinePanel.roomReadMarkerTsMap[roomId] = eventTs;
|
||||
@@ -974,6 +1065,7 @@ var TimelinePanel = React.createClass({
|
||||
return;
|
||||
}
|
||||
|
||||
// Do the local echo of the RM
|
||||
// run the render cycle before calling the callback, so that
|
||||
// getReadMarkerPosition() returns the right thing.
|
||||
this.setState({
|
||||
@@ -1022,26 +1114,34 @@ var TimelinePanel = React.createClass({
|
||||
// of paginating our way through the entire history of the room.
|
||||
var stickyBottom = !this._timelineWindow.canPaginate(EventTimeline.FORWARDS);
|
||||
|
||||
// If the state is PREPARED, we're still waiting for the js-sdk to sync with
|
||||
// the HS and fetch the latest events, so we are effectively forward paginating.
|
||||
const forwardPaginating = (
|
||||
this.state.forwardPaginating || this.state.clientSyncState == 'PREPARED'
|
||||
);
|
||||
return (
|
||||
<MessagePanel ref="messagePanel"
|
||||
hidden={ this.props.hidden }
|
||||
backPaginating={ this.state.backPaginating }
|
||||
forwardPaginating={ this.state.forwardPaginating }
|
||||
events={ this.state.events }
|
||||
highlightedEventId={ this.props.highlightedEventId }
|
||||
readMarkerEventId={ this.state.readMarkerEventId }
|
||||
readMarkerVisible={ this.state.readMarkerVisible }
|
||||
suppressFirstDateSeparator={ this.state.canBackPaginate }
|
||||
showUrlPreview = { this.props.showUrlPreview }
|
||||
manageReadReceipts = { this.props.manageReadReceipts }
|
||||
ourUserId={ MatrixClientPeg.get().credentials.userId }
|
||||
stickyBottom={ stickyBottom }
|
||||
onScroll={ this.onMessageListScroll }
|
||||
onFillRequest={ this.onMessageListFillRequest }
|
||||
onUnfillRequest={ this.onMessageListUnfillRequest }
|
||||
opacity={ this.props.opacity }
|
||||
className={ this.props.className }
|
||||
tileShape={ this.props.tileShape }
|
||||
hidden={ this.props.hidden }
|
||||
hideRedactions={ this.state.hideRedactions }
|
||||
backPaginating={ this.state.backPaginating }
|
||||
forwardPaginating={ forwardPaginating }
|
||||
events={ this.state.events }
|
||||
highlightedEventId={ this.props.highlightedEventId }
|
||||
readMarkerEventId={ this.state.readMarkerEventId }
|
||||
readMarkerVisible={ this.state.readMarkerVisible }
|
||||
suppressFirstDateSeparator={ this.state.canBackPaginate }
|
||||
showUrlPreview = { this.props.showUrlPreview }
|
||||
manageReadReceipts = { this.props.manageReadReceipts }
|
||||
ourUserId={ MatrixClientPeg.get().credentials.userId }
|
||||
stickyBottom={ stickyBottom }
|
||||
onScroll={ this.onMessageListScroll }
|
||||
onFillRequest={ this.onMessageListFillRequest }
|
||||
onUnfillRequest={ this.onMessageListUnfillRequest }
|
||||
opacity={ this.props.opacity }
|
||||
isTwelveHour={ this.state.isTwelveHour }
|
||||
alwaysShowTimestamps={ this.state.alwaysShowTimestamps }
|
||||
className={ this.props.className }
|
||||
tileShape={ this.props.tileShape }
|
||||
/>
|
||||
);
|
||||
},
|
||||
|
||||
@@ -18,6 +18,7 @@ var React = require('react');
|
||||
var ContentMessages = require('../../ContentMessages');
|
||||
var dis = require('../../dispatcher');
|
||||
var filesize = require('filesize');
|
||||
import { _t } from '../../languageHandler';
|
||||
|
||||
module.exports = React.createClass({displayName: 'UploadBar',
|
||||
propTypes: {
|
||||
@@ -81,10 +82,8 @@ module.exports = React.createClass({displayName: 'UploadBar',
|
||||
uploadedSize = uploadedSize.replace(/ .*/, '');
|
||||
}
|
||||
|
||||
var others;
|
||||
if (uploads.length > 1) {
|
||||
others = ' and ' + (uploads.length - 1) + ' other' + (uploads.length > 2 ? 's' : '');
|
||||
}
|
||||
// MUST use var name 'count' for pluralization to kick in
|
||||
var uploadText = _t("Uploading %(filename)s and %(count)s others", {filename: upload.fileName, count: (uploads.length - 1)});
|
||||
|
||||
return (
|
||||
<div className="mx_UploadBar">
|
||||
@@ -98,7 +97,7 @@ module.exports = React.createClass({displayName: 'UploadBar',
|
||||
<div className="mx_UploadBar_uploadBytes">
|
||||
{ uploadedSize } / { totalSize }
|
||||
</div>
|
||||
<div className="mx_UploadBar_uploadFilename">Uploading {upload.fileName}{others}</div>
|
||||
<div className="mx_UploadBar_uploadFilename">{uploadText}</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -17,6 +17,7 @@ limitations under the License.
|
||||
'use strict';
|
||||
|
||||
var React = require('react');
|
||||
import { _t } from '../../../languageHandler';
|
||||
var sdk = require('../../../index');
|
||||
var Modal = require("../../../Modal");
|
||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||
@@ -54,7 +55,7 @@ module.exports = React.createClass({
|
||||
progress: "sent_email"
|
||||
});
|
||||
}, (err) => {
|
||||
this.showErrorDialog("Failed to send email: " + err.message);
|
||||
this.showErrorDialog(_t('Failed to send email') + ": " + err.message);
|
||||
this.setState({
|
||||
progress: null
|
||||
});
|
||||
@@ -78,30 +79,33 @@ module.exports = React.createClass({
|
||||
ev.preventDefault();
|
||||
|
||||
if (!this.state.email) {
|
||||
this.showErrorDialog("The email address linked to your account must be entered.");
|
||||
this.showErrorDialog(_t('The email address linked to your account must be entered.'));
|
||||
}
|
||||
else if (!this.state.password || !this.state.password2) {
|
||||
this.showErrorDialog("A new password must be entered.");
|
||||
this.showErrorDialog(_t('A new password must be entered.'));
|
||||
}
|
||||
else if (this.state.password !== this.state.password2) {
|
||||
this.showErrorDialog("New passwords must match each other.");
|
||||
this.showErrorDialog(_t('New passwords must match each other.'));
|
||||
}
|
||||
else {
|
||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
Modal.createDialog(QuestionDialog, {
|
||||
title: "Warning",
|
||||
title: _t('Warning!'),
|
||||
description:
|
||||
<div>
|
||||
Resetting password will currently reset any end-to-end encryption keys on all devices,
|
||||
making encrypted chat history unreadable, unless you first export your room keys
|
||||
and re-import them afterwards.
|
||||
In future this <a href="https://github.com/vector-im/riot-web/issues/2671">will be improved</a>.
|
||||
{ _t(
|
||||
'Resetting password will currently reset any ' +
|
||||
'end-to-end encryption keys on all devices, ' +
|
||||
'making encrypted chat history unreadable, ' +
|
||||
'unless you first export your room keys and re-import ' +
|
||||
'them afterwards. In future this will be improved.'
|
||||
) }
|
||||
</div>,
|
||||
button: "Continue",
|
||||
button: _t('Continue'),
|
||||
extraButtons: [
|
||||
<button className="mx_Dialog_primary"
|
||||
onClick={this._onExportE2eKeysClicked}>
|
||||
Export E2E room keys
|
||||
{ _t('Export E2E room keys') }
|
||||
</button>
|
||||
],
|
||||
onFinished: (confirmed) => {
|
||||
@@ -150,7 +154,7 @@ module.exports = React.createClass({
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: title,
|
||||
description: body
|
||||
description: body,
|
||||
});
|
||||
},
|
||||
|
||||
@@ -168,22 +172,20 @@ module.exports = React.createClass({
|
||||
else if (this.state.progress === "sent_email") {
|
||||
resetPasswordJsx = (
|
||||
<div>
|
||||
An email has been sent to {this.state.email}. Once you've followed
|
||||
the link it contains, click below.
|
||||
{ _t('An email has been sent to') } {this.state.email}. { _t('Once you've followed the link it contains, click below') }.
|
||||
<br />
|
||||
<input className="mx_Login_submit" type="button" onClick={this.onVerify}
|
||||
value="I have verified my email address" />
|
||||
value={ _t('I have verified my email address') } />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
else if (this.state.progress === "complete") {
|
||||
resetPasswordJsx = (
|
||||
<div>
|
||||
<p>Your password has been reset.</p>
|
||||
<p>You have been logged out of all devices and will no longer receive push notifications.
|
||||
To re-enable notifications, sign in again on each device.</p>
|
||||
<p>{ _t('Your password has been reset') }.</p>
|
||||
<p>{ _t('You have been logged out of all devices and will no longer receive push notifications. To re-enable notifications, sign in again on each device') }.</p>
|
||||
<input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
|
||||
value="Return to login screen" />
|
||||
value={ _t('Return to login screen') } />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
@@ -191,7 +193,7 @@ module.exports = React.createClass({
|
||||
resetPasswordJsx = (
|
||||
<div>
|
||||
<div className="mx_Login_prompt">
|
||||
To reset your password, enter the email address linked to your account:
|
||||
{ _t('To reset your password, enter the email address linked to your account') }:
|
||||
</div>
|
||||
<div>
|
||||
<form onSubmit={this.onSubmitForm}>
|
||||
@@ -199,21 +201,21 @@ module.exports = React.createClass({
|
||||
name="reset_email" // define a name so browser's password autofill gets less confused
|
||||
value={this.state.email}
|
||||
onChange={this.onInputChanged.bind(this, "email")}
|
||||
placeholder="Email address" autoFocus />
|
||||
placeholder={ _t('Email address') } autoFocus />
|
||||
<br />
|
||||
<input className="mx_Login_field" ref="pass" type="password"
|
||||
name="reset_password"
|
||||
value={this.state.password}
|
||||
onChange={this.onInputChanged.bind(this, "password")}
|
||||
placeholder="New password" />
|
||||
placeholder={ _t('New password') } />
|
||||
<br />
|
||||
<input className="mx_Login_field" ref="pass" type="password"
|
||||
name="reset_password_confirm"
|
||||
value={this.state.password2}
|
||||
onChange={this.onInputChanged.bind(this, "password2")}
|
||||
placeholder="Confirm your new password" />
|
||||
placeholder={ _t('Confirm your new password') } />
|
||||
<br />
|
||||
<input className="mx_Login_submit" type="submit" value="Send Reset Email" />
|
||||
<input className="mx_Login_submit" type="submit" value={ _t('Send Reset Email') } />
|
||||
</form>
|
||||
<ServerConfig ref="serverConfig"
|
||||
withToggleButton={true}
|
||||
@@ -227,10 +229,10 @@ module.exports = React.createClass({
|
||||
<div className="mx_Login_error">
|
||||
</div>
|
||||
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
||||
Return to login
|
||||
{_t('Return to login screen')}
|
||||
</a>
|
||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||
Create a new account
|
||||
{ _t('Create an account') }
|
||||
</a>
|
||||
<LoginFooter />
|
||||
</div>
|
||||
|
||||
@@ -17,13 +17,13 @@ limitations under the License.
|
||||
|
||||
'use strict';
|
||||
|
||||
var React = require('react');
|
||||
var ReactDOM = require('react-dom');
|
||||
var sdk = require('../../../index');
|
||||
var Login = require("../../../Login");
|
||||
var PasswordLogin = require("../../views/login/PasswordLogin");
|
||||
var CasLogin = require("../../views/login/CasLogin");
|
||||
var ServerConfig = require("../../views/login/ServerConfig");
|
||||
import React from 'react';
|
||||
import { _t, _tJsx } from '../../../languageHandler';
|
||||
import sdk from '../../../index';
|
||||
import Login from '../../../Login';
|
||||
|
||||
// For validating phone numbers without country codes
|
||||
const PHONE_NUMBER_REGEX = /^[0-9\(\)\-\s]*$/;
|
||||
|
||||
/**
|
||||
* A wire component which glues together login UI components and Login logic
|
||||
@@ -67,6 +67,7 @@ module.exports = React.createClass({
|
||||
username: "",
|
||||
phoneCountry: null,
|
||||
phoneNumber: "",
|
||||
currentFlow: "m.login.password",
|
||||
};
|
||||
},
|
||||
|
||||
@@ -86,7 +87,27 @@ module.exports = React.createClass({
|
||||
).then((data) => {
|
||||
this.props.onLoggedIn(data);
|
||||
}, (error) => {
|
||||
this._setStateFromError(error, true);
|
||||
let errorText;
|
||||
|
||||
// Some error strings only apply for logging in
|
||||
const usingEmail = username.indexOf("@") > 0;
|
||||
if (error.httpStatus == 400 && usingEmail) {
|
||||
errorText = _t('This Home Server does not support login using email address.');
|
||||
} else if (error.httpStatus === 401 || error.httpStatus === 403) {
|
||||
errorText = _t('Incorrect username and/or password.');
|
||||
} else {
|
||||
// other errors, not specific to doing a password login
|
||||
errorText = this._errorTextFromError(error);
|
||||
}
|
||||
|
||||
this.setState({
|
||||
errorText: errorText,
|
||||
// 401 would be the sensible status code for 'incorrect password'
|
||||
// but the login API gives a 403 https://matrix.org/jira/browse/SYN-744
|
||||
// mentions this (although the bug is for UI auth which is not this)
|
||||
// We treat both as an incorrect password
|
||||
loginIncorrect: error.httpStatus === 401 || error.httpStatus == 403,
|
||||
});
|
||||
}).finally(() => {
|
||||
this.setState({
|
||||
busy: false
|
||||
@@ -109,7 +130,16 @@ module.exports = React.createClass({
|
||||
this._loginLogic.loginAsGuest().then(function(data) {
|
||||
self.props.onLoggedIn(data);
|
||||
}, function(error) {
|
||||
self._setStateFromError(error, true);
|
||||
let errorText;
|
||||
if (error.httpStatus === 403) {
|
||||
errorText = _t("Guest access is disabled on this Home Server.");
|
||||
} else {
|
||||
errorText = self._errorTextFromError(error);
|
||||
}
|
||||
self.setState({
|
||||
errorText: errorText,
|
||||
loginIncorrect: false,
|
||||
});
|
||||
}).finally(function() {
|
||||
self.setState({
|
||||
busy: false
|
||||
@@ -126,26 +156,31 @@ module.exports = React.createClass({
|
||||
},
|
||||
|
||||
onPhoneNumberChanged: function(phoneNumber) {
|
||||
this.setState({ phoneNumber: phoneNumber });
|
||||
},
|
||||
// Validate the phone number entered
|
||||
if (!PHONE_NUMBER_REGEX.test(phoneNumber)) {
|
||||
this.setState({ errorText: _t('The phone number entered looks invalid') });
|
||||
return;
|
||||
}
|
||||
|
||||
onHsUrlChanged: function(newHsUrl) {
|
||||
var self = this;
|
||||
this.setState({
|
||||
enteredHomeserverUrl: newHsUrl,
|
||||
errorText: null, // reset err messages
|
||||
}, function() {
|
||||
self._initLoginLogic(newHsUrl);
|
||||
phoneNumber: phoneNumber,
|
||||
errorText: null,
|
||||
});
|
||||
},
|
||||
|
||||
onIsUrlChanged: function(newIsUrl) {
|
||||
onServerConfigChange: function(config) {
|
||||
var self = this;
|
||||
this.setState({
|
||||
enteredIdentityServerUrl: newIsUrl,
|
||||
let newState = {
|
||||
errorText: null, // reset err messages
|
||||
}, function() {
|
||||
self._initLoginLogic(null, newIsUrl);
|
||||
};
|
||||
if (config.hsUrl !== undefined) {
|
||||
newState.enteredHomeserverUrl = config.hsUrl;
|
||||
}
|
||||
if (config.isUrl !== undefined) {
|
||||
newState.enteredIdentityServerUrl = config.isUrl;
|
||||
}
|
||||
this.setState(newState, function() {
|
||||
self._initLoginLogic(config.hsUrl || null, config.isUrl);
|
||||
});
|
||||
},
|
||||
|
||||
@@ -161,66 +196,64 @@ module.exports = React.createClass({
|
||||
});
|
||||
this._loginLogic = loginLogic;
|
||||
|
||||
loginLogic.getFlows().then(function(flows) {
|
||||
// old behaviour was to always use the first flow without presenting
|
||||
// options. This works in most cases (we don't have a UI for multiple
|
||||
// logins so let's skip that for now).
|
||||
loginLogic.chooseFlow(0);
|
||||
}, function(err) {
|
||||
self._setStateFromError(err, false);
|
||||
}).finally(function() {
|
||||
self.setState({
|
||||
busy: false
|
||||
});
|
||||
});
|
||||
|
||||
this.setState({
|
||||
enteredHomeserverUrl: hsUrl,
|
||||
enteredIdentityServerUrl: isUrl,
|
||||
busy: true,
|
||||
loginIncorrect: false,
|
||||
});
|
||||
|
||||
loginLogic.getFlows().then(function(flows) {
|
||||
// old behaviour was to always use the first flow without presenting
|
||||
// options. This works in most cases (we don't have a UI for multiple
|
||||
// logins so let's skip that for now).
|
||||
loginLogic.chooseFlow(0);
|
||||
self.setState({
|
||||
currentFlow: self._getCurrentFlowStep(),
|
||||
});
|
||||
}, function(err) {
|
||||
self.setState({
|
||||
errorText: self._errorTextFromError(err),
|
||||
loginIncorrect: false,
|
||||
});
|
||||
}).finally(function() {
|
||||
self.setState({
|
||||
busy: false,
|
||||
});
|
||||
}).done();
|
||||
},
|
||||
|
||||
_getCurrentFlowStep: function() {
|
||||
return this._loginLogic ? this._loginLogic.getCurrentFlowStep() : null;
|
||||
},
|
||||
|
||||
_setStateFromError: function(err, isLoginAttempt) {
|
||||
this.setState({
|
||||
errorText: this._errorTextFromError(err),
|
||||
// https://matrix.org/jira/browse/SYN-744
|
||||
loginIncorrect: isLoginAttempt && (err.httpStatus == 401 || err.httpStatus == 403)
|
||||
});
|
||||
},
|
||||
|
||||
_errorTextFromError(err) {
|
||||
if (err.friendlyText) {
|
||||
return err.friendlyText;
|
||||
}
|
||||
|
||||
let errCode = err.errcode;
|
||||
if (!errCode && err.httpStatus) {
|
||||
errCode = "HTTP " + err.httpStatus;
|
||||
}
|
||||
|
||||
let errorText = "Error: Problem communicating with the given homeserver " +
|
||||
(errCode ? "(" + errCode + ")" : "");
|
||||
let errorText = _t("Error: Problem communicating with the given homeserver.") +
|
||||
(errCode ? " (" + errCode + ")" : "");
|
||||
|
||||
if (err.cors === 'rejected') {
|
||||
if (window.location.protocol === 'https:' &&
|
||||
(this.state.enteredHomeserverUrl.startsWith("http:") ||
|
||||
!this.state.enteredHomeserverUrl.startsWith("http")))
|
||||
{
|
||||
!this.state.enteredHomeserverUrl.startsWith("http"))
|
||||
) {
|
||||
errorText = <span>
|
||||
Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar.
|
||||
Either use HTTPS or <a href='https://www.google.com/search?&q=enable%20unsafe%20scripts'>enable unsafe scripts</a>
|
||||
{ _tJsx("Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar. " +
|
||||
"Either use HTTPS or <a>enable unsafe scripts</a>.",
|
||||
/<a>(.*?)<\/a>/,
|
||||
(sub) => { return <a href="https://www.google.com/search?&q=enable%20unsafe%20scripts">{ sub }</a>; }
|
||||
)}
|
||||
</span>;
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
errorText = <span>
|
||||
Can't connect to homeserver - please check your connectivity and ensure
|
||||
your <a href={ this.state.enteredHomeserverUrl }>homeserver's SSL certificate</a> is trusted.
|
||||
{ _tJsx("Can't connect to homeserver - please check your connectivity, ensure your <a>homeserver's SSL certificate</a> is trusted, and that a browser extension is not blocking requests.",
|
||||
/<a>(.*?)<\/a>/,
|
||||
(sub) => { return <a href={this.state.enteredHomeserverUrl}>{ sub }</a>; }
|
||||
)}
|
||||
</span>;
|
||||
}
|
||||
}
|
||||
@@ -231,6 +264,7 @@ module.exports = React.createClass({
|
||||
componentForStep: function(step) {
|
||||
switch (step) {
|
||||
case 'm.login.password':
|
||||
const PasswordLogin = sdk.getComponent('login.PasswordLogin');
|
||||
return (
|
||||
<PasswordLogin
|
||||
onSubmit={this.onPasswordLogin}
|
||||
@@ -245,6 +279,7 @@ module.exports = React.createClass({
|
||||
/>
|
||||
);
|
||||
case 'm.login.cas':
|
||||
const CasLogin = sdk.getComponent('login.CasLogin');
|
||||
return (
|
||||
<CasLogin onSubmit={this.onCasLogin} />
|
||||
);
|
||||
@@ -254,24 +289,24 @@ module.exports = React.createClass({
|
||||
}
|
||||
return (
|
||||
<div>
|
||||
Sorry, this homeserver is using a login which is not
|
||||
recognised ({step})
|
||||
{ _t('Sorry, this homeserver is using a login which is not recognised ')}({step})
|
||||
</div>
|
||||
);
|
||||
}
|
||||
},
|
||||
|
||||
render: function() {
|
||||
var Loader = sdk.getComponent("elements.Spinner");
|
||||
var LoginHeader = sdk.getComponent("login.LoginHeader");
|
||||
var LoginFooter = sdk.getComponent("login.LoginFooter");
|
||||
var loader = this.state.busy ? <div className="mx_Login_loader"><Loader /></div> : null;
|
||||
const Loader = sdk.getComponent("elements.Spinner");
|
||||
const LoginHeader = sdk.getComponent("login.LoginHeader");
|
||||
const LoginFooter = sdk.getComponent("login.LoginFooter");
|
||||
const ServerConfig = sdk.getComponent("login.ServerConfig");
|
||||
const loader = this.state.busy ? <div className="mx_Login_loader"><Loader /></div> : null;
|
||||
|
||||
var loginAsGuestJsx;
|
||||
if (this.props.enableGuest) {
|
||||
loginAsGuestJsx =
|
||||
<a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
|
||||
Login as guest
|
||||
{ _t('Login as guest')}
|
||||
</a>;
|
||||
}
|
||||
|
||||
@@ -279,7 +314,7 @@ module.exports = React.createClass({
|
||||
if (this.props.onCancelClick) {
|
||||
returnToAppJsx =
|
||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||
Return to app
|
||||
{ _t('Return to app')}
|
||||
</a>;
|
||||
}
|
||||
|
||||
@@ -288,24 +323,23 @@ module.exports = React.createClass({
|
||||
<div className="mx_Login_box">
|
||||
<LoginHeader />
|
||||
<div>
|
||||
<h2>Sign in
|
||||
<h2>{ _t('Sign in')}
|
||||
{ loader }
|
||||
</h2>
|
||||
{ this.componentForStep(this._getCurrentFlowStep()) }
|
||||
{ this.componentForStep(this.state.currentFlow) }
|
||||
<ServerConfig ref="serverConfig"
|
||||
withToggleButton={true}
|
||||
customHsUrl={this.props.customHsUrl}
|
||||
customIsUrl={this.props.customIsUrl}
|
||||
defaultHsUrl={this.props.defaultHsUrl}
|
||||
defaultIsUrl={this.props.defaultIsUrl}
|
||||
onHsUrlChanged={this.onHsUrlChanged}
|
||||
onIsUrlChanged={this.onIsUrlChanged}
|
||||
onServerConfigChange={this.onServerConfigChange}
|
||||
delayTimeMs={1000}/>
|
||||
<div className="mx_Login_error">
|
||||
{ this.state.errorText }
|
||||
</div>
|
||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||
Create a new account
|
||||
{ _t('Create an account')}
|
||||
</a>
|
||||
{ loginAsGuestJsx }
|
||||
{ returnToAppJsx }
|
||||
|
||||
@@ -16,9 +16,10 @@ limitations under the License.
|
||||
|
||||
'use strict';
|
||||
|
||||
var React = require('react');
|
||||
var sdk = require('../../../index');
|
||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
module.exports = React.createClass({
|
||||
displayName: 'PostRegistration',
|
||||
@@ -49,7 +50,7 @@ module.exports = React.createClass({
|
||||
});
|
||||
}, function(error) {
|
||||
self.setState({
|
||||
errorString: "Failed to fetch avatar URL",
|
||||
errorString: _t("Failed to fetch avatar URL"),
|
||||
busy: false
|
||||
});
|
||||
});
|
||||
@@ -64,12 +65,12 @@ module.exports = React.createClass({
|
||||
<div className="mx_Login_box">
|
||||
<LoginHeader />
|
||||
<div className="mx_Login_profile">
|
||||
Set a display name:
|
||||
{ _t('Set a display name:') }
|
||||
<ChangeDisplayName />
|
||||
Upload an avatar:
|
||||
{ _t('Upload an avatar:') }
|
||||
<ChangeAvatar
|
||||
initialAvatarUrl={this.state.avatarUrl} />
|
||||
<button onClick={this.props.onComplete}>Continue</button>
|
||||
<button onClick={this.props.onComplete}>{ _t('Continue') }</button>
|
||||
{this.state.errorString}
|
||||
</div>
|
||||
</div>
|
||||
|
||||
@@ -21,12 +21,11 @@ import q from 'q';
|
||||
import React from 'react';
|
||||
|
||||
import sdk from '../../../index';
|
||||
import dis from '../../../dispatcher';
|
||||
import ServerConfig from '../../views/login/ServerConfig';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import RegistrationForm from '../../views/login/RegistrationForm';
|
||||
import CaptchaForm from '../../views/login/CaptchaForm';
|
||||
import RtsClient from '../../../RtsClient';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
const MIN_PASSWORD_LENGTH = 6;
|
||||
|
||||
@@ -46,8 +45,6 @@ module.exports = React.createClass({
|
||||
brand: React.PropTypes.string,
|
||||
email: React.PropTypes.string,
|
||||
referrer: React.PropTypes.string,
|
||||
username: React.PropTypes.string,
|
||||
guestAccessToken: React.PropTypes.string,
|
||||
teamServerConfig: React.PropTypes.shape({
|
||||
// Email address to request new teams
|
||||
supportEmail: React.PropTypes.string.isRequired,
|
||||
@@ -98,7 +95,7 @@ module.exports = React.createClass({
|
||||
this.props.teamServerConfig.teamServerURL &&
|
||||
!this._rtsClient
|
||||
) {
|
||||
this._rtsClient = new RtsClient(this.props.teamServerConfig.teamServerURL);
|
||||
this._rtsClient = this.props.rtsClient || new RtsClient(this.props.teamServerConfig.teamServerURL);
|
||||
|
||||
this.setState({
|
||||
teamServerBusy: true,
|
||||
@@ -123,18 +120,17 @@ module.exports = React.createClass({
|
||||
}
|
||||
},
|
||||
|
||||
onHsUrlChanged: function(newHsUrl) {
|
||||
this.setState({
|
||||
hsUrl: newHsUrl,
|
||||
onServerConfigChange: function(config) {
|
||||
let newState = {};
|
||||
if (config.hsUrl !== undefined) {
|
||||
newState.hsUrl = config.hsUrl;
|
||||
}
|
||||
if (config.isUrl !== undefined) {
|
||||
newState.isUrl = config.isUrl;
|
||||
}
|
||||
this.setState(newState, function() {
|
||||
this._replaceClient();
|
||||
});
|
||||
this._replaceClient();
|
||||
},
|
||||
|
||||
onIsUrlChanged: function(newIsUrl) {
|
||||
this.setState({
|
||||
isUrl: newIsUrl,
|
||||
});
|
||||
this._replaceClient();
|
||||
},
|
||||
|
||||
_replaceClient: function() {
|
||||
@@ -163,7 +159,7 @@ module.exports = React.createClass({
|
||||
msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
|
||||
}
|
||||
if (!msisdn_available) {
|
||||
msg = "This server does not support authentication with a phone number";
|
||||
msg = _t('This server does not support authentication with a phone number.');
|
||||
}
|
||||
}
|
||||
this.setState({
|
||||
@@ -222,30 +218,29 @@ module.exports = React.createClass({
|
||||
}
|
||||
|
||||
trackPromise.then((teamToken) => {
|
||||
console.info('Team token promise',teamToken);
|
||||
this.props.onLoggedIn({
|
||||
return this.props.onLoggedIn({
|
||||
userId: response.user_id,
|
||||
deviceId: response.device_id,
|
||||
homeserverUrl: this._matrixClient.getHomeserverUrl(),
|
||||
identityServerUrl: this._matrixClient.getIdentityServerUrl(),
|
||||
accessToken: response.access_token
|
||||
}, teamToken);
|
||||
}).then(() => {
|
||||
return this._setupPushers();
|
||||
}).then((cli) => {
|
||||
return this._setupPushers(cli);
|
||||
});
|
||||
},
|
||||
|
||||
_setupPushers: function() {
|
||||
_setupPushers: function(matrixClient) {
|
||||
if (!this.props.brand) {
|
||||
return q();
|
||||
}
|
||||
return MatrixClientPeg.get().getPushers().then((resp)=>{
|
||||
return matrixClient.getPushers().then((resp)=>{
|
||||
const pushers = resp.pushers;
|
||||
for (let i = 0; i < pushers.length; ++i) {
|
||||
if (pushers[i].kind == 'email') {
|
||||
const emailPusher = pushers[i];
|
||||
emailPusher.data = { brand: this.props.brand };
|
||||
MatrixClientPeg.get().setPusher(emailPusher).done(() => {
|
||||
matrixClient.setPusher(emailPusher).done(() => {
|
||||
console.log("Set email branding to " + this.props.brand);
|
||||
}, (error) => {
|
||||
console.error("Couldn't set email branding: " + error);
|
||||
@@ -261,29 +256,29 @@ module.exports = React.createClass({
|
||||
var errMsg;
|
||||
switch (errCode) {
|
||||
case "RegistrationForm.ERR_PASSWORD_MISSING":
|
||||
errMsg = "Missing password.";
|
||||
errMsg = _t('Missing password.');
|
||||
break;
|
||||
case "RegistrationForm.ERR_PASSWORD_MISMATCH":
|
||||
errMsg = "Passwords don't match.";
|
||||
errMsg = _t('Passwords don\'t match.');
|
||||
break;
|
||||
case "RegistrationForm.ERR_PASSWORD_LENGTH":
|
||||
errMsg = `Password too short (min ${MIN_PASSWORD_LENGTH}).`;
|
||||
errMsg = _t('Password too short (min %(MIN_PASSWORD_LENGTH)s).', {MIN_PASSWORD_LENGTH: MIN_PASSWORD_LENGTH});
|
||||
break;
|
||||
case "RegistrationForm.ERR_EMAIL_INVALID":
|
||||
errMsg = "This doesn't look like a valid email address";
|
||||
errMsg = _t('This doesn\'t look like a valid email address.');
|
||||
break;
|
||||
case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
|
||||
errMsg = "This doesn't look like a valid phone number";
|
||||
errMsg = _t('This doesn\'t look like a valid phone number.');
|
||||
break;
|
||||
case "RegistrationForm.ERR_USERNAME_INVALID":
|
||||
errMsg = "User names may only contain letters, numbers, dots, hyphens and underscores.";
|
||||
errMsg = _t('User names may only contain letters, numbers, dots, hyphens and underscores.');
|
||||
break;
|
||||
case "RegistrationForm.ERR_USERNAME_BLANK":
|
||||
errMsg = "You need to enter a user name";
|
||||
errMsg = _t('You need to enter a user name.');
|
||||
break;
|
||||
default:
|
||||
console.error("Unknown error code: %s", errCode);
|
||||
errMsg = "An unknown error occurred.";
|
||||
errMsg = _t('An unknown error occurred.');
|
||||
break;
|
||||
}
|
||||
this.setState({
|
||||
@@ -298,17 +293,6 @@ module.exports = React.createClass({
|
||||
},
|
||||
|
||||
_makeRegisterRequest: function(auth) {
|
||||
let guestAccessToken = this.props.guestAccessToken;
|
||||
|
||||
if (
|
||||
this.state.formVals.username !== this.props.username ||
|
||||
this.state.hsUrl != this.props.defaultHsUrl
|
||||
) {
|
||||
// don't try to upgrade if we changed our username
|
||||
// or are registering on a different HS
|
||||
guestAccessToken = null;
|
||||
}
|
||||
|
||||
// Only send the bind params if we're sending username / pw params
|
||||
// (Since we need to send no params at all to use the ones saved in the
|
||||
// session).
|
||||
@@ -323,7 +307,7 @@ module.exports = React.createClass({
|
||||
undefined, // session id: included in the auth dict already
|
||||
auth,
|
||||
bindThreepids,
|
||||
guestAccessToken,
|
||||
null,
|
||||
);
|
||||
},
|
||||
|
||||
@@ -360,10 +344,6 @@ module.exports = React.createClass({
|
||||
} else if (this.state.busy || this.state.teamServerBusy) {
|
||||
registerBody = <Spinner />;
|
||||
} else {
|
||||
let guestUsername = this.props.username;
|
||||
if (this.state.hsUrl != this.props.defaultHsUrl) {
|
||||
guestUsername = null;
|
||||
}
|
||||
let errorSection;
|
||||
if (this.state.errorText) {
|
||||
errorSection = <div className="mx_Login_error">{this.state.errorText}</div>;
|
||||
@@ -377,7 +357,6 @@ module.exports = React.createClass({
|
||||
defaultPhoneNumber={this.state.formVals.phoneNumber}
|
||||
defaultPassword={this.state.formVals.password}
|
||||
teamsConfig={this.state.teamsConfig}
|
||||
guestUsername={guestUsername}
|
||||
minPasswordLength={MIN_PASSWORD_LENGTH}
|
||||
onError={this.onFormValidationFailed}
|
||||
onRegisterClick={this.onFormSubmit}
|
||||
@@ -390,8 +369,7 @@ module.exports = React.createClass({
|
||||
customIsUrl={this.props.customIsUrl}
|
||||
defaultHsUrl={this.props.defaultHsUrl}
|
||||
defaultIsUrl={this.props.defaultIsUrl}
|
||||
onHsUrlChanged={this.onHsUrlChanged}
|
||||
onIsUrlChanged={this.onIsUrlChanged}
|
||||
onServerConfigChange={this.onServerConfigChange}
|
||||
delayTimeMs={1000}
|
||||
/>
|
||||
</div>
|
||||
@@ -402,7 +380,7 @@ module.exports = React.createClass({
|
||||
if (this.props.onCancelClick) {
|
||||
returnToAppJsx = (
|
||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||
Return to app
|
||||
{_t('Return to app')}
|
||||
</a>
|
||||
);
|
||||
}
|
||||
@@ -415,10 +393,10 @@ module.exports = React.createClass({
|
||||
this.state.teamSelected.domain + "/icon.png" :
|
||||
null}
|
||||
/>
|
||||
<h2>Create an account</h2>
|
||||
<h2>{_t('Create an account')}</h2>
|
||||
{registerBody}
|
||||
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
||||
I already have an account
|
||||
{_t('I already have an account')}
|
||||
</a>
|
||||
{returnToAppJsx}
|
||||
<LoginFooter />
|
||||
|
||||
@@ -32,6 +32,7 @@ module.exports = React.createClass({
|
||||
urls: React.PropTypes.array, // [highest_priority, ... , lowest_priority]
|
||||
width: React.PropTypes.number,
|
||||
height: React.PropTypes.number,
|
||||
// XXX resizeMethod not actually used.
|
||||
resizeMethod: React.PropTypes.string,
|
||||
defaultToInitialLetter: React.PropTypes.bool // true to add default url
|
||||
},
|
||||
|
||||
66
src/components/views/avatars/GroupAvatar.js
Normal file
66
src/components/views/avatars/GroupAvatar.js
Normal file
@@ -0,0 +1,66 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import sdk from '../../../index';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'GroupAvatar',
|
||||
|
||||
propTypes: {
|
||||
groupId: PropTypes.string,
|
||||
groupAvatarUrl: PropTypes.string,
|
||||
width: PropTypes.number,
|
||||
height: PropTypes.number,
|
||||
resizeMethod: PropTypes.string,
|
||||
},
|
||||
|
||||
getDefaultProps: function() {
|
||||
return {
|
||||
width: 36,
|
||||
height: 36,
|
||||
resizeMethod: 'crop',
|
||||
};
|
||||
},
|
||||
|
||||
getGroupAvatarUrl: function() {
|
||||
return MatrixClientPeg.get().mxcUrlToHttp(
|
||||
this.props.groupAvatarUrl,
|
||||
this.props.width,
|
||||
this.props.height,
|
||||
this.props.resizeMethod,
|
||||
);
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
|
||||
// extract the props we use from props so we can pass any others through
|
||||
// should consider adding this as a global rule in js-sdk?
|
||||
/*eslint no-unused-vars: ["error", { "ignoreRestSiblings": true }]*/
|
||||
const {groupId, groupAvatarUrl, ...otherProps} = this.props;
|
||||
|
||||
return (
|
||||
<BaseAvatar
|
||||
name={this.props.groupId[1]}
|
||||
idName={this.props.groupId}
|
||||
url={this.getGroupAvatarUrl()}
|
||||
{...otherProps}
|
||||
/>
|
||||
);
|
||||
},
|
||||
});
|
||||
@@ -59,7 +59,9 @@ module.exports = React.createClass({
|
||||
ContentRepo.getHttpUriForMxc(
|
||||
MatrixClientPeg.get().getHomeserverUrl(),
|
||||
props.oobData.avatarUrl,
|
||||
props.width, props.height, props.resizeMethod
|
||||
Math.floor(props.width * window.devicePixelRatio),
|
||||
Math.floor(props.height * window.devicePixelRatio),
|
||||
props.resizeMethod
|
||||
), // highest priority
|
||||
this.getRoomAvatarUrl(props),
|
||||
this.getOneToOneAvatar(props),
|
||||
@@ -74,7 +76,9 @@ module.exports = React.createClass({
|
||||
|
||||
return props.room.getAvatarUrl(
|
||||
MatrixClientPeg.get().getHomeserverUrl(),
|
||||
props.width, props.height, props.resizeMethod,
|
||||
Math.floor(props.width * window.devicePixelRatio),
|
||||
Math.floor(props.height * window.devicePixelRatio),
|
||||
props.resizeMethod,
|
||||
false
|
||||
);
|
||||
},
|
||||
@@ -103,14 +107,18 @@ module.exports = React.createClass({
|
||||
}
|
||||
return theOtherGuy.getAvatarUrl(
|
||||
MatrixClientPeg.get().getHomeserverUrl(),
|
||||
props.width, props.height, props.resizeMethod,
|
||||
Math.floor(props.width * window.devicePixelRatio),
|
||||
Math.floor(props.height * window.devicePixelRatio),
|
||||
props.resizeMethod,
|
||||
false
|
||||
);
|
||||
} else if (userIds.length == 1) {
|
||||
return mlist[userIds[0]].getAvatarUrl(
|
||||
MatrixClientPeg.get().getHomeserverUrl(),
|
||||
props.width, props.height, props.resizeMethod,
|
||||
false
|
||||
Math.floor(props.width * window.devicePixelRatio),
|
||||
Math.floor(props.height * window.devicePixelRatio),
|
||||
props.resizeMethod,
|
||||
false
|
||||
);
|
||||
} else {
|
||||
return null;
|
||||
|
||||
@@ -16,8 +16,8 @@ limitations under the License.
|
||||
|
||||
'use strict';
|
||||
|
||||
var React = require('react');
|
||||
|
||||
import React from 'react';
|
||||
import { _t } from '../../../languageHandler';
|
||||
module.exports = React.createClass({
|
||||
displayName: 'CreateRoomButton',
|
||||
propTypes: {
|
||||
@@ -36,7 +36,7 @@ module.exports = React.createClass({
|
||||
|
||||
render: function() {
|
||||
return (
|
||||
<button className="mx_CreateRoomButton" onClick={this.onClick}>Create Room</button>
|
||||
<button className="mx_CreateRoomButton" onClick={this.onClick}>{_t("Create Room")}</button>
|
||||
);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -17,6 +17,7 @@ limitations under the License.
|
||||
'use strict';
|
||||
|
||||
var React = require('react');
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
var Presets = {
|
||||
PrivateChat: "private_chat",
|
||||
@@ -46,9 +47,9 @@ module.exports = React.createClass({
|
||||
render: function() {
|
||||
return (
|
||||
<select className="mx_Presets" onChange={this.onValueChanged} value={this.props.preset}>
|
||||
<option value={this.Presets.PrivateChat}>Private Chat</option>
|
||||
<option value={this.Presets.PublicChat}>Public Chat</option>
|
||||
<option value={this.Presets.Custom}>Custom</option>
|
||||
<option value={this.Presets.PrivateChat}>{_t("Private Chat")}</option>
|
||||
<option value={this.Presets.PublicChat}>{_t("Public Chat")}</option>
|
||||
<option value={this.Presets.Custom}>{_t("Custom")}</option>
|
||||
</select>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -15,6 +15,7 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
var React = require('react');
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
module.exports = React.createClass({
|
||||
displayName: 'RoomAlias',
|
||||
@@ -94,7 +95,7 @@ module.exports = React.createClass({
|
||||
|
||||
render: function() {
|
||||
return (
|
||||
<input type="text" className="mx_RoomAlias" placeholder="Alias (optional)"
|
||||
<input type="text" className="mx_RoomAlias" placeholder={_t("Alias (optional)")}
|
||||
onChange={this.onValueChanged} onFocus={this.onFocus} onBlur={this.onBlur}
|
||||
value={this.props.alias}/>
|
||||
);
|
||||
|
||||
@@ -67,7 +67,7 @@ export default React.createClass({
|
||||
|
||||
render: function() {
|
||||
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||
|
||||
|
||||
return (
|
||||
<div onKeyDown={this._onKeyDown} className={this.props.className}>
|
||||
<AccessibleButton onClick={this._onCancelClick}
|
||||
|
||||
@@ -16,36 +16,30 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import dis from '../../../dispatcher';
|
||||
import { _t } from '../../../languageHandler';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||
import AccessibleButton from '../elements/AccessibleButton';
|
||||
import Unread from '../../../Unread';
|
||||
import classNames from 'classnames';
|
||||
import createRoom from '../../../createRoom';
|
||||
|
||||
export default class ChatCreateOrReuseDialog extends React.Component {
|
||||
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.onNewDMClick = this.onNewDMClick.bind(this);
|
||||
this.onRoomTileClick = this.onRoomTileClick.bind(this);
|
||||
|
||||
this.state = {
|
||||
tiles: [],
|
||||
profile: {
|
||||
displayName: null,
|
||||
avatarUrl: null,
|
||||
},
|
||||
profileError: null,
|
||||
};
|
||||
}
|
||||
|
||||
onNewDMClick() {
|
||||
createRoom({dmUserId: this.props.userId});
|
||||
this.props.onFinished(true);
|
||||
}
|
||||
|
||||
onRoomTileClick(roomId) {
|
||||
dis.dispatch({
|
||||
action: 'view_room',
|
||||
room_id: roomId,
|
||||
});
|
||||
this.props.onFinished(true);
|
||||
}
|
||||
|
||||
render() {
|
||||
componentWillMount() {
|
||||
const client = MatrixClientPeg.get();
|
||||
|
||||
const dmRoomMap = new DMRoomMap(client);
|
||||
@@ -70,40 +64,123 @@ export default class ChatCreateOrReuseDialog extends React.Component {
|
||||
highlight={highlight}
|
||||
isInvite={me.membership == "invite"}
|
||||
onClick={this.onRoomTileClick}
|
||||
/>
|
||||
/>,
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
const labelClasses = classNames({
|
||||
mx_MemberInfo_createRoom_label: true,
|
||||
mx_RoomTile_name: true,
|
||||
this.setState({
|
||||
tiles: tiles,
|
||||
});
|
||||
const startNewChat = <AccessibleButton
|
||||
className="mx_MemberInfo_createRoom"
|
||||
onClick={this.onNewDMClick}
|
||||
>
|
||||
<div className="mx_RoomTile_avatar">
|
||||
<img src="img/create-big.svg" width="26" height="26" />
|
||||
</div>
|
||||
<div className={labelClasses}><i>Start new chat</i></div>
|
||||
</AccessibleButton>;
|
||||
|
||||
if (tiles.length === 0) {
|
||||
this.setState({
|
||||
busyProfile: true,
|
||||
});
|
||||
MatrixClientPeg.get().getProfileInfo(this.props.userId).done((resp) => {
|
||||
const profile = {
|
||||
displayName: resp.displayname,
|
||||
avatarUrl: null,
|
||||
};
|
||||
if (resp.avatar_url) {
|
||||
profile.avatarUrl = MatrixClientPeg.get().mxcUrlToHttp(
|
||||
resp.avatar_url, 48, 48, "crop",
|
||||
);
|
||||
}
|
||||
this.setState({
|
||||
busyProfile: false,
|
||||
profile: profile,
|
||||
});
|
||||
}, (err) => {
|
||||
console.error(
|
||||
'Unable to get profile for user ' + this.props.userId + ':',
|
||||
err,
|
||||
);
|
||||
this.setState({
|
||||
busyProfile: false,
|
||||
profileError: err,
|
||||
});
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
onRoomTileClick(roomId) {
|
||||
this.props.onExistingRoomSelected(roomId);
|
||||
}
|
||||
|
||||
render() {
|
||||
let title = '';
|
||||
let content = null;
|
||||
if (this.state.tiles.length > 0) {
|
||||
// Show the existing rooms with a "+" to add a new dm
|
||||
title = _t('Create a new chat or reuse an existing one');
|
||||
const labelClasses = classNames({
|
||||
mx_MemberInfo_createRoom_label: true,
|
||||
mx_RoomTile_name: true,
|
||||
});
|
||||
const startNewChat = <AccessibleButton
|
||||
className="mx_MemberInfo_createRoom"
|
||||
onClick={this.props.onNewDMClick}
|
||||
>
|
||||
<div className="mx_RoomTile_avatar">
|
||||
<img src="img/create-big.svg" width="26" height="26" />
|
||||
</div>
|
||||
<div className={labelClasses}><i>{ _t("Start new chat") }</i></div>
|
||||
</AccessibleButton>;
|
||||
content = <div className="mx_Dialog_content">
|
||||
{ _t('You already have existing direct chats with this user:') }
|
||||
<div className="mx_ChatCreateOrReuseDialog_tiles">
|
||||
{ this.state.tiles }
|
||||
{ startNewChat }
|
||||
</div>
|
||||
</div>;
|
||||
} else {
|
||||
// Show the avatar, name and a button to confirm that a new chat is requested
|
||||
const BaseAvatar = sdk.getComponent('avatars.BaseAvatar');
|
||||
const Spinner = sdk.getComponent('elements.Spinner');
|
||||
title = _t('Start chatting');
|
||||
|
||||
let profile = null;
|
||||
if (this.state.busyProfile) {
|
||||
profile = <Spinner />;
|
||||
} else if (this.state.profileError) {
|
||||
profile = <div className="error">
|
||||
Unable to load profile information for { this.props.userId }
|
||||
</div>;
|
||||
} else {
|
||||
profile = <div className="mx_ChatCreateOrReuseDialog_profile">
|
||||
<BaseAvatar
|
||||
name={this.state.profile.displayName || this.props.userId}
|
||||
url={this.state.profile.avatarUrl}
|
||||
width={48} height={48}
|
||||
/>
|
||||
<div className="mx_ChatCreateOrReuseDialog_profile_name">
|
||||
{this.state.profile.displayName || this.props.userId}
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
content = <div>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>
|
||||
{ _t('Click on the button below to start chatting!') }
|
||||
</p>
|
||||
{ profile }
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={this.props.onNewDMClick}>
|
||||
{ _t('Start Chatting') }
|
||||
</button>
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
return (
|
||||
<BaseDialog className='mx_ChatCreateOrReuseDialog'
|
||||
onFinished={() => {
|
||||
this.props.onFinished(false)
|
||||
}}
|
||||
title='Create a new chat or reuse an existing one'
|
||||
onFinished={ this.props.onFinished.bind(false) }
|
||||
title={title}
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
You already have existing direct chats with this user:
|
||||
<div className="mx_ChatCreateOrReuseDialog_tiles">
|
||||
{tiles}
|
||||
{startNewChat}
|
||||
</div>
|
||||
</div>
|
||||
{ content }
|
||||
</BaseDialog>
|
||||
);
|
||||
}
|
||||
@@ -111,5 +188,8 @@ export default class ChatCreateOrReuseDialog extends React.Component {
|
||||
|
||||
ChatCreateOrReuseDialog.propTyps = {
|
||||
userId: React.PropTypes.string.isRequired,
|
||||
// Called when clicking outside of the dialog
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
onNewDMClick: React.PropTypes.func.isRequired,
|
||||
onExistingRoomSelected: React.PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
@@ -15,25 +15,24 @@ limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import classNames from 'classnames';
|
||||
import { _t } from '../../../languageHandler';
|
||||
import sdk from '../../../index';
|
||||
import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
|
||||
import createRoom from '../../../createRoom';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||
import rate_limited_func from '../../../ratelimitedfunc';
|
||||
import dis from '../../../dispatcher';
|
||||
import Modal from '../../../Modal';
|
||||
import AccessibleButton from '../elements/AccessibleButton';
|
||||
import q from 'q';
|
||||
import Fuse from 'fuse.js';
|
||||
import dis from '../../../dispatcher';
|
||||
|
||||
const TRUNCATE_QUERY_LIST = 40;
|
||||
const QUERY_USER_DIRECTORY_DEBOUNCE_MS = 200;
|
||||
|
||||
module.exports = React.createClass({
|
||||
displayName: "ChatInviteDialog",
|
||||
propTypes: {
|
||||
title: React.PropTypes.string,
|
||||
title: React.PropTypes.string.isRequired,
|
||||
description: React.PropTypes.oneOfType([
|
||||
React.PropTypes.element,
|
||||
React.PropTypes.string,
|
||||
@@ -43,17 +42,13 @@ module.exports = React.createClass({
|
||||
roomId: React.PropTypes.string,
|
||||
button: React.PropTypes.string,
|
||||
focus: React.PropTypes.bool,
|
||||
onFinished: React.PropTypes.func.isRequired
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getDefaultProps: function() {
|
||||
return {
|
||||
title: "Start a chat",
|
||||
description: "Who would you like to communicate with?",
|
||||
value: "",
|
||||
placeholder: "Email, name or matrix ID",
|
||||
button: "Start Chat",
|
||||
focus: true
|
||||
focus: true,
|
||||
};
|
||||
},
|
||||
|
||||
@@ -61,12 +56,20 @@ module.exports = React.createClass({
|
||||
return {
|
||||
error: false,
|
||||
|
||||
// List of AddressTile.InviteAddressType objects represeting
|
||||
// List of AddressTile.InviteAddressType objects representing
|
||||
// the list of addresses we're going to invite
|
||||
inviteList: [],
|
||||
|
||||
// List of AddressTile.InviteAddressType objects represeting
|
||||
// the set of autocompletion results for the current search
|
||||
// Whether a search is ongoing
|
||||
busy: false,
|
||||
// An error message generated during the user directory search
|
||||
searchError: null,
|
||||
// Whether the server supports the user_directory API
|
||||
serverSupportsUserDirectory: true,
|
||||
// The query being searched for
|
||||
query: "",
|
||||
// List of AddressTile.InviteAddressType objects representing
|
||||
// the set of auto-completion results for the current search
|
||||
// query.
|
||||
queryList: [],
|
||||
};
|
||||
@@ -77,20 +80,6 @@ module.exports = React.createClass({
|
||||
// Set the cursor at the end of the text input
|
||||
this.refs.textinput.value = this.props.value;
|
||||
}
|
||||
// Create a Fuse instance for fuzzy searching this._userList
|
||||
this._fuse = new Fuse(
|
||||
// Use an empty list at first that will later be populated
|
||||
// (see this._updateUserList)
|
||||
[],
|
||||
{
|
||||
shouldSort: true,
|
||||
location: 0, // The index of the query in the test string
|
||||
distance: 5, // The distance away from location the query can be
|
||||
// 0.0 = exact match, 1.0 = match anything
|
||||
threshold: 0.3,
|
||||
}
|
||||
);
|
||||
this._updateUserList();
|
||||
},
|
||||
|
||||
onButtonClick: function() {
|
||||
@@ -112,17 +101,28 @@ module.exports = React.createClass({
|
||||
// A Direct Message room already exists for this user, so select a
|
||||
// room from a list that is similar to the one in MemberInfo panel
|
||||
const ChatCreateOrReuseDialog = sdk.getComponent(
|
||||
"views.dialogs.ChatCreateOrReuseDialog"
|
||||
"views.dialogs.ChatCreateOrReuseDialog",
|
||||
);
|
||||
Modal.createDialog(ChatCreateOrReuseDialog, {
|
||||
const close = Modal.createDialog(ChatCreateOrReuseDialog, {
|
||||
userId: userId,
|
||||
onFinished: (success) => {
|
||||
if (success) {
|
||||
this.props.onFinished(true, inviteList[0]);
|
||||
}
|
||||
// else show this ChatInviteDialog again
|
||||
}
|
||||
});
|
||||
this.props.onFinished(success);
|
||||
},
|
||||
onNewDMClick: () => {
|
||||
dis.dispatch({
|
||||
action: 'start_chat',
|
||||
user_id: userId,
|
||||
});
|
||||
close(true);
|
||||
},
|
||||
onExistingRoomSelected: (roomId) => {
|
||||
dis.dispatch({
|
||||
action: 'view_room',
|
||||
room_id: roomId,
|
||||
});
|
||||
close(true);
|
||||
},
|
||||
}).close;
|
||||
} else {
|
||||
this._startChat(inviteList);
|
||||
}
|
||||
@@ -148,15 +148,15 @@ module.exports = React.createClass({
|
||||
} else if (e.keyCode === 38) { // up arrow
|
||||
e.stopPropagation();
|
||||
e.preventDefault();
|
||||
this.addressSelector.moveSelectionUp();
|
||||
if (this.addressSelector) this.addressSelector.moveSelectionUp();
|
||||
} else if (e.keyCode === 40) { // down arrow
|
||||
e.stopPropagation();
|
||||
e.preventDefault();
|
||||
this.addressSelector.moveSelectionDown();
|
||||
if (this.addressSelector) this.addressSelector.moveSelectionDown();
|
||||
} else if (this.state.queryList.length > 0 && (e.keyCode === 188 || e.keyCode === 13 || e.keyCode === 9)) { // comma or enter or tab
|
||||
e.stopPropagation();
|
||||
e.preventDefault();
|
||||
this.addressSelector.chooseSelection();
|
||||
if (this.addressSelector) this.addressSelector.chooseSelection();
|
||||
} else if (this.refs.textinput.value.length === 0 && this.state.inviteList.length && e.keyCode === 8) { // backspace
|
||||
e.stopPropagation();
|
||||
e.preventDefault();
|
||||
@@ -179,71 +179,36 @@ module.exports = React.createClass({
|
||||
|
||||
onQueryChanged: function(ev) {
|
||||
const query = ev.target.value;
|
||||
let queryList = [];
|
||||
|
||||
if (query.length < 2) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (this.queryChangedDebouncer) {
|
||||
clearTimeout(this.queryChangedDebouncer);
|
||||
}
|
||||
this.queryChangedDebouncer = setTimeout(() => {
|
||||
// Only do search if there is something to search
|
||||
if (query.length > 0 && query != '@') {
|
||||
// Weighted keys prefer to match userIds when first char is @
|
||||
this._fuse.options.keys = [{
|
||||
name: 'displayName',
|
||||
weight: query[0] === '@' ? 0.1 : 0.9,
|
||||
},{
|
||||
name: 'userId',
|
||||
weight: query[0] === '@' ? 0.9 : 0.1,
|
||||
}];
|
||||
queryList = this._fuse.search(query).map((user) => {
|
||||
// Return objects, structure of which is defined
|
||||
// by InviteAddressType
|
||||
return {
|
||||
addressType: 'mx',
|
||||
address: user.userId,
|
||||
displayName: user.displayName,
|
||||
avatarMxc: user.avatarUrl,
|
||||
isKnown: true,
|
||||
}
|
||||
});
|
||||
|
||||
// If the query is a valid address, add an entry for that
|
||||
// This is important, otherwise there's no way to invite
|
||||
// a perfectly valid address if there are close matches.
|
||||
const addrType = getAddressType(query);
|
||||
if (addrType !== null) {
|
||||
queryList.unshift({
|
||||
addressType: addrType,
|
||||
address: query,
|
||||
isKnown: false,
|
||||
});
|
||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||
if (addrType == 'email') {
|
||||
this._lookupThreepid(addrType, query).done();
|
||||
}
|
||||
// Only do search if there is something to search
|
||||
if (query.length > 0 && query != '@' && query.length >= 2) {
|
||||
this.queryChangedDebouncer = setTimeout(() => {
|
||||
if (this.state.serverSupportsUserDirectory) {
|
||||
this._doUserDirectorySearch(query);
|
||||
} else {
|
||||
this._doLocalSearch(query);
|
||||
}
|
||||
}
|
||||
}, QUERY_USER_DIRECTORY_DEBOUNCE_MS);
|
||||
} else {
|
||||
this.setState({
|
||||
queryList: queryList,
|
||||
error: false,
|
||||
}, () => {
|
||||
this.addressSelector.moveSelectionTop();
|
||||
queryList: [],
|
||||
query: "",
|
||||
searchError: null,
|
||||
});
|
||||
}, 200);
|
||||
}
|
||||
},
|
||||
|
||||
onDismissed: function(index) {
|
||||
var self = this;
|
||||
return function() {
|
||||
return () => {
|
||||
var inviteList = self.state.inviteList.slice();
|
||||
inviteList.splice(index, 1);
|
||||
self.setState({
|
||||
inviteList: inviteList,
|
||||
queryList: [],
|
||||
query: "",
|
||||
});
|
||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||
};
|
||||
@@ -262,10 +227,109 @@ module.exports = React.createClass({
|
||||
this.setState({
|
||||
inviteList: inviteList,
|
||||
queryList: [],
|
||||
query: "",
|
||||
});
|
||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||
},
|
||||
|
||||
_doUserDirectorySearch: function(query) {
|
||||
this.setState({
|
||||
busy: true,
|
||||
query,
|
||||
searchError: null,
|
||||
});
|
||||
MatrixClientPeg.get().searchUserDirectory({
|
||||
term: query,
|
||||
}).then((resp) => {
|
||||
// The query might have changed since we sent the request, so ignore
|
||||
// responses for anything other than the latest query.
|
||||
if (this.state.query !== query) {
|
||||
return;
|
||||
}
|
||||
this._processResults(resp.results, query);
|
||||
}).catch((err) => {
|
||||
console.error('Error whilst searching user directory: ', err);
|
||||
this.setState({
|
||||
searchError: err.errcode ? err.message : _t('Something went wrong!'),
|
||||
});
|
||||
if (err.errcode === 'M_UNRECOGNIZED') {
|
||||
this.setState({
|
||||
serverSupportsUserDirectory: false,
|
||||
});
|
||||
// Do a local search immediately
|
||||
this._doLocalSearch(query);
|
||||
}
|
||||
}).done(() => {
|
||||
this.setState({
|
||||
busy: false,
|
||||
});
|
||||
});
|
||||
},
|
||||
|
||||
_doLocalSearch: function(query) {
|
||||
this.setState({
|
||||
query,
|
||||
searchError: null,
|
||||
});
|
||||
const queryLowercase = query.toLowerCase();
|
||||
const results = [];
|
||||
MatrixClientPeg.get().getUsers().forEach((user) => {
|
||||
if (user.userId.toLowerCase().indexOf(queryLowercase) === -1 &&
|
||||
user.displayName.toLowerCase().indexOf(queryLowercase) === -1
|
||||
) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Put results in the format of the new API
|
||||
results.push({
|
||||
user_id: user.userId,
|
||||
display_name: user.displayName,
|
||||
avatar_url: user.avatarUrl,
|
||||
});
|
||||
});
|
||||
this._processResults(results, query);
|
||||
},
|
||||
|
||||
_processResults: function(results, query) {
|
||||
const queryList = [];
|
||||
results.forEach((user) => {
|
||||
if (user.user_id === MatrixClientPeg.get().credentials.userId) {
|
||||
return;
|
||||
}
|
||||
// Return objects, structure of which is defined
|
||||
// by InviteAddressType
|
||||
queryList.push({
|
||||
addressType: 'mx',
|
||||
address: user.user_id,
|
||||
displayName: user.display_name,
|
||||
avatarMxc: user.avatar_url,
|
||||
isKnown: true,
|
||||
});
|
||||
});
|
||||
|
||||
// If the query is a valid address, add an entry for that
|
||||
// This is important, otherwise there's no way to invite
|
||||
// a perfectly valid address if there are close matches.
|
||||
const addrType = getAddressType(query);
|
||||
if (addrType !== null) {
|
||||
queryList.unshift({
|
||||
addressType: addrType,
|
||||
address: query,
|
||||
isKnown: false,
|
||||
});
|
||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||
if (addrType == 'email') {
|
||||
this._lookupThreepid(addrType, query).done();
|
||||
}
|
||||
}
|
||||
this.setState({
|
||||
queryList,
|
||||
error: false,
|
||||
}, () => {
|
||||
if (this.addressSelector) this.addressSelector.moveSelectionTop();
|
||||
});
|
||||
},
|
||||
|
||||
_getDirectMessageRooms: function(addr) {
|
||||
const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
|
||||
const dmRooms = dmRoomMap.getDMRoomsForUserId(addr);
|
||||
@@ -284,11 +348,7 @@ module.exports = React.createClass({
|
||||
|
||||
_startChat: function(addrs) {
|
||||
if (MatrixClientPeg.get().isGuest()) {
|
||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||
Modal.createDialog(NeedToRegisterDialog, {
|
||||
title: "Please Register",
|
||||
description: "Guest users can't invite users. Please register."
|
||||
});
|
||||
dis.dispatch({action: 'view_set_mxid'});
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -308,8 +368,8 @@ module.exports = React.createClass({
|
||||
console.error(err.stack);
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Error",
|
||||
description: "Failed to invite",
|
||||
title: _t("Failed to invite"),
|
||||
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||
});
|
||||
return null;
|
||||
})
|
||||
@@ -321,8 +381,8 @@ module.exports = React.createClass({
|
||||
console.error(err.stack);
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Error",
|
||||
description: "Failed to invite user",
|
||||
title: _t("Failed to invite user"),
|
||||
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||
});
|
||||
return null;
|
||||
})
|
||||
@@ -342,8 +402,8 @@ module.exports = React.createClass({
|
||||
console.error(err.stack);
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Error",
|
||||
description: "Failed to invite",
|
||||
title: _t("Failed to invite"),
|
||||
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||
});
|
||||
return null;
|
||||
})
|
||||
@@ -354,18 +414,6 @@ module.exports = React.createClass({
|
||||
this.props.onFinished(true, addrTexts);
|
||||
},
|
||||
|
||||
_updateUserList: new rate_limited_func(function() {
|
||||
// Get all the users
|
||||
this._userList = MatrixClientPeg.get().getUsers();
|
||||
// Remove current user
|
||||
const meIx = this._userList.findIndex((u) => {
|
||||
return u.userId === MatrixClientPeg.get().credentials.userId;
|
||||
});
|
||||
this._userList.splice(meIx, 1);
|
||||
|
||||
this._fuse.set(this._userList);
|
||||
}, 500),
|
||||
|
||||
_isOnInviteList: function(uid) {
|
||||
for (let i = 0; i < this.state.inviteList.length; i++) {
|
||||
if (
|
||||
@@ -401,7 +449,7 @@ module.exports = React.createClass({
|
||||
if (errorList.length > 0) {
|
||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: "Failed to invite the following users to the " + room.name + " room:",
|
||||
title: _t("Failed to invite the following users to the %(roomName)s room:", {roomName: room.name}),
|
||||
description: errorList.join(", "),
|
||||
});
|
||||
}
|
||||
@@ -433,6 +481,7 @@ module.exports = React.createClass({
|
||||
this.setState({
|
||||
inviteList: inviteList,
|
||||
queryList: [],
|
||||
query: "",
|
||||
});
|
||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||
return inviteList;
|
||||
@@ -468,7 +517,7 @@ module.exports = React.createClass({
|
||||
displayName: res.displayname,
|
||||
avatarMxc: res.avatar_url,
|
||||
isKnown: true,
|
||||
}]
|
||||
}],
|
||||
});
|
||||
});
|
||||
},
|
||||
@@ -500,23 +549,27 @@ module.exports = React.createClass({
|
||||
placeholder={this.props.placeholder}
|
||||
defaultValue={this.props.value}
|
||||
autoFocus={this.props.focus}>
|
||||
</textarea>
|
||||
</textarea>,
|
||||
);
|
||||
|
||||
var error;
|
||||
var addressSelector;
|
||||
let error;
|
||||
let addressSelector;
|
||||
if (this.state.error) {
|
||||
error = <div className="mx_ChatInviteDialog_error">You have entered an invalid contact. Try using their Matrix ID or email address.</div>;
|
||||
error = <div className="mx_ChatInviteDialog_error">{_t("You have entered an invalid contact. Try using their Matrix ID or email address.")}</div>;
|
||||
} else if (this.state.searchError) {
|
||||
error = <div className="mx_ChatInviteDialog_error">{this.state.searchError}</div>;
|
||||
} else if (
|
||||
this.state.query.length > 0 &&
|
||||
this.state.queryList.length === 0 &&
|
||||
!this.state.busy
|
||||
) {
|
||||
error = <div className="mx_ChatInviteDialog_error">{_t("No results")}</div>;
|
||||
} else {
|
||||
const addressSelectorHeader = <div className="mx_ChatInviteDialog_addressSelectHeader">
|
||||
Searching known users
|
||||
</div>;
|
||||
addressSelector = (
|
||||
<AddressSelector ref={(ref) => {this.addressSelector = ref;}}
|
||||
addressList={ this.state.queryList }
|
||||
onSelected={ this.onSelected }
|
||||
truncateAt={ TRUNCATE_QUERY_LIST }
|
||||
header={ addressSelectorHeader }
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -17,6 +17,7 @@ limitations under the License.
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import classnames from 'classnames';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
/*
|
||||
* A dialog for confirming a redaction.
|
||||
@@ -42,7 +43,7 @@ export default React.createClass({
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
|
||||
const title = "Confirm Redaction";
|
||||
const title = _t("Confirm Removal");
|
||||
|
||||
const confirmButtonClass = classnames({
|
||||
'mx_Dialog_primary': true,
|
||||
@@ -55,16 +56,16 @@ export default React.createClass({
|
||||
title={title}
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
Are you sure you wish to redact (delete) this event?
|
||||
Note that if you redact a room name or topic change, it could undo the change.
|
||||
{_t("Are you sure you wish to remove (delete) this event? " +
|
||||
"Note that if you delete a room name or topic change, it could undo the change.")}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className={confirmButtonClass} onClick={this.onOk}>
|
||||
Redact
|
||||
{_t("Remove")}
|
||||
</button>
|
||||
|
||||
<button onClick={this.onCancel}>
|
||||
Cancel
|
||||
{_t("Cancel")}
|
||||
</button>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
|
||||
@@ -16,6 +16,7 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
import classnames from 'classnames';
|
||||
|
||||
/*
|
||||
@@ -69,7 +70,7 @@ export default React.createClass({
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
|
||||
|
||||
const title = this.props.action + " this person?";
|
||||
const title = _t("%(actionVerb)s this person?", { actionVerb: this.props.action});
|
||||
const confirmButtonClass = classnames({
|
||||
'mx_Dialog_primary': true,
|
||||
'danger': this.props.danger,
|
||||
@@ -82,7 +83,7 @@ export default React.createClass({
|
||||
<form onSubmit={this.onOk}>
|
||||
<input className="mx_ConfirmUserActionDialog_reasonField"
|
||||
ref={this._collectReasonField}
|
||||
placeholder="Reason"
|
||||
placeholder={ _t("Reason") }
|
||||
autoFocus={true}
|
||||
/>
|
||||
</form>
|
||||
@@ -111,7 +112,7 @@ export default React.createClass({
|
||||
</button>
|
||||
|
||||
<button onClick={this.onCancel}>
|
||||
Cancel
|
||||
{ _t("Cancel") }
|
||||
</button>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
|
||||
199
src/components/views/dialogs/CreateGroupDialog.js
Normal file
199
src/components/views/dialogs/CreateGroupDialog.js
Normal file
@@ -0,0 +1,199 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import sdk from '../../../index';
|
||||
import dis from '../../../dispatcher';
|
||||
import { _t } from '../../../languageHandler';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
|
||||
// We match fairly liberally and leave it up to the server to reject if
|
||||
// there are invalid characters etc.
|
||||
const GROUP_REGEX = /^\+(.*?):(.*)$/;
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'CreateGroupDialog',
|
||||
propTypes: {
|
||||
onFinished: PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
groupName: '',
|
||||
groupId: '',
|
||||
groupError: null,
|
||||
creating: false,
|
||||
createError: null,
|
||||
};
|
||||
},
|
||||
|
||||
_onGroupNameChange: function(e) {
|
||||
this.setState({
|
||||
groupName: e.target.value,
|
||||
});
|
||||
},
|
||||
|
||||
_onGroupIdChange: function(e) {
|
||||
this.setState({
|
||||
groupId: e.target.value,
|
||||
});
|
||||
},
|
||||
|
||||
_onGroupIdBlur: function(e) {
|
||||
this._checkGroupId();
|
||||
},
|
||||
|
||||
_checkGroupId: function(e) {
|
||||
const parsedGroupId = this._parseGroupId(this.state.groupId);
|
||||
let error = null;
|
||||
if (parsedGroupId === null) {
|
||||
error = _t(
|
||||
"Group IDs must be of the form +localpart:%(domain)s",
|
||||
{domain: MatrixClientPeg.get().getDomain()},
|
||||
);
|
||||
} else {
|
||||
const domain = parsedGroupId[1];
|
||||
if (domain !== MatrixClientPeg.get().getDomain()) {
|
||||
error = _t(
|
||||
"It is currently only possible to create groups on your own home server: "+
|
||||
"use a group ID ending with %(domain)s",
|
||||
{domain: MatrixClientPeg.get().getDomain()},
|
||||
);
|
||||
}
|
||||
}
|
||||
this.setState({
|
||||
groupIdError: error,
|
||||
});
|
||||
return error;
|
||||
},
|
||||
|
||||
_onFormSubmit: function(e) {
|
||||
e.preventDefault();
|
||||
|
||||
if (this._checkGroupId()) return;
|
||||
|
||||
const parsedGroupId = this._parseGroupId(this.state.groupId);
|
||||
const profile = {};
|
||||
if (this.state.groupName !== '') {
|
||||
profile.name = this.state.groupName;
|
||||
}
|
||||
this.setState({creating: true});
|
||||
MatrixClientPeg.get().createGroup({
|
||||
localpart: parsedGroupId[0],
|
||||
profile: profile,
|
||||
}).then((result) => {
|
||||
dis.dispatch({
|
||||
action: 'view_group',
|
||||
group_id: result.group_id,
|
||||
});
|
||||
this.props.onFinished(true);
|
||||
}).catch((e) => {
|
||||
this.setState({createError: e});
|
||||
}).finally(() => {
|
||||
this.setState({creating: false});
|
||||
}).done();
|
||||
},
|
||||
|
||||
_onCancel: function() {
|
||||
this.props.onFinished(false);
|
||||
},
|
||||
|
||||
/**
|
||||
* Parse a string that may be a group ID
|
||||
* If the string is a valid group ID, return a list of [localpart, domain],
|
||||
* otherwise return null.
|
||||
*
|
||||
* @param {string} groupId The ID of the group
|
||||
* @return {string[]} array of localpart, domain
|
||||
*/
|
||||
_parseGroupId: function(groupId) {
|
||||
const matches = GROUP_REGEX.exec(this.state.groupId);
|
||||
if (!matches || matches.length < 3) {
|
||||
return null;
|
||||
}
|
||||
return [matches[1], matches[2]];
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const Spinner = sdk.getComponent('elements.Spinner');
|
||||
|
||||
if (this.state.creating) {
|
||||
return <Spinner />;
|
||||
}
|
||||
|
||||
let createErrorNode;
|
||||
if (this.state.createError) {
|
||||
// XXX: We should catch errcodes and give sensible i18ned messages for them,
|
||||
// rather than displaying what the server gives us, but synapse doesn't give
|
||||
// any yet.
|
||||
createErrorNode = <div className="error">
|
||||
<div>{_t('Room creation failed')}</div>
|
||||
<div>{this.state.createError.message}</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
return (
|
||||
<BaseDialog className="mx_CreateGroupDialog" onFinished={this.props.onFinished}
|
||||
onEnterPressed={this._onFormSubmit}
|
||||
title={_t('Create Group')}
|
||||
>
|
||||
<form onSubmit={this._onFormSubmit}>
|
||||
<div className="mx_Dialog_content">
|
||||
<div className="mx_CreateGroupDialog_inputRow">
|
||||
<div className="mx_CreateGroupDialog_label">
|
||||
<label htmlFor="groupname">{_t('Group Name')}</label>
|
||||
</div>
|
||||
<div>
|
||||
<input id="groupname" className="mx_CreateGroupDialog_input"
|
||||
autoFocus={true} size="64"
|
||||
placeholder={_t('Example')}
|
||||
onChange={this._onGroupNameChange}
|
||||
value={this.state.groupName}
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
<div className="mx_CreateGroupDialog_inputRow">
|
||||
<div className="mx_CreateGroupDialog_label">
|
||||
<label htmlFor="groupid">{_t('Group ID')}</label>
|
||||
</div>
|
||||
<div>
|
||||
<input id="groupid" className="mx_CreateGroupDialog_input"
|
||||
size="64"
|
||||
placeholder={_t('+example:%(domain)s', {domain: MatrixClientPeg.get().getDomain()})}
|
||||
onChange={this._onGroupIdChange}
|
||||
onBlur={this._onGroupIdBlur}
|
||||
value={this.state.groupId}
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
<div className="error">
|
||||
{this.state.groupIdError}
|
||||
</div>
|
||||
{createErrorNode}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button onClick={this._onCancel}>
|
||||
{ _t("Cancel") }
|
||||
</button>
|
||||
<input type="submit" value={_t('Create')} className="mx_Dialog_primary" />
|
||||
</div>
|
||||
</form>
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
@@ -20,6 +20,7 @@ import sdk from '../../../index';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import * as Lifecycle from '../../../Lifecycle';
|
||||
import Velocity from 'velocity-vector';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
export default class DeactivateAccountDialog extends React.Component {
|
||||
constructor(props, context) {
|
||||
@@ -56,10 +57,10 @@ export default class DeactivateAccountDialog extends React.Component {
|
||||
Lifecycle.onLoggedOut();
|
||||
this.props.onFinished(false);
|
||||
}, (err) => {
|
||||
let errStr = 'Unknown error';
|
||||
let errStr = _t('Unknown error');
|
||||
// https://matrix.org/jira/browse/SYN-744
|
||||
if (err.httpStatus == 401 || err.httpStatus == 403) {
|
||||
errStr = 'Incorrect password';
|
||||
errStr = _t('Incorrect password');
|
||||
Velocity(this._passwordField, "callout.shake", 300);
|
||||
}
|
||||
this.setState({
|
||||
@@ -85,29 +86,29 @@ export default class DeactivateAccountDialog extends React.Component {
|
||||
passwordBoxClass = 'error';
|
||||
}
|
||||
|
||||
const okLabel = this.state.busy ? <Loader /> : 'Deactivate Account';
|
||||
const okLabel = this.state.busy ? <Loader /> : _t('Deactivate Account');
|
||||
const okEnabled = this.state.confirmButtonEnabled && !this.state.busy;
|
||||
|
||||
let cancelButton = null;
|
||||
if (!this.state.busy) {
|
||||
cancelButton = <button onClick={this._onCancel} autoFocus={true}>
|
||||
Cancel
|
||||
{_t("Cancel")}
|
||||
</button>;
|
||||
}
|
||||
|
||||
return (
|
||||
<div className="mx_DeactivateAccountDialog">
|
||||
<div className="mx_Dialog_title danger">
|
||||
Deactivate Account
|
||||
{_t("Deactivate Account")}
|
||||
</div>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>This will make your account permanently unusable. You will not be able to re-register the same user ID.</p>
|
||||
<p>{_t("This will make your account permanently unusable. You will not be able to re-register the same user ID.")}</p>
|
||||
|
||||
<p>This action is irreversible.</p>
|
||||
<p>{_t("This action is irreversible.")}</p>
|
||||
|
||||
<p>To continue, please enter your password.</p>
|
||||
<p>{_t("To continue, please enter your password.")}</p>
|
||||
|
||||
<p>Password:</p>
|
||||
<p>{_t("Password")}:</p>
|
||||
<input
|
||||
type="password"
|
||||
onChange={this._onPasswordFieldChange}
|
||||
|
||||
77
src/components/views/dialogs/DeviceVerifyDialog.js
Normal file
77
src/components/views/dialogs/DeviceVerifyDialog.js
Normal file
@@ -0,0 +1,77 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import sdk from '../../../index';
|
||||
import * as FormattingUtils from '../../../utils/FormattingUtils';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
export default function DeviceVerifyDialog(props) {
|
||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
|
||||
const key = FormattingUtils.formatCryptoKey(props.device.getFingerprint());
|
||||
const body = (
|
||||
<div>
|
||||
<p>
|
||||
{_t("To verify that this device can be trusted, please contact its " +
|
||||
"owner using some other means (e.g. in person or a phone call) " +
|
||||
"and ask them whether the key they see in their User Settings " +
|
||||
"for this device matches the key below:")}
|
||||
</p>
|
||||
<div className="mx_UserSettings_cryptoSection">
|
||||
<ul>
|
||||
<li><label>{_t("Device name")}:</label> <span>{ props.device.getDisplayName() }</span></li>
|
||||
<li><label>{_t("Device ID")}:</label> <span><code>{ props.device.deviceId}</code></span></li>
|
||||
<li><label>{_t("Device key")}:</label> <span><code><b>{ key }</b></code></span></li>
|
||||
</ul>
|
||||
</div>
|
||||
<p>
|
||||
{_t("If it matches, press the verify button below. " +
|
||||
"If it doesn't, then someone else is intercepting this device " +
|
||||
"and you probably want to press the blacklist button instead.")}
|
||||
</p>
|
||||
<p>
|
||||
{_t("In future this verification process will be more sophisticated.")}
|
||||
</p>
|
||||
</div>
|
||||
);
|
||||
|
||||
function onFinished(confirm) {
|
||||
if (confirm) {
|
||||
MatrixClientPeg.get().setDeviceVerified(
|
||||
props.userId, props.device.deviceId, true,
|
||||
);
|
||||
}
|
||||
props.onFinished(confirm);
|
||||
}
|
||||
|
||||
return (
|
||||
<QuestionDialog
|
||||
title={_t("Verify device")}
|
||||
description={body}
|
||||
button={_t("I verify that the keys match")}
|
||||
onFinished={onFinished}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
DeviceVerifyDialog.propTypes = {
|
||||
userId: React.PropTypes.string.isRequired,
|
||||
device: React.PropTypes.object.isRequired,
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
};
|
||||
@@ -27,6 +27,7 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'ErrorDialog',
|
||||
@@ -43,24 +44,30 @@ export default React.createClass({
|
||||
|
||||
getDefaultProps: function() {
|
||||
return {
|
||||
title: "Error",
|
||||
description: "An error has occurred.",
|
||||
button: "OK",
|
||||
focus: true,
|
||||
title: null,
|
||||
description: null,
|
||||
button: null,
|
||||
};
|
||||
},
|
||||
|
||||
componentDidMount: function() {
|
||||
if (this.props.focus) {
|
||||
this.refs.button.focus();
|
||||
}
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
return (
|
||||
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
||||
title={this.props.title}>
|
||||
title={this.props.title || _t('Error')}>
|
||||
<div className="mx_Dialog_content">
|
||||
{this.props.description}
|
||||
{this.props.description || _t('An error has occurred.')}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={this.props.focus}>
|
||||
{this.props.button}
|
||||
<button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
|
||||
{this.props.button || _t('OK')}
|
||||
</button>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
|
||||
@@ -15,11 +15,10 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import Matrix from 'matrix-js-sdk';
|
||||
|
||||
import React from 'react';
|
||||
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
import AccessibleButton from '../elements/AccessibleButton';
|
||||
|
||||
@@ -46,12 +45,6 @@ export default React.createClass({
|
||||
title: React.PropTypes.string,
|
||||
},
|
||||
|
||||
getDefaultProps: function() {
|
||||
return {
|
||||
title: "Authentication",
|
||||
};
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
authError: null,
|
||||
@@ -85,7 +78,7 @@ export default React.createClass({
|
||||
<AccessibleButton onClick={this._onDismissClick}
|
||||
className="mx_UserSettings_button"
|
||||
>
|
||||
Dismiss
|
||||
{_t("Dismiss")}
|
||||
</AccessibleButton>
|
||||
</div>
|
||||
);
|
||||
@@ -105,7 +98,7 @@ export default React.createClass({
|
||||
return (
|
||||
<BaseDialog className="mx_InteractiveAuthDialog"
|
||||
onFinished={this.props.onFinished}
|
||||
title={this.state.authError ? 'Error' : this.props.title}
|
||||
title={this.state.authError ? 'Error' : (this.props.title || _t('Authentication'))}
|
||||
>
|
||||
{content}
|
||||
</BaseDialog>
|
||||
|
||||
172
src/components/views/dialogs/KeyShareDialog.js
Normal file
172
src/components/views/dialogs/KeyShareDialog.js
Normal file
@@ -0,0 +1,172 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import Modal from '../../../Modal';
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
/**
|
||||
* Dialog which asks the user whether they want to share their keys with
|
||||
* an unverified device.
|
||||
*
|
||||
* onFinished is called with `true` if the key should be shared, `false` if it
|
||||
* should not, and `undefined` if the dialog is cancelled. (In other words:
|
||||
* truthy: do the key share. falsy: don't share the keys).
|
||||
*/
|
||||
export default React.createClass({
|
||||
propTypes: {
|
||||
matrixClient: React.PropTypes.object.isRequired,
|
||||
userId: React.PropTypes.string.isRequired,
|
||||
deviceId: React.PropTypes.string.isRequired,
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
deviceInfo: null,
|
||||
wasNewDevice: false,
|
||||
};
|
||||
},
|
||||
|
||||
componentDidMount: function() {
|
||||
this._unmounted = false;
|
||||
const userId = this.props.userId;
|
||||
const deviceId = this.props.deviceId;
|
||||
|
||||
// give the client a chance to refresh the device list
|
||||
this.props.matrixClient.downloadKeys([userId], false).then((r) => {
|
||||
if (this._unmounted) { return; }
|
||||
|
||||
const deviceInfo = r[userId][deviceId];
|
||||
|
||||
if(!deviceInfo) {
|
||||
console.warn(`No details found for device ${userId}:${deviceId}`);
|
||||
|
||||
this.props.onFinished(false);
|
||||
return;
|
||||
}
|
||||
|
||||
const wasNewDevice = !deviceInfo.isKnown();
|
||||
|
||||
this.setState({
|
||||
deviceInfo: deviceInfo,
|
||||
wasNewDevice: wasNewDevice,
|
||||
});
|
||||
|
||||
// if the device was new before, it's not any more.
|
||||
if (wasNewDevice) {
|
||||
this.props.matrixClient.setDeviceKnown(
|
||||
userId,
|
||||
deviceId,
|
||||
true,
|
||||
);
|
||||
}
|
||||
}).done();
|
||||
},
|
||||
|
||||
componentWillUnmount: function() {
|
||||
this._unmounted = true;
|
||||
},
|
||||
|
||||
|
||||
_onVerifyClicked: function() {
|
||||
const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
|
||||
|
||||
console.log("KeyShareDialog: Starting verify dialog");
|
||||
Modal.createDialog(DeviceVerifyDialog, {
|
||||
userId: this.props.userId,
|
||||
device: this.state.deviceInfo,
|
||||
onFinished: (verified) => {
|
||||
if (verified) {
|
||||
// can automatically share the keys now.
|
||||
this.props.onFinished(true);
|
||||
}
|
||||
},
|
||||
});
|
||||
},
|
||||
|
||||
_onShareClicked: function() {
|
||||
console.log("KeyShareDialog: User clicked 'share'");
|
||||
this.props.onFinished(true);
|
||||
},
|
||||
|
||||
_onIgnoreClicked: function() {
|
||||
console.log("KeyShareDialog: User clicked 'ignore'");
|
||||
this.props.onFinished(false);
|
||||
},
|
||||
|
||||
_renderContent: function() {
|
||||
const displayName = this.state.deviceInfo.getDisplayName() ||
|
||||
this.state.deviceInfo.deviceId;
|
||||
|
||||
let text;
|
||||
if (this.state.wasNewDevice) {
|
||||
text = "You added a new device '%(displayName)s', which is"
|
||||
+ " requesting encryption keys.";
|
||||
} else {
|
||||
text = "Your unverified device '%(displayName)s' is requesting"
|
||||
+ " encryption keys.";
|
||||
}
|
||||
text = _t(text, {displayName: displayName});
|
||||
|
||||
return (
|
||||
<div>
|
||||
<p>{text}</p>
|
||||
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button onClick={this._onVerifyClicked}>
|
||||
{_t('Start verification')}
|
||||
</button>
|
||||
<button onClick={this._onShareClicked}>
|
||||
{_t('Share without verifying')}
|
||||
</button>
|
||||
<button onClick={this._onIgnoreClicked}>
|
||||
{_t('Ignore request')}
|
||||
</button>
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const Spinner = sdk.getComponent('views.elements.Spinner');
|
||||
|
||||
let content;
|
||||
|
||||
if (this.state.deviceInfo) {
|
||||
content = this._renderContent();
|
||||
} else {
|
||||
content = (
|
||||
<div>
|
||||
<p>{_t('Loading device info...')}</p>
|
||||
<Spinner />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
return (
|
||||
<BaseDialog className='mx_KeyShareRequestDialog'
|
||||
onFinished={this.props.onFinished}
|
||||
title={_t('Encryption key request')}
|
||||
>
|
||||
{content}
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
@@ -1,78 +0,0 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
/*
|
||||
* Usage:
|
||||
* Modal.createDialog(NeedToRegisterDialog, {
|
||||
* title: "some text", (default: "Registration required")
|
||||
* description: "some more text",
|
||||
* onFinished: someFunction,
|
||||
* });
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import dis from '../../../dispatcher';
|
||||
import sdk from '../../../index';
|
||||
|
||||
module.exports = React.createClass({
|
||||
displayName: 'NeedToRegisterDialog',
|
||||
propTypes: {
|
||||
title: React.PropTypes.string,
|
||||
description: React.PropTypes.oneOfType([
|
||||
React.PropTypes.element,
|
||||
React.PropTypes.string,
|
||||
]),
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getDefaultProps: function() {
|
||||
return {
|
||||
title: "Registration required",
|
||||
description: "A registered account is required for this action",
|
||||
};
|
||||
},
|
||||
|
||||
onRegisterClicked: function() {
|
||||
dis.dispatch({
|
||||
action: "start_upgrade_registration",
|
||||
});
|
||||
if (this.props.onFinished) {
|
||||
this.props.onFinished();
|
||||
}
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
return (
|
||||
<BaseDialog className="mx_NeedToRegisterDialog"
|
||||
onFinished={this.props.onFinished}
|
||||
title={this.props.title}
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
{this.props.description}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={true}>
|
||||
Cancel
|
||||
</button>
|
||||
<button onClick={this.onRegisterClicked}>
|
||||
Register
|
||||
</button>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
@@ -16,6 +16,7 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'QuestionDialog',
|
||||
@@ -33,7 +34,6 @@ export default React.createClass({
|
||||
title: "",
|
||||
description: "",
|
||||
extraButtons: null,
|
||||
button: "OK",
|
||||
focus: true,
|
||||
hasCancelButton: true,
|
||||
};
|
||||
@@ -51,7 +51,7 @@ export default React.createClass({
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const cancelButton = this.props.hasCancelButton ? (
|
||||
<button onClick={this.onCancel}>
|
||||
Cancel
|
||||
{_t("Cancel")}
|
||||
</button>
|
||||
) : null;
|
||||
return (
|
||||
@@ -64,7 +64,7 @@ export default React.createClass({
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={this.onOk} autoFocus={this.props.focus}>
|
||||
{this.props.button}
|
||||
{this.props.button || _t('OK')}
|
||||
</button>
|
||||
{this.props.extraButtons}
|
||||
{cancelButton}
|
||||
|
||||
@@ -18,6 +18,7 @@ import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import SdkConfig from '../../../SdkConfig';
|
||||
import Modal from '../../../Modal';
|
||||
import { _t, _tJsx } from '../../../languageHandler';
|
||||
|
||||
|
||||
export default React.createClass({
|
||||
@@ -43,29 +44,32 @@ export default React.createClass({
|
||||
|
||||
if (SdkConfig.get().bug_report_endpoint_url) {
|
||||
bugreport = (
|
||||
<p>Otherwise, <a onClick={this._sendBugReport} href='#'>
|
||||
click here</a> to send a bug report.
|
||||
<p>
|
||||
{_tJsx(
|
||||
"Otherwise, <a>click here</a> to send a bug report.",
|
||||
/<a>(.*?)<\/a>/, (sub) => <a onClick={this._sendBugReport} key="bugreport" href='#'>{sub}</a>,
|
||||
)}
|
||||
</p>
|
||||
);
|
||||
}
|
||||
|
||||
return (
|
||||
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
||||
title='Unable to restore session'>
|
||||
title={_t('Unable to restore session')}>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>We encountered an error trying to restore your previous session. If
|
||||
you continue, you will need to log in again, and encrypted chat
|
||||
history will be unreadable.</p>
|
||||
<p>{_t("We encountered an error trying to restore your previous session. If " +
|
||||
"you continue, you will need to log in again, and encrypted chat " +
|
||||
"history will be unreadable.")}</p>
|
||||
|
||||
<p>If you have previously used a more recent version of Riot, your session
|
||||
may be incompatible with this version. Close this window and return
|
||||
to the more recent version.</p>
|
||||
<p>{_t("If you have previously used a more recent version of Riot, your session " +
|
||||
"may be incompatible with this version. Close this window and return " +
|
||||
"to the more recent version.")}</p>
|
||||
|
||||
{bugreport}
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button className="mx_Dialog_primary" onClick={this._continueClicked}>
|
||||
Continue anyway
|
||||
{_t("Continue anyway")}
|
||||
</button>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
|
||||
@@ -1,87 +0,0 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
|
||||
/**
|
||||
* Prompt the user to set a display name.
|
||||
*
|
||||
* On success, `onFinished(true, newDisplayName)` is called.
|
||||
*/
|
||||
export default React.createClass({
|
||||
displayName: 'SetDisplayNameDialog',
|
||||
propTypes: {
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
currentDisplayName: React.PropTypes.string,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
if (this.props.currentDisplayName) {
|
||||
return { value: this.props.currentDisplayName };
|
||||
}
|
||||
|
||||
if (MatrixClientPeg.get().isGuest()) {
|
||||
return { value : "Guest " + MatrixClientPeg.get().getUserIdLocalpart() };
|
||||
}
|
||||
else {
|
||||
return { value : MatrixClientPeg.get().getUserIdLocalpart() };
|
||||
}
|
||||
},
|
||||
|
||||
componentDidMount: function() {
|
||||
this.refs.input_value.select();
|
||||
},
|
||||
|
||||
onValueChange: function(ev) {
|
||||
this.setState({
|
||||
value: ev.target.value
|
||||
});
|
||||
},
|
||||
|
||||
onFormSubmit: function(ev) {
|
||||
ev.preventDefault();
|
||||
this.props.onFinished(true, this.state.value);
|
||||
return false;
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
return (
|
||||
<BaseDialog className="mx_SetDisplayNameDialog"
|
||||
onFinished={this.props.onFinished}
|
||||
title="Set a Display Name"
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
Your display name is how you'll appear to others when you speak in rooms.<br/>
|
||||
What would you like it to be?
|
||||
</div>
|
||||
<form onSubmit={this.onFormSubmit}>
|
||||
<div className="mx_Dialog_content">
|
||||
<input type="text" ref="input_value" value={this.state.value}
|
||||
autoFocus={true} onChange={this.onValueChange} size="30"
|
||||
className="mx_SetDisplayNameDialog_input"
|
||||
/>
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<input className="mx_Dialog_primary" type="submit" value="Set" />
|
||||
</div>
|
||||
</form>
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
164
src/components/views/dialogs/SetEmailDialog.js
Normal file
164
src/components/views/dialogs/SetEmailDialog.js
Normal file
@@ -0,0 +1,164 @@
|
||||
/*
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import Email from '../../../email';
|
||||
import AddThreepid from '../../../AddThreepid';
|
||||
import { _t } from '../../../languageHandler';
|
||||
import Modal from '../../../Modal';
|
||||
|
||||
|
||||
/**
|
||||
* Prompt the user to set an email address.
|
||||
*
|
||||
* On success, `onFinished(true)` is called.
|
||||
*/
|
||||
export default React.createClass({
|
||||
displayName: 'SetEmailDialog',
|
||||
propTypes: {
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
emailAddress: null,
|
||||
emailBusy: false,
|
||||
};
|
||||
},
|
||||
|
||||
componentDidMount: function() {
|
||||
},
|
||||
|
||||
onEmailAddressChanged: function(value) {
|
||||
this.setState({
|
||||
emailAddress: value,
|
||||
});
|
||||
},
|
||||
|
||||
onSubmit: function() {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
|
||||
const emailAddress = this.state.emailAddress;
|
||||
if (!Email.looksValid(emailAddress)) {
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: _t("Invalid Email Address"),
|
||||
description: _t("This doesn't appear to be a valid email address"),
|
||||
});
|
||||
return;
|
||||
}
|
||||
this._addThreepid = new AddThreepid();
|
||||
// we always bind emails when registering, so let's do the
|
||||
// same here.
|
||||
this._addThreepid.addEmailAddress(emailAddress, true).done(() => {
|
||||
Modal.createDialog(QuestionDialog, {
|
||||
title: _t("Verification Pending"),
|
||||
description: _t(
|
||||
"Please check your email and click on the link it contains. Once this " +
|
||||
"is done, click continue.",
|
||||
),
|
||||
button: _t('Continue'),
|
||||
onFinished: this.onEmailDialogFinished,
|
||||
});
|
||||
}, (err) => {
|
||||
this.setState({emailBusy: false});
|
||||
console.error("Unable to add email address " + emailAddress + " " + err);
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: _t("Unable to add email address"),
|
||||
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||
});
|
||||
});
|
||||
this.setState({emailBusy: true});
|
||||
},
|
||||
|
||||
onCancelled: function() {
|
||||
this.props.onFinished(false);
|
||||
},
|
||||
|
||||
onEmailDialogFinished: function(ok) {
|
||||
if (ok) {
|
||||
this.verifyEmailAddress();
|
||||
} else {
|
||||
this.setState({emailBusy: false});
|
||||
}
|
||||
},
|
||||
|
||||
verifyEmailAddress: function() {
|
||||
this._addThreepid.checkEmailLinkClicked().done(() => {
|
||||
this.props.onFinished(true);
|
||||
}, (err) => {
|
||||
this.setState({emailBusy: false});
|
||||
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||
const message = _t("Unable to verify email address.") + " " +
|
||||
_t("Please check your email and click on the link it contains. Once this is done, click continue.");
|
||||
Modal.createDialog(QuestionDialog, {
|
||||
title: _t("Verification Pending"),
|
||||
description: message,
|
||||
button: _t('Continue'),
|
||||
onFinished: this.onEmailDialogFinished,
|
||||
});
|
||||
} else {
|
||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||
console.error("Unable to verify email address: " + err);
|
||||
Modal.createDialog(ErrorDialog, {
|
||||
title: _t("Unable to verify email address."),
|
||||
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||
});
|
||||
}
|
||||
});
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const Spinner = sdk.getComponent('elements.Spinner');
|
||||
const EditableText = sdk.getComponent('elements.EditableText');
|
||||
|
||||
const emailInput = this.state.emailBusy ? <Spinner /> : <EditableText
|
||||
className="mx_SetEmailDialog_email_input"
|
||||
placeholder={ _t("Email address") }
|
||||
placeholderClassName="mx_SetEmailDialog_email_input_placeholder"
|
||||
blurToCancel={ false }
|
||||
onValueChanged={ this.onEmailAddressChanged } />;
|
||||
|
||||
return (
|
||||
<BaseDialog className="mx_SetEmailDialog"
|
||||
onFinished={this.onCancelled}
|
||||
title={this.props.title}
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
<p>
|
||||
{ _t('This will allow you to reset your password and receive notifications.') }
|
||||
</p>
|
||||
{ emailInput }
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<input className="mx_Dialog_primary"
|
||||
type="submit"
|
||||
value={_t("Continue")}
|
||||
onClick={this.onSubmit}
|
||||
/>
|
||||
<input
|
||||
type="submit"
|
||||
value={_t("Skip")}
|
||||
onClick={this.onCancelled}
|
||||
/>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
294
src/components/views/dialogs/SetMxIdDialog.js
Normal file
294
src/components/views/dialogs/SetMxIdDialog.js
Normal file
@@ -0,0 +1,294 @@
|
||||
/*
|
||||
Copyright 2016 OpenMarket Ltd
|
||||
Copyright 2017 Vector Creations Ltd
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
import q from 'q';
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import classnames from 'classnames';
|
||||
import KeyCode from '../../../KeyCode';
|
||||
import { _t, _tJsx } from '../../../languageHandler';
|
||||
|
||||
// The amount of time to wait for further changes to the input username before
|
||||
// sending a request to the server
|
||||
const USERNAME_CHECK_DEBOUNCE_MS = 250;
|
||||
|
||||
/**
|
||||
* Prompt the user to set a display name.
|
||||
*
|
||||
* On success, `onFinished(true, newDisplayName)` is called.
|
||||
*/
|
||||
export default React.createClass({
|
||||
displayName: 'SetMxIdDialog',
|
||||
propTypes: {
|
||||
onFinished: React.PropTypes.func.isRequired,
|
||||
// Called when the user requests to register with a different homeserver
|
||||
onDifferentServerClicked: React.PropTypes.func.isRequired,
|
||||
// Called if the user wants to switch to login instead
|
||||
onLoginClick: React.PropTypes.func.isRequired,
|
||||
},
|
||||
|
||||
getInitialState: function() {
|
||||
return {
|
||||
// The entered username
|
||||
username: '',
|
||||
// Indicate ongoing work on the username
|
||||
usernameBusy: false,
|
||||
// Indicate error with username
|
||||
usernameError: '',
|
||||
// Assume the homeserver supports username checking until "M_UNRECOGNIZED"
|
||||
usernameCheckSupport: true,
|
||||
|
||||
// Whether the auth UI is currently being used
|
||||
doingUIAuth: false,
|
||||
// Indicate error with auth
|
||||
authError: '',
|
||||
};
|
||||
},
|
||||
|
||||
componentDidMount: function() {
|
||||
this.refs.input_value.select();
|
||||
|
||||
this._matrixClient = MatrixClientPeg.get();
|
||||
},
|
||||
|
||||
onValueChange: function(ev) {
|
||||
this.setState({
|
||||
username: ev.target.value,
|
||||
usernameBusy: true,
|
||||
usernameError: '',
|
||||
}, () => {
|
||||
if (!this.state.username || !this.state.usernameCheckSupport) {
|
||||
this.setState({
|
||||
usernameBusy: false,
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
// Debounce the username check to limit number of requests sent
|
||||
if (this._usernameCheckTimeout) {
|
||||
clearTimeout(this._usernameCheckTimeout);
|
||||
}
|
||||
this._usernameCheckTimeout = setTimeout(() => {
|
||||
this._doUsernameCheck().finally(() => {
|
||||
this.setState({
|
||||
usernameBusy: false,
|
||||
});
|
||||
});
|
||||
}, USERNAME_CHECK_DEBOUNCE_MS);
|
||||
});
|
||||
},
|
||||
|
||||
onKeyUp: function(ev) {
|
||||
if (ev.keyCode === KeyCode.ENTER) {
|
||||
this.onSubmit();
|
||||
}
|
||||
},
|
||||
|
||||
onSubmit: function(ev) {
|
||||
this.setState({
|
||||
doingUIAuth: true,
|
||||
});
|
||||
},
|
||||
|
||||
_doUsernameCheck: function() {
|
||||
// Check if username is available
|
||||
return this._matrixClient.isUsernameAvailable(this.state.username).then(
|
||||
(isAvailable) => {
|
||||
if (isAvailable) {
|
||||
this.setState({usernameError: ''});
|
||||
}
|
||||
},
|
||||
(err) => {
|
||||
// Indicate whether the homeserver supports username checking
|
||||
const newState = {
|
||||
usernameCheckSupport: err.errcode !== "M_UNRECOGNIZED",
|
||||
};
|
||||
console.error('Error whilst checking username availability: ', err);
|
||||
switch (err.errcode) {
|
||||
case "M_USER_IN_USE":
|
||||
newState.usernameError = _t('Username not available');
|
||||
break;
|
||||
case "M_INVALID_USERNAME":
|
||||
newState.usernameError = _t(
|
||||
'Username invalid: %(errMessage)s',
|
||||
{ errMessage: err.message},
|
||||
);
|
||||
break;
|
||||
case "M_UNRECOGNIZED":
|
||||
// This homeserver doesn't support username checking, assume it's
|
||||
// fine and rely on the error appearing in registration step.
|
||||
newState.usernameError = '';
|
||||
break;
|
||||
case undefined:
|
||||
newState.usernameError = _t('Something went wrong!');
|
||||
break;
|
||||
default:
|
||||
newState.usernameError = _t(
|
||||
'An error occurred: %(error_string)s',
|
||||
{ error_string: err.message },
|
||||
);
|
||||
break;
|
||||
}
|
||||
this.setState(newState);
|
||||
},
|
||||
);
|
||||
},
|
||||
|
||||
_generatePassword: function() {
|
||||
return Math.random().toString(36).slice(2);
|
||||
},
|
||||
|
||||
_makeRegisterRequest: function(auth) {
|
||||
// Not upgrading - changing mxids
|
||||
const guestAccessToken = null;
|
||||
if (!this._generatedPassword) {
|
||||
this._generatedPassword = this._generatePassword();
|
||||
}
|
||||
return this._matrixClient.register(
|
||||
this.state.username,
|
||||
this._generatedPassword,
|
||||
undefined, // session id: included in the auth dict already
|
||||
auth,
|
||||
{},
|
||||
guestAccessToken,
|
||||
);
|
||||
},
|
||||
|
||||
_onUIAuthFinished: function(success, response) {
|
||||
this.setState({
|
||||
doingUIAuth: false,
|
||||
});
|
||||
|
||||
if (!success) {
|
||||
this.setState({ authError: response.message });
|
||||
return;
|
||||
}
|
||||
|
||||
// XXX Implement RTS /register here
|
||||
const teamToken = null;
|
||||
|
||||
this.props.onFinished(true, {
|
||||
userId: response.user_id,
|
||||
deviceId: response.device_id,
|
||||
homeserverUrl: this._matrixClient.getHomeserverUrl(),
|
||||
identityServerUrl: this._matrixClient.getIdentityServerUrl(),
|
||||
accessToken: response.access_token,
|
||||
password: this._generatedPassword,
|
||||
teamToken: teamToken,
|
||||
});
|
||||
},
|
||||
|
||||
render: function() {
|
||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||
const InteractiveAuth = sdk.getComponent('structures.InteractiveAuth');
|
||||
const Spinner = sdk.getComponent('elements.Spinner');
|
||||
|
||||
let auth;
|
||||
if (this.state.doingUIAuth) {
|
||||
auth = <InteractiveAuth
|
||||
matrixClient={this._matrixClient}
|
||||
makeRequest={this._makeRegisterRequest}
|
||||
onAuthFinished={this._onUIAuthFinished}
|
||||
inputs={{}}
|
||||
poll={true}
|
||||
/>;
|
||||
}
|
||||
const inputClasses = classnames({
|
||||
"mx_SetMxIdDialog_input": true,
|
||||
"error": Boolean(this.state.usernameError),
|
||||
});
|
||||
|
||||
let usernameIndicator = null;
|
||||
let usernameBusyIndicator = null;
|
||||
if (this.state.usernameBusy) {
|
||||
usernameBusyIndicator = <Spinner w="24" h="24"/>;
|
||||
} else {
|
||||
const usernameAvailable = this.state.username &&
|
||||
this.state.usernameCheckSupport && !this.state.usernameError;
|
||||
const usernameIndicatorClasses = classnames({
|
||||
"error": Boolean(this.state.usernameError),
|
||||
"success": usernameAvailable,
|
||||
});
|
||||
usernameIndicator = <div className={usernameIndicatorClasses}>
|
||||
{ usernameAvailable ? _t('Username available') : this.state.usernameError }
|
||||
</div>;
|
||||
}
|
||||
|
||||
let authErrorIndicator = null;
|
||||
if (this.state.authError) {
|
||||
authErrorIndicator = <div className="error">
|
||||
{ this.state.authError }
|
||||
</div>;
|
||||
}
|
||||
const canContinue = this.state.username &&
|
||||
!this.state.usernameError &&
|
||||
!this.state.usernameBusy;
|
||||
|
||||
return (
|
||||
<BaseDialog className="mx_SetMxIdDialog"
|
||||
onFinished={this.props.onFinished}
|
||||
title="To get started, please pick a username!"
|
||||
>
|
||||
<div className="mx_Dialog_content">
|
||||
<div className="mx_SetMxIdDialog_input_group">
|
||||
<input type="text" ref="input_value" value={this.state.username}
|
||||
autoFocus={true}
|
||||
onChange={this.onValueChange}
|
||||
onKeyUp={this.onKeyUp}
|
||||
size="30"
|
||||
className={inputClasses}
|
||||
/>
|
||||
{ usernameBusyIndicator }
|
||||
</div>
|
||||
{ usernameIndicator }
|
||||
<p>
|
||||
{ _tJsx(
|
||||
'This will be your account name on the <span></span> ' +
|
||||
'homeserver, or you can pick a <a>different server</a>.',
|
||||
[
|
||||
/<span><\/span>/,
|
||||
/<a>(.*?)<\/a>/,
|
||||
],
|
||||
[
|
||||
(sub) => <span>{this.props.homeserverUrl}</span>,
|
||||
(sub) => <a href="#" onClick={this.props.onDifferentServerClicked}>{sub}</a>,
|
||||
],
|
||||
)}
|
||||
</p>
|
||||
<p>
|
||||
{ _tJsx(
|
||||
'If you already have a Matrix account you can <a>log in</a> instead.',
|
||||
/<a>(.*?)<\/a>/,
|
||||
[(sub) => <a href="#" onClick={this.props.onLoginClick}>{sub}</a>],
|
||||
)}
|
||||
</p>
|
||||
{ auth }
|
||||
{ authErrorIndicator }
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<input className="mx_Dialog_primary"
|
||||
type="submit"
|
||||
value={_t("Continue")}
|
||||
onClick={this.onSubmit}
|
||||
disabled={!canContinue}
|
||||
/>
|
||||
</div>
|
||||
</BaseDialog>
|
||||
);
|
||||
},
|
||||
});
|
||||
@@ -16,6 +16,7 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
export default React.createClass({
|
||||
displayName: 'TextInputDialog',
|
||||
@@ -36,7 +37,6 @@ export default React.createClass({
|
||||
title: "",
|
||||
value: "",
|
||||
description: "",
|
||||
button: "OK",
|
||||
focus: true,
|
||||
};
|
||||
},
|
||||
@@ -73,7 +73,7 @@ export default React.createClass({
|
||||
</div>
|
||||
<div className="mx_Dialog_buttons">
|
||||
<button onClick={this.onCancel}>
|
||||
Cancel
|
||||
{ _t("Cancel") }
|
||||
</button>
|
||||
<button className="mx_Dialog_primary" onClick={this.onOk}>
|
||||
{this.props.button}
|
||||
|
||||
@@ -16,10 +16,10 @@ limitations under the License.
|
||||
|
||||
import React from 'react';
|
||||
import sdk from '../../../index';
|
||||
import dis from '../../../dispatcher';
|
||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||
import GeminiScrollbar from 'react-gemini-scrollbar';
|
||||
import Resend from '../../../Resend';
|
||||
import { _t } from '../../../languageHandler';
|
||||
|
||||
function DeviceListEntry(props) {
|
||||
const {userId, device} = props;
|
||||
@@ -120,17 +120,17 @@ export default React.createClass({
|
||||
if (blacklistUnverified) {
|
||||
warning = (
|
||||
<h4>
|
||||
You are currently blacklisting unverified devices; to send
|
||||
messages to these devices you must verify them.
|
||||
{_t("You are currently blacklisting unverified devices; to send " +
|
||||
"messages to these devices you must verify them.")}
|
||||
</h4>
|
||||
);
|
||||
} else {
|
||||
warning = (
|
||||
<div>
|
||||
<p>
|
||||
We recommend you go through the verification process
|
||||
for each device to confirm they belong to their legitimate owner,
|
||||
but you can resend the message without verifying if you prefer.
|
||||
{_t("We recommend you go through the verification process " +
|
||||
"for each device to confirm they belong to their legitimate owner, " +
|
||||
"but you can resend the message without verifying if you prefer.")}
|
||||
</p>
|
||||
</div>
|
||||
);
|
||||
@@ -145,14 +145,14 @@ export default React.createClass({
|
||||
console.log("UnknownDeviceDialog closed by escape");
|
||||
this.props.onFinished();
|
||||
}}
|
||||
title='Room contains unknown devices'
|
||||
title={_t('Room contains unknown devices')}
|
||||
>
|
||||
<GeminiScrollbar autoshow={false} className="mx_Dialog_content">
|
||||
<h4>
|
||||
This room contains devices that you haven't seen before.
|
||||
{_t('"%(RoomName)s" contains devices that you haven\'t seen before.', {RoomName: this.props.room.name})}
|
||||
</h4>
|
||||
{ warning }
|
||||
Unknown devices:
|
||||
{_t("Unknown devices")}:
|
||||
|
||||
<UnknownDeviceList devices={this.props.devices} />
|
||||
</GeminiScrollbar>
|
||||
@@ -162,7 +162,7 @@ export default React.createClass({
|
||||
this.props.onFinished();
|
||||
Resend.resendUnsentEvents(this.props.room);
|
||||
}}>
|
||||
Send anyway
|
||||
{_t("Send anyway")}
|
||||
</button>
|
||||
<button className="mx_Dialog_primary" autoFocus={ true }
|
||||
onClick={() => {
|
||||
|
||||
@@ -32,6 +32,8 @@ export default function AccessibleButton(props) {
|
||||
};
|
||||
restProps.tabIndex = restProps.tabIndex || "0";
|
||||
restProps.role = "button";
|
||||
restProps.className = (restProps.className ? restProps.className + " " : "") +
|
||||
"mx_AccessibleButton";
|
||||
return React.createElement(element, restProps, children);
|
||||
}
|
||||
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user